Файловый менеджер - Редактировать - /home/freeclou/app.optimyar.com/front-web/build/assets/fonts/iran-yekan/MobileFonts/wgdpf7/dist.tar
Назад
markdown-it.js 0000664 00001020144 15105452314 0007342 0 ustar 00 /*! markdown-it 12.2.0 https://github.com/markdown-it/markdown-it @license MIT */ (function(global, factory) { typeof exports === "object" && typeof module !== "undefined" ? module.exports = factory() : typeof define === "function" && define.amd ? define(factory) : (global = typeof globalThis !== "undefined" ? globalThis : global || self, global.markdownit = factory()); })(this, (function() { "use strict"; function createCommonjsModule(fn, basedir, module) { return module = { path: basedir, exports: {}, require: function(path, base) { return commonjsRequire(path, base === undefined || base === null ? module.path : base); } }, fn(module, module.exports), module.exports; } function getAugmentedNamespace(n) { if (n.__esModule) return n; var a = Object.defineProperty({}, "__esModule", { value: true }); Object.keys(n).forEach((function(k) { var d = Object.getOwnPropertyDescriptor(n, k); Object.defineProperty(a, k, d.get ? d : { enumerable: true, get: function() { return n[k]; } }); })); return a; } function commonjsRequire() { throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs"); } var require$$0 = { Aacute: "\xc1", aacute: "\xe1", Abreve: "\u0102", abreve: "\u0103", ac: "\u223e", acd: "\u223f", acE: "\u223e\u0333", Acirc: "\xc2", acirc: "\xe2", acute: "\xb4", Acy: "\u0410", acy: "\u0430", AElig: "\xc6", aelig: "\xe6", af: "\u2061", Afr: "\ud835\udd04", afr: "\ud835\udd1e", Agrave: "\xc0", agrave: "\xe0", alefsym: "\u2135", aleph: "\u2135", Alpha: "\u0391", alpha: "\u03b1", Amacr: "\u0100", amacr: "\u0101", amalg: "\u2a3f", amp: "&", AMP: "&", andand: "\u2a55", And: "\u2a53", and: "\u2227", andd: "\u2a5c", andslope: "\u2a58", andv: "\u2a5a", ang: "\u2220", ange: "\u29a4", angle: "\u2220", angmsdaa: "\u29a8", angmsdab: "\u29a9", angmsdac: "\u29aa", angmsdad: "\u29ab", angmsdae: "\u29ac", angmsdaf: "\u29ad", angmsdag: "\u29ae", angmsdah: "\u29af", angmsd: "\u2221", angrt: "\u221f", angrtvb: "\u22be", angrtvbd: "\u299d", angsph: "\u2222", angst: "\xc5", angzarr: "\u237c", Aogon: "\u0104", aogon: "\u0105", Aopf: "\ud835\udd38", aopf: "\ud835\udd52", apacir: "\u2a6f", ap: "\u2248", apE: "\u2a70", ape: "\u224a", apid: "\u224b", apos: "'", ApplyFunction: "\u2061", approx: "\u2248", approxeq: "\u224a", Aring: "\xc5", aring: "\xe5", Ascr: "\ud835\udc9c", ascr: "\ud835\udcb6", Assign: "\u2254", ast: "*", asymp: "\u2248", asympeq: "\u224d", Atilde: "\xc3", atilde: "\xe3", Auml: "\xc4", auml: "\xe4", awconint: "\u2233", awint: "\u2a11", backcong: "\u224c", backepsilon: "\u03f6", backprime: "\u2035", backsim: "\u223d", backsimeq: "\u22cd", Backslash: "\u2216", Barv: "\u2ae7", barvee: "\u22bd", barwed: "\u2305", Barwed: "\u2306", barwedge: "\u2305", bbrk: "\u23b5", bbrktbrk: "\u23b6", bcong: "\u224c", Bcy: "\u0411", bcy: "\u0431", bdquo: "\u201e", becaus: "\u2235", because: "\u2235", Because: "\u2235", bemptyv: "\u29b0", bepsi: "\u03f6", bernou: "\u212c", Bernoullis: "\u212c", Beta: "\u0392", beta: "\u03b2", beth: "\u2136", between: "\u226c", Bfr: "\ud835\udd05", bfr: "\ud835\udd1f", bigcap: "\u22c2", bigcirc: "\u25ef", bigcup: "\u22c3", bigodot: "\u2a00", bigoplus: "\u2a01", bigotimes: "\u2a02", bigsqcup: "\u2a06", bigstar: "\u2605", bigtriangledown: "\u25bd", bigtriangleup: "\u25b3", biguplus: "\u2a04", bigvee: "\u22c1", bigwedge: "\u22c0", bkarow: "\u290d", blacklozenge: "\u29eb", blacksquare: "\u25aa", blacktriangle: "\u25b4", blacktriangledown: "\u25be", blacktriangleleft: "\u25c2", blacktriangleright: "\u25b8", blank: "\u2423", blk12: "\u2592", blk14: "\u2591", blk34: "\u2593", block: "\u2588", bne: "=\u20e5", bnequiv: "\u2261\u20e5", bNot: "\u2aed", bnot: "\u2310", Bopf: "\ud835\udd39", bopf: "\ud835\udd53", bot: "\u22a5", bottom: "\u22a5", bowtie: "\u22c8", boxbox: "\u29c9", boxdl: "\u2510", boxdL: "\u2555", boxDl: "\u2556", boxDL: "\u2557", boxdr: "\u250c", boxdR: "\u2552", boxDr: "\u2553", boxDR: "\u2554", boxh: "\u2500", boxH: "\u2550", boxhd: "\u252c", boxHd: "\u2564", boxhD: "\u2565", boxHD: "\u2566", boxhu: "\u2534", boxHu: "\u2567", boxhU: "\u2568", boxHU: "\u2569", boxminus: "\u229f", boxplus: "\u229e", boxtimes: "\u22a0", boxul: "\u2518", boxuL: "\u255b", boxUl: "\u255c", boxUL: "\u255d", boxur: "\u2514", boxuR: "\u2558", boxUr: "\u2559", boxUR: "\u255a", boxv: "\u2502", boxV: "\u2551", boxvh: "\u253c", boxvH: "\u256a", boxVh: "\u256b", boxVH: "\u256c", boxvl: "\u2524", boxvL: "\u2561", boxVl: "\u2562", boxVL: "\u2563", boxvr: "\u251c", boxvR: "\u255e", boxVr: "\u255f", boxVR: "\u2560", bprime: "\u2035", breve: "\u02d8", Breve: "\u02d8", brvbar: "\xa6", bscr: "\ud835\udcb7", Bscr: "\u212c", bsemi: "\u204f", bsim: "\u223d", bsime: "\u22cd", bsolb: "\u29c5", bsol: "\\", bsolhsub: "\u27c8", bull: "\u2022", bullet: "\u2022", bump: "\u224e", bumpE: "\u2aae", bumpe: "\u224f", Bumpeq: "\u224e", bumpeq: "\u224f", Cacute: "\u0106", cacute: "\u0107", capand: "\u2a44", capbrcup: "\u2a49", capcap: "\u2a4b", cap: "\u2229", Cap: "\u22d2", capcup: "\u2a47", capdot: "\u2a40", CapitalDifferentialD: "\u2145", caps: "\u2229\ufe00", caret: "\u2041", caron: "\u02c7", Cayleys: "\u212d", ccaps: "\u2a4d", Ccaron: "\u010c", ccaron: "\u010d", Ccedil: "\xc7", ccedil: "\xe7", Ccirc: "\u0108", ccirc: "\u0109", Cconint: "\u2230", ccups: "\u2a4c", ccupssm: "\u2a50", Cdot: "\u010a", cdot: "\u010b", cedil: "\xb8", Cedilla: "\xb8", cemptyv: "\u29b2", cent: "\xa2", centerdot: "\xb7", CenterDot: "\xb7", cfr: "\ud835\udd20", Cfr: "\u212d", CHcy: "\u0427", chcy: "\u0447", check: "\u2713", checkmark: "\u2713", Chi: "\u03a7", chi: "\u03c7", circ: "\u02c6", circeq: "\u2257", circlearrowleft: "\u21ba", circlearrowright: "\u21bb", circledast: "\u229b", circledcirc: "\u229a", circleddash: "\u229d", CircleDot: "\u2299", circledR: "\xae", circledS: "\u24c8", CircleMinus: "\u2296", CirclePlus: "\u2295", CircleTimes: "\u2297", cir: "\u25cb", cirE: "\u29c3", cire: "\u2257", cirfnint: "\u2a10", cirmid: "\u2aef", cirscir: "\u29c2", ClockwiseContourIntegral: "\u2232", CloseCurlyDoubleQuote: "\u201d", CloseCurlyQuote: "\u2019", clubs: "\u2663", clubsuit: "\u2663", colon: ":", Colon: "\u2237", Colone: "\u2a74", colone: "\u2254", coloneq: "\u2254", comma: ",", commat: "@", comp: "\u2201", compfn: "\u2218", complement: "\u2201", complexes: "\u2102", cong: "\u2245", congdot: "\u2a6d", Congruent: "\u2261", conint: "\u222e", Conint: "\u222f", ContourIntegral: "\u222e", copf: "\ud835\udd54", Copf: "\u2102", coprod: "\u2210", Coproduct: "\u2210", copy: "\xa9", COPY: "\xa9", copysr: "\u2117", CounterClockwiseContourIntegral: "\u2233", crarr: "\u21b5", cross: "\u2717", Cross: "\u2a2f", Cscr: "\ud835\udc9e", cscr: "\ud835\udcb8", csub: "\u2acf", csube: "\u2ad1", csup: "\u2ad0", csupe: "\u2ad2", ctdot: "\u22ef", cudarrl: "\u2938", cudarrr: "\u2935", cuepr: "\u22de", cuesc: "\u22df", cularr: "\u21b6", cularrp: "\u293d", cupbrcap: "\u2a48", cupcap: "\u2a46", CupCap: "\u224d", cup: "\u222a", Cup: "\u22d3", cupcup: "\u2a4a", cupdot: "\u228d", cupor: "\u2a45", cups: "\u222a\ufe00", curarr: "\u21b7", curarrm: "\u293c", curlyeqprec: "\u22de", curlyeqsucc: "\u22df", curlyvee: "\u22ce", curlywedge: "\u22cf", curren: "\xa4", curvearrowleft: "\u21b6", curvearrowright: "\u21b7", cuvee: "\u22ce", cuwed: "\u22cf", cwconint: "\u2232", cwint: "\u2231", cylcty: "\u232d", dagger: "\u2020", Dagger: "\u2021", daleth: "\u2138", darr: "\u2193", Darr: "\u21a1", dArr: "\u21d3", dash: "\u2010", Dashv: "\u2ae4", dashv: "\u22a3", dbkarow: "\u290f", dblac: "\u02dd", Dcaron: "\u010e", dcaron: "\u010f", Dcy: "\u0414", dcy: "\u0434", ddagger: "\u2021", ddarr: "\u21ca", DD: "\u2145", dd: "\u2146", DDotrahd: "\u2911", ddotseq: "\u2a77", deg: "\xb0", Del: "\u2207", Delta: "\u0394", delta: "\u03b4", demptyv: "\u29b1", dfisht: "\u297f", Dfr: "\ud835\udd07", dfr: "\ud835\udd21", dHar: "\u2965", dharl: "\u21c3", dharr: "\u21c2", DiacriticalAcute: "\xb4", DiacriticalDot: "\u02d9", DiacriticalDoubleAcute: "\u02dd", DiacriticalGrave: "`", DiacriticalTilde: "\u02dc", diam: "\u22c4", diamond: "\u22c4", Diamond: "\u22c4", diamondsuit: "\u2666", diams: "\u2666", die: "\xa8", DifferentialD: "\u2146", digamma: "\u03dd", disin: "\u22f2", div: "\xf7", divide: "\xf7", divideontimes: "\u22c7", divonx: "\u22c7", DJcy: "\u0402", djcy: "\u0452", dlcorn: "\u231e", dlcrop: "\u230d", dollar: "$", Dopf: "\ud835\udd3b", dopf: "\ud835\udd55", Dot: "\xa8", dot: "\u02d9", DotDot: "\u20dc", doteq: "\u2250", doteqdot: "\u2251", DotEqual: "\u2250", dotminus: "\u2238", dotplus: "\u2214", dotsquare: "\u22a1", doublebarwedge: "\u2306", DoubleContourIntegral: "\u222f", DoubleDot: "\xa8", DoubleDownArrow: "\u21d3", DoubleLeftArrow: "\u21d0", DoubleLeftRightArrow: "\u21d4", DoubleLeftTee: "\u2ae4", DoubleLongLeftArrow: "\u27f8", DoubleLongLeftRightArrow: "\u27fa", DoubleLongRightArrow: "\u27f9", DoubleRightArrow: "\u21d2", DoubleRightTee: "\u22a8", DoubleUpArrow: "\u21d1", DoubleUpDownArrow: "\u21d5", DoubleVerticalBar: "\u2225", DownArrowBar: "\u2913", downarrow: "\u2193", DownArrow: "\u2193", Downarrow: "\u21d3", DownArrowUpArrow: "\u21f5", DownBreve: "\u0311", downdownarrows: "\u21ca", downharpoonleft: "\u21c3", downharpoonright: "\u21c2", DownLeftRightVector: "\u2950", DownLeftTeeVector: "\u295e", DownLeftVectorBar: "\u2956", DownLeftVector: "\u21bd", DownRightTeeVector: "\u295f", DownRightVectorBar: "\u2957", DownRightVector: "\u21c1", DownTeeArrow: "\u21a7", DownTee: "\u22a4", drbkarow: "\u2910", drcorn: "\u231f", drcrop: "\u230c", Dscr: "\ud835\udc9f", dscr: "\ud835\udcb9", DScy: "\u0405", dscy: "\u0455", dsol: "\u29f6", Dstrok: "\u0110", dstrok: "\u0111", dtdot: "\u22f1", dtri: "\u25bf", dtrif: "\u25be", duarr: "\u21f5", duhar: "\u296f", dwangle: "\u29a6", DZcy: "\u040f", dzcy: "\u045f", dzigrarr: "\u27ff", Eacute: "\xc9", eacute: "\xe9", easter: "\u2a6e", Ecaron: "\u011a", ecaron: "\u011b", Ecirc: "\xca", ecirc: "\xea", ecir: "\u2256", ecolon: "\u2255", Ecy: "\u042d", ecy: "\u044d", eDDot: "\u2a77", Edot: "\u0116", edot: "\u0117", eDot: "\u2251", ee: "\u2147", efDot: "\u2252", Efr: "\ud835\udd08", efr: "\ud835\udd22", eg: "\u2a9a", Egrave: "\xc8", egrave: "\xe8", egs: "\u2a96", egsdot: "\u2a98", el: "\u2a99", Element: "\u2208", elinters: "\u23e7", ell: "\u2113", els: "\u2a95", elsdot: "\u2a97", Emacr: "\u0112", emacr: "\u0113", empty: "\u2205", emptyset: "\u2205", EmptySmallSquare: "\u25fb", emptyv: "\u2205", EmptyVerySmallSquare: "\u25ab", emsp13: "\u2004", emsp14: "\u2005", emsp: "\u2003", ENG: "\u014a", eng: "\u014b", ensp: "\u2002", Eogon: "\u0118", eogon: "\u0119", Eopf: "\ud835\udd3c", eopf: "\ud835\udd56", epar: "\u22d5", eparsl: "\u29e3", eplus: "\u2a71", epsi: "\u03b5", Epsilon: "\u0395", epsilon: "\u03b5", epsiv: "\u03f5", eqcirc: "\u2256", eqcolon: "\u2255", eqsim: "\u2242", eqslantgtr: "\u2a96", eqslantless: "\u2a95", Equal: "\u2a75", equals: "=", EqualTilde: "\u2242", equest: "\u225f", Equilibrium: "\u21cc", equiv: "\u2261", equivDD: "\u2a78", eqvparsl: "\u29e5", erarr: "\u2971", erDot: "\u2253", escr: "\u212f", Escr: "\u2130", esdot: "\u2250", Esim: "\u2a73", esim: "\u2242", Eta: "\u0397", eta: "\u03b7", ETH: "\xd0", eth: "\xf0", Euml: "\xcb", euml: "\xeb", euro: "\u20ac", excl: "!", exist: "\u2203", Exists: "\u2203", expectation: "\u2130", exponentiale: "\u2147", ExponentialE: "\u2147", fallingdotseq: "\u2252", Fcy: "\u0424", fcy: "\u0444", female: "\u2640", ffilig: "\ufb03", fflig: "\ufb00", ffllig: "\ufb04", Ffr: "\ud835\udd09", ffr: "\ud835\udd23", filig: "\ufb01", FilledSmallSquare: "\u25fc", FilledVerySmallSquare: "\u25aa", fjlig: "fj", flat: "\u266d", fllig: "\ufb02", fltns: "\u25b1", fnof: "\u0192", Fopf: "\ud835\udd3d", fopf: "\ud835\udd57", forall: "\u2200", ForAll: "\u2200", fork: "\u22d4", forkv: "\u2ad9", Fouriertrf: "\u2131", fpartint: "\u2a0d", frac12: "\xbd", frac13: "\u2153", frac14: "\xbc", frac15: "\u2155", frac16: "\u2159", frac18: "\u215b", frac23: "\u2154", frac25: "\u2156", frac34: "\xbe", frac35: "\u2157", frac38: "\u215c", frac45: "\u2158", frac56: "\u215a", frac58: "\u215d", frac78: "\u215e", frasl: "\u2044", frown: "\u2322", fscr: "\ud835\udcbb", Fscr: "\u2131", gacute: "\u01f5", Gamma: "\u0393", gamma: "\u03b3", Gammad: "\u03dc", gammad: "\u03dd", gap: "\u2a86", Gbreve: "\u011e", gbreve: "\u011f", Gcedil: "\u0122", Gcirc: "\u011c", gcirc: "\u011d", Gcy: "\u0413", gcy: "\u0433", Gdot: "\u0120", gdot: "\u0121", ge: "\u2265", gE: "\u2267", gEl: "\u2a8c", gel: "\u22db", geq: "\u2265", geqq: "\u2267", geqslant: "\u2a7e", gescc: "\u2aa9", ges: "\u2a7e", gesdot: "\u2a80", gesdoto: "\u2a82", gesdotol: "\u2a84", gesl: "\u22db\ufe00", gesles: "\u2a94", Gfr: "\ud835\udd0a", gfr: "\ud835\udd24", gg: "\u226b", Gg: "\u22d9", ggg: "\u22d9", gimel: "\u2137", GJcy: "\u0403", gjcy: "\u0453", gla: "\u2aa5", gl: "\u2277", glE: "\u2a92", glj: "\u2aa4", gnap: "\u2a8a", gnapprox: "\u2a8a", gne: "\u2a88", gnE: "\u2269", gneq: "\u2a88", gneqq: "\u2269", gnsim: "\u22e7", Gopf: "\ud835\udd3e", gopf: "\ud835\udd58", grave: "`", GreaterEqual: "\u2265", GreaterEqualLess: "\u22db", GreaterFullEqual: "\u2267", GreaterGreater: "\u2aa2", GreaterLess: "\u2277", GreaterSlantEqual: "\u2a7e", GreaterTilde: "\u2273", Gscr: "\ud835\udca2", gscr: "\u210a", gsim: "\u2273", gsime: "\u2a8e", gsiml: "\u2a90", gtcc: "\u2aa7", gtcir: "\u2a7a", gt: ">", GT: ">", Gt: "\u226b", gtdot: "\u22d7", gtlPar: "\u2995", gtquest: "\u2a7c", gtrapprox: "\u2a86", gtrarr: "\u2978", gtrdot: "\u22d7", gtreqless: "\u22db", gtreqqless: "\u2a8c", gtrless: "\u2277", gtrsim: "\u2273", gvertneqq: "\u2269\ufe00", gvnE: "\u2269\ufe00", Hacek: "\u02c7", hairsp: "\u200a", half: "\xbd", hamilt: "\u210b", HARDcy: "\u042a", hardcy: "\u044a", harrcir: "\u2948", harr: "\u2194", hArr: "\u21d4", harrw: "\u21ad", Hat: "^", hbar: "\u210f", Hcirc: "\u0124", hcirc: "\u0125", hearts: "\u2665", heartsuit: "\u2665", hellip: "\u2026", hercon: "\u22b9", hfr: "\ud835\udd25", Hfr: "\u210c", HilbertSpace: "\u210b", hksearow: "\u2925", hkswarow: "\u2926", hoarr: "\u21ff", homtht: "\u223b", hookleftarrow: "\u21a9", hookrightarrow: "\u21aa", hopf: "\ud835\udd59", Hopf: "\u210d", horbar: "\u2015", HorizontalLine: "\u2500", hscr: "\ud835\udcbd", Hscr: "\u210b", hslash: "\u210f", Hstrok: "\u0126", hstrok: "\u0127", HumpDownHump: "\u224e", HumpEqual: "\u224f", hybull: "\u2043", hyphen: "\u2010", Iacute: "\xcd", iacute: "\xed", ic: "\u2063", Icirc: "\xce", icirc: "\xee", Icy: "\u0418", icy: "\u0438", Idot: "\u0130", IEcy: "\u0415", iecy: "\u0435", iexcl: "\xa1", iff: "\u21d4", ifr: "\ud835\udd26", Ifr: "\u2111", Igrave: "\xcc", igrave: "\xec", ii: "\u2148", iiiint: "\u2a0c", iiint: "\u222d", iinfin: "\u29dc", iiota: "\u2129", IJlig: "\u0132", ijlig: "\u0133", Imacr: "\u012a", imacr: "\u012b", image: "\u2111", ImaginaryI: "\u2148", imagline: "\u2110", imagpart: "\u2111", imath: "\u0131", Im: "\u2111", imof: "\u22b7", imped: "\u01b5", Implies: "\u21d2", incare: "\u2105", in: "\u2208", infin: "\u221e", infintie: "\u29dd", inodot: "\u0131", intcal: "\u22ba", int: "\u222b", Int: "\u222c", integers: "\u2124", Integral: "\u222b", intercal: "\u22ba", Intersection: "\u22c2", intlarhk: "\u2a17", intprod: "\u2a3c", InvisibleComma: "\u2063", InvisibleTimes: "\u2062", IOcy: "\u0401", iocy: "\u0451", Iogon: "\u012e", iogon: "\u012f", Iopf: "\ud835\udd40", iopf: "\ud835\udd5a", Iota: "\u0399", iota: "\u03b9", iprod: "\u2a3c", iquest: "\xbf", iscr: "\ud835\udcbe", Iscr: "\u2110", isin: "\u2208", isindot: "\u22f5", isinE: "\u22f9", isins: "\u22f4", isinsv: "\u22f3", isinv: "\u2208", it: "\u2062", Itilde: "\u0128", itilde: "\u0129", Iukcy: "\u0406", iukcy: "\u0456", Iuml: "\xcf", iuml: "\xef", Jcirc: "\u0134", jcirc: "\u0135", Jcy: "\u0419", jcy: "\u0439", Jfr: "\ud835\udd0d", jfr: "\ud835\udd27", jmath: "\u0237", Jopf: "\ud835\udd41", jopf: "\ud835\udd5b", Jscr: "\ud835\udca5", jscr: "\ud835\udcbf", Jsercy: "\u0408", jsercy: "\u0458", Jukcy: "\u0404", jukcy: "\u0454", Kappa: "\u039a", kappa: "\u03ba", kappav: "\u03f0", Kcedil: "\u0136", kcedil: "\u0137", Kcy: "\u041a", kcy: "\u043a", Kfr: "\ud835\udd0e", kfr: "\ud835\udd28", kgreen: "\u0138", KHcy: "\u0425", khcy: "\u0445", KJcy: "\u040c", kjcy: "\u045c", Kopf: "\ud835\udd42", kopf: "\ud835\udd5c", Kscr: "\ud835\udca6", kscr: "\ud835\udcc0", lAarr: "\u21da", Lacute: "\u0139", lacute: "\u013a", laemptyv: "\u29b4", lagran: "\u2112", Lambda: "\u039b", lambda: "\u03bb", lang: "\u27e8", Lang: "\u27ea", langd: "\u2991", langle: "\u27e8", lap: "\u2a85", Laplacetrf: "\u2112", laquo: "\xab", larrb: "\u21e4", larrbfs: "\u291f", larr: "\u2190", Larr: "\u219e", lArr: "\u21d0", larrfs: "\u291d", larrhk: "\u21a9", larrlp: "\u21ab", larrpl: "\u2939", larrsim: "\u2973", larrtl: "\u21a2", latail: "\u2919", lAtail: "\u291b", lat: "\u2aab", late: "\u2aad", lates: "\u2aad\ufe00", lbarr: "\u290c", lBarr: "\u290e", lbbrk: "\u2772", lbrace: "{", lbrack: "[", lbrke: "\u298b", lbrksld: "\u298f", lbrkslu: "\u298d", Lcaron: "\u013d", lcaron: "\u013e", Lcedil: "\u013b", lcedil: "\u013c", lceil: "\u2308", lcub: "{", Lcy: "\u041b", lcy: "\u043b", ldca: "\u2936", ldquo: "\u201c", ldquor: "\u201e", ldrdhar: "\u2967", ldrushar: "\u294b", ldsh: "\u21b2", le: "\u2264", lE: "\u2266", LeftAngleBracket: "\u27e8", LeftArrowBar: "\u21e4", leftarrow: "\u2190", LeftArrow: "\u2190", Leftarrow: "\u21d0", LeftArrowRightArrow: "\u21c6", leftarrowtail: "\u21a2", LeftCeiling: "\u2308", LeftDoubleBracket: "\u27e6", LeftDownTeeVector: "\u2961", LeftDownVectorBar: "\u2959", LeftDownVector: "\u21c3", LeftFloor: "\u230a", leftharpoondown: "\u21bd", leftharpoonup: "\u21bc", leftleftarrows: "\u21c7", leftrightarrow: "\u2194", LeftRightArrow: "\u2194", Leftrightarrow: "\u21d4", leftrightarrows: "\u21c6", leftrightharpoons: "\u21cb", leftrightsquigarrow: "\u21ad", LeftRightVector: "\u294e", LeftTeeArrow: "\u21a4", LeftTee: "\u22a3", LeftTeeVector: "\u295a", leftthreetimes: "\u22cb", LeftTriangleBar: "\u29cf", LeftTriangle: "\u22b2", LeftTriangleEqual: "\u22b4", LeftUpDownVector: "\u2951", LeftUpTeeVector: "\u2960", LeftUpVectorBar: "\u2958", LeftUpVector: "\u21bf", LeftVectorBar: "\u2952", LeftVector: "\u21bc", lEg: "\u2a8b", leg: "\u22da", leq: "\u2264", leqq: "\u2266", leqslant: "\u2a7d", lescc: "\u2aa8", les: "\u2a7d", lesdot: "\u2a7f", lesdoto: "\u2a81", lesdotor: "\u2a83", lesg: "\u22da\ufe00", lesges: "\u2a93", lessapprox: "\u2a85", lessdot: "\u22d6", lesseqgtr: "\u22da", lesseqqgtr: "\u2a8b", LessEqualGreater: "\u22da", LessFullEqual: "\u2266", LessGreater: "\u2276", lessgtr: "\u2276", LessLess: "\u2aa1", lesssim: "\u2272", LessSlantEqual: "\u2a7d", LessTilde: "\u2272", lfisht: "\u297c", lfloor: "\u230a", Lfr: "\ud835\udd0f", lfr: "\ud835\udd29", lg: "\u2276", lgE: "\u2a91", lHar: "\u2962", lhard: "\u21bd", lharu: "\u21bc", lharul: "\u296a", lhblk: "\u2584", LJcy: "\u0409", ljcy: "\u0459", llarr: "\u21c7", ll: "\u226a", Ll: "\u22d8", llcorner: "\u231e", Lleftarrow: "\u21da", llhard: "\u296b", lltri: "\u25fa", Lmidot: "\u013f", lmidot: "\u0140", lmoustache: "\u23b0", lmoust: "\u23b0", lnap: "\u2a89", lnapprox: "\u2a89", lne: "\u2a87", lnE: "\u2268", lneq: "\u2a87", lneqq: "\u2268", lnsim: "\u22e6", loang: "\u27ec", loarr: "\u21fd", lobrk: "\u27e6", longleftarrow: "\u27f5", LongLeftArrow: "\u27f5", Longleftarrow: "\u27f8", longleftrightarrow: "\u27f7", LongLeftRightArrow: "\u27f7", Longleftrightarrow: "\u27fa", longmapsto: "\u27fc", longrightarrow: "\u27f6", LongRightArrow: "\u27f6", Longrightarrow: "\u27f9", looparrowleft: "\u21ab", looparrowright: "\u21ac", lopar: "\u2985", Lopf: "\ud835\udd43", lopf: "\ud835\udd5d", loplus: "\u2a2d", lotimes: "\u2a34", lowast: "\u2217", lowbar: "_", LowerLeftArrow: "\u2199", LowerRightArrow: "\u2198", loz: "\u25ca", lozenge: "\u25ca", lozf: "\u29eb", lpar: "(", lparlt: "\u2993", lrarr: "\u21c6", lrcorner: "\u231f", lrhar: "\u21cb", lrhard: "\u296d", lrm: "\u200e", lrtri: "\u22bf", lsaquo: "\u2039", lscr: "\ud835\udcc1", Lscr: "\u2112", lsh: "\u21b0", Lsh: "\u21b0", lsim: "\u2272", lsime: "\u2a8d", lsimg: "\u2a8f", lsqb: "[", lsquo: "\u2018", lsquor: "\u201a", Lstrok: "\u0141", lstrok: "\u0142", ltcc: "\u2aa6", ltcir: "\u2a79", lt: "<", LT: "<", Lt: "\u226a", ltdot: "\u22d6", lthree: "\u22cb", ltimes: "\u22c9", ltlarr: "\u2976", ltquest: "\u2a7b", ltri: "\u25c3", ltrie: "\u22b4", ltrif: "\u25c2", ltrPar: "\u2996", lurdshar: "\u294a", luruhar: "\u2966", lvertneqq: "\u2268\ufe00", lvnE: "\u2268\ufe00", macr: "\xaf", male: "\u2642", malt: "\u2720", maltese: "\u2720", Map: "\u2905", map: "\u21a6", mapsto: "\u21a6", mapstodown: "\u21a7", mapstoleft: "\u21a4", mapstoup: "\u21a5", marker: "\u25ae", mcomma: "\u2a29", Mcy: "\u041c", mcy: "\u043c", mdash: "\u2014", mDDot: "\u223a", measuredangle: "\u2221", MediumSpace: "\u205f", Mellintrf: "\u2133", Mfr: "\ud835\udd10", mfr: "\ud835\udd2a", mho: "\u2127", micro: "\xb5", midast: "*", midcir: "\u2af0", mid: "\u2223", middot: "\xb7", minusb: "\u229f", minus: "\u2212", minusd: "\u2238", minusdu: "\u2a2a", MinusPlus: "\u2213", mlcp: "\u2adb", mldr: "\u2026", mnplus: "\u2213", models: "\u22a7", Mopf: "\ud835\udd44", mopf: "\ud835\udd5e", mp: "\u2213", mscr: "\ud835\udcc2", Mscr: "\u2133", mstpos: "\u223e", Mu: "\u039c", mu: "\u03bc", multimap: "\u22b8", mumap: "\u22b8", nabla: "\u2207", Nacute: "\u0143", nacute: "\u0144", nang: "\u2220\u20d2", nap: "\u2249", napE: "\u2a70\u0338", napid: "\u224b\u0338", napos: "\u0149", napprox: "\u2249", natural: "\u266e", naturals: "\u2115", natur: "\u266e", nbsp: "\xa0", nbump: "\u224e\u0338", nbumpe: "\u224f\u0338", ncap: "\u2a43", Ncaron: "\u0147", ncaron: "\u0148", Ncedil: "\u0145", ncedil: "\u0146", ncong: "\u2247", ncongdot: "\u2a6d\u0338", ncup: "\u2a42", Ncy: "\u041d", ncy: "\u043d", ndash: "\u2013", nearhk: "\u2924", nearr: "\u2197", neArr: "\u21d7", nearrow: "\u2197", ne: "\u2260", nedot: "\u2250\u0338", NegativeMediumSpace: "\u200b", NegativeThickSpace: "\u200b", NegativeThinSpace: "\u200b", NegativeVeryThinSpace: "\u200b", nequiv: "\u2262", nesear: "\u2928", nesim: "\u2242\u0338", NestedGreaterGreater: "\u226b", NestedLessLess: "\u226a", NewLine: "\n", nexist: "\u2204", nexists: "\u2204", Nfr: "\ud835\udd11", nfr: "\ud835\udd2b", ngE: "\u2267\u0338", nge: "\u2271", ngeq: "\u2271", ngeqq: "\u2267\u0338", ngeqslant: "\u2a7e\u0338", nges: "\u2a7e\u0338", nGg: "\u22d9\u0338", ngsim: "\u2275", nGt: "\u226b\u20d2", ngt: "\u226f", ngtr: "\u226f", nGtv: "\u226b\u0338", nharr: "\u21ae", nhArr: "\u21ce", nhpar: "\u2af2", ni: "\u220b", nis: "\u22fc", nisd: "\u22fa", niv: "\u220b", NJcy: "\u040a", njcy: "\u045a", nlarr: "\u219a", nlArr: "\u21cd", nldr: "\u2025", nlE: "\u2266\u0338", nle: "\u2270", nleftarrow: "\u219a", nLeftarrow: "\u21cd", nleftrightarrow: "\u21ae", nLeftrightarrow: "\u21ce", nleq: "\u2270", nleqq: "\u2266\u0338", nleqslant: "\u2a7d\u0338", nles: "\u2a7d\u0338", nless: "\u226e", nLl: "\u22d8\u0338", nlsim: "\u2274", nLt: "\u226a\u20d2", nlt: "\u226e", nltri: "\u22ea", nltrie: "\u22ec", nLtv: "\u226a\u0338", nmid: "\u2224", NoBreak: "\u2060", NonBreakingSpace: "\xa0", nopf: "\ud835\udd5f", Nopf: "\u2115", Not: "\u2aec", not: "\xac", NotCongruent: "\u2262", NotCupCap: "\u226d", NotDoubleVerticalBar: "\u2226", NotElement: "\u2209", NotEqual: "\u2260", NotEqualTilde: "\u2242\u0338", NotExists: "\u2204", NotGreater: "\u226f", NotGreaterEqual: "\u2271", NotGreaterFullEqual: "\u2267\u0338", NotGreaterGreater: "\u226b\u0338", NotGreaterLess: "\u2279", NotGreaterSlantEqual: "\u2a7e\u0338", NotGreaterTilde: "\u2275", NotHumpDownHump: "\u224e\u0338", NotHumpEqual: "\u224f\u0338", notin: "\u2209", notindot: "\u22f5\u0338", notinE: "\u22f9\u0338", notinva: "\u2209", notinvb: "\u22f7", notinvc: "\u22f6", NotLeftTriangleBar: "\u29cf\u0338", NotLeftTriangle: "\u22ea", NotLeftTriangleEqual: "\u22ec", NotLess: "\u226e", NotLessEqual: "\u2270", NotLessGreater: "\u2278", NotLessLess: "\u226a\u0338", NotLessSlantEqual: "\u2a7d\u0338", NotLessTilde: "\u2274", NotNestedGreaterGreater: "\u2aa2\u0338", NotNestedLessLess: "\u2aa1\u0338", notni: "\u220c", notniva: "\u220c", notnivb: "\u22fe", notnivc: "\u22fd", NotPrecedes: "\u2280", NotPrecedesEqual: "\u2aaf\u0338", NotPrecedesSlantEqual: "\u22e0", NotReverseElement: "\u220c", NotRightTriangleBar: "\u29d0\u0338", NotRightTriangle: "\u22eb", NotRightTriangleEqual: "\u22ed", NotSquareSubset: "\u228f\u0338", NotSquareSubsetEqual: "\u22e2", NotSquareSuperset: "\u2290\u0338", NotSquareSupersetEqual: "\u22e3", NotSubset: "\u2282\u20d2", NotSubsetEqual: "\u2288", NotSucceeds: "\u2281", NotSucceedsEqual: "\u2ab0\u0338", NotSucceedsSlantEqual: "\u22e1", NotSucceedsTilde: "\u227f\u0338", NotSuperset: "\u2283\u20d2", NotSupersetEqual: "\u2289", NotTilde: "\u2241", NotTildeEqual: "\u2244", NotTildeFullEqual: "\u2247", NotTildeTilde: "\u2249", NotVerticalBar: "\u2224", nparallel: "\u2226", npar: "\u2226", nparsl: "\u2afd\u20e5", npart: "\u2202\u0338", npolint: "\u2a14", npr: "\u2280", nprcue: "\u22e0", nprec: "\u2280", npreceq: "\u2aaf\u0338", npre: "\u2aaf\u0338", nrarrc: "\u2933\u0338", nrarr: "\u219b", nrArr: "\u21cf", nrarrw: "\u219d\u0338", nrightarrow: "\u219b", nRightarrow: "\u21cf", nrtri: "\u22eb", nrtrie: "\u22ed", nsc: "\u2281", nsccue: "\u22e1", nsce: "\u2ab0\u0338", Nscr: "\ud835\udca9", nscr: "\ud835\udcc3", nshortmid: "\u2224", nshortparallel: "\u2226", nsim: "\u2241", nsime: "\u2244", nsimeq: "\u2244", nsmid: "\u2224", nspar: "\u2226", nsqsube: "\u22e2", nsqsupe: "\u22e3", nsub: "\u2284", nsubE: "\u2ac5\u0338", nsube: "\u2288", nsubset: "\u2282\u20d2", nsubseteq: "\u2288", nsubseteqq: "\u2ac5\u0338", nsucc: "\u2281", nsucceq: "\u2ab0\u0338", nsup: "\u2285", nsupE: "\u2ac6\u0338", nsupe: "\u2289", nsupset: "\u2283\u20d2", nsupseteq: "\u2289", nsupseteqq: "\u2ac6\u0338", ntgl: "\u2279", Ntilde: "\xd1", ntilde: "\xf1", ntlg: "\u2278", ntriangleleft: "\u22ea", ntrianglelefteq: "\u22ec", ntriangleright: "\u22eb", ntrianglerighteq: "\u22ed", Nu: "\u039d", nu: "\u03bd", num: "#", numero: "\u2116", numsp: "\u2007", nvap: "\u224d\u20d2", nvdash: "\u22ac", nvDash: "\u22ad", nVdash: "\u22ae", nVDash: "\u22af", nvge: "\u2265\u20d2", nvgt: ">\u20d2", nvHarr: "\u2904", nvinfin: "\u29de", nvlArr: "\u2902", nvle: "\u2264\u20d2", nvlt: "<\u20d2", nvltrie: "\u22b4\u20d2", nvrArr: "\u2903", nvrtrie: "\u22b5\u20d2", nvsim: "\u223c\u20d2", nwarhk: "\u2923", nwarr: "\u2196", nwArr: "\u21d6", nwarrow: "\u2196", nwnear: "\u2927", Oacute: "\xd3", oacute: "\xf3", oast: "\u229b", Ocirc: "\xd4", ocirc: "\xf4", ocir: "\u229a", Ocy: "\u041e", ocy: "\u043e", odash: "\u229d", Odblac: "\u0150", odblac: "\u0151", odiv: "\u2a38", odot: "\u2299", odsold: "\u29bc", OElig: "\u0152", oelig: "\u0153", ofcir: "\u29bf", Ofr: "\ud835\udd12", ofr: "\ud835\udd2c", ogon: "\u02db", Ograve: "\xd2", ograve: "\xf2", ogt: "\u29c1", ohbar: "\u29b5", ohm: "\u03a9", oint: "\u222e", olarr: "\u21ba", olcir: "\u29be", olcross: "\u29bb", oline: "\u203e", olt: "\u29c0", Omacr: "\u014c", omacr: "\u014d", Omega: "\u03a9", omega: "\u03c9", Omicron: "\u039f", omicron: "\u03bf", omid: "\u29b6", ominus: "\u2296", Oopf: "\ud835\udd46", oopf: "\ud835\udd60", opar: "\u29b7", OpenCurlyDoubleQuote: "\u201c", OpenCurlyQuote: "\u2018", operp: "\u29b9", oplus: "\u2295", orarr: "\u21bb", Or: "\u2a54", or: "\u2228", ord: "\u2a5d", order: "\u2134", orderof: "\u2134", ordf: "\xaa", ordm: "\xba", origof: "\u22b6", oror: "\u2a56", orslope: "\u2a57", orv: "\u2a5b", oS: "\u24c8", Oscr: "\ud835\udcaa", oscr: "\u2134", Oslash: "\xd8", oslash: "\xf8", osol: "\u2298", Otilde: "\xd5", otilde: "\xf5", otimesas: "\u2a36", Otimes: "\u2a37", otimes: "\u2297", Ouml: "\xd6", ouml: "\xf6", ovbar: "\u233d", OverBar: "\u203e", OverBrace: "\u23de", OverBracket: "\u23b4", OverParenthesis: "\u23dc", para: "\xb6", parallel: "\u2225", par: "\u2225", parsim: "\u2af3", parsl: "\u2afd", part: "\u2202", PartialD: "\u2202", Pcy: "\u041f", pcy: "\u043f", percnt: "%", period: ".", permil: "\u2030", perp: "\u22a5", pertenk: "\u2031", Pfr: "\ud835\udd13", pfr: "\ud835\udd2d", Phi: "\u03a6", phi: "\u03c6", phiv: "\u03d5", phmmat: "\u2133", phone: "\u260e", Pi: "\u03a0", pi: "\u03c0", pitchfork: "\u22d4", piv: "\u03d6", planck: "\u210f", planckh: "\u210e", plankv: "\u210f", plusacir: "\u2a23", plusb: "\u229e", pluscir: "\u2a22", plus: "+", plusdo: "\u2214", plusdu: "\u2a25", pluse: "\u2a72", PlusMinus: "\xb1", plusmn: "\xb1", plussim: "\u2a26", plustwo: "\u2a27", pm: "\xb1", Poincareplane: "\u210c", pointint: "\u2a15", popf: "\ud835\udd61", Popf: "\u2119", pound: "\xa3", prap: "\u2ab7", Pr: "\u2abb", pr: "\u227a", prcue: "\u227c", precapprox: "\u2ab7", prec: "\u227a", preccurlyeq: "\u227c", Precedes: "\u227a", PrecedesEqual: "\u2aaf", PrecedesSlantEqual: "\u227c", PrecedesTilde: "\u227e", preceq: "\u2aaf", precnapprox: "\u2ab9", precneqq: "\u2ab5", precnsim: "\u22e8", pre: "\u2aaf", prE: "\u2ab3", precsim: "\u227e", prime: "\u2032", Prime: "\u2033", primes: "\u2119", prnap: "\u2ab9", prnE: "\u2ab5", prnsim: "\u22e8", prod: "\u220f", Product: "\u220f", profalar: "\u232e", profline: "\u2312", profsurf: "\u2313", prop: "\u221d", Proportional: "\u221d", Proportion: "\u2237", propto: "\u221d", prsim: "\u227e", prurel: "\u22b0", Pscr: "\ud835\udcab", pscr: "\ud835\udcc5", Psi: "\u03a8", psi: "\u03c8", puncsp: "\u2008", Qfr: "\ud835\udd14", qfr: "\ud835\udd2e", qint: "\u2a0c", qopf: "\ud835\udd62", Qopf: "\u211a", qprime: "\u2057", Qscr: "\ud835\udcac", qscr: "\ud835\udcc6", quaternions: "\u210d", quatint: "\u2a16", quest: "?", questeq: "\u225f", quot: '"', QUOT: '"', rAarr: "\u21db", race: "\u223d\u0331", Racute: "\u0154", racute: "\u0155", radic: "\u221a", raemptyv: "\u29b3", rang: "\u27e9", Rang: "\u27eb", rangd: "\u2992", range: "\u29a5", rangle: "\u27e9", raquo: "\xbb", rarrap: "\u2975", rarrb: "\u21e5", rarrbfs: "\u2920", rarrc: "\u2933", rarr: "\u2192", Rarr: "\u21a0", rArr: "\u21d2", rarrfs: "\u291e", rarrhk: "\u21aa", rarrlp: "\u21ac", rarrpl: "\u2945", rarrsim: "\u2974", Rarrtl: "\u2916", rarrtl: "\u21a3", rarrw: "\u219d", ratail: "\u291a", rAtail: "\u291c", ratio: "\u2236", rationals: "\u211a", rbarr: "\u290d", rBarr: "\u290f", RBarr: "\u2910", rbbrk: "\u2773", rbrace: "}", rbrack: "]", rbrke: "\u298c", rbrksld: "\u298e", rbrkslu: "\u2990", Rcaron: "\u0158", rcaron: "\u0159", Rcedil: "\u0156", rcedil: "\u0157", rceil: "\u2309", rcub: "}", Rcy: "\u0420", rcy: "\u0440", rdca: "\u2937", rdldhar: "\u2969", rdquo: "\u201d", rdquor: "\u201d", rdsh: "\u21b3", real: "\u211c", realine: "\u211b", realpart: "\u211c", reals: "\u211d", Re: "\u211c", rect: "\u25ad", reg: "\xae", REG: "\xae", ReverseElement: "\u220b", ReverseEquilibrium: "\u21cb", ReverseUpEquilibrium: "\u296f", rfisht: "\u297d", rfloor: "\u230b", rfr: "\ud835\udd2f", Rfr: "\u211c", rHar: "\u2964", rhard: "\u21c1", rharu: "\u21c0", rharul: "\u296c", Rho: "\u03a1", rho: "\u03c1", rhov: "\u03f1", RightAngleBracket: "\u27e9", RightArrowBar: "\u21e5", rightarrow: "\u2192", RightArrow: "\u2192", Rightarrow: "\u21d2", RightArrowLeftArrow: "\u21c4", rightarrowtail: "\u21a3", RightCeiling: "\u2309", RightDoubleBracket: "\u27e7", RightDownTeeVector: "\u295d", RightDownVectorBar: "\u2955", RightDownVector: "\u21c2", RightFloor: "\u230b", rightharpoondown: "\u21c1", rightharpoonup: "\u21c0", rightleftarrows: "\u21c4", rightleftharpoons: "\u21cc", rightrightarrows: "\u21c9", rightsquigarrow: "\u219d", RightTeeArrow: "\u21a6", RightTee: "\u22a2", RightTeeVector: "\u295b", rightthreetimes: "\u22cc", RightTriangleBar: "\u29d0", RightTriangle: "\u22b3", RightTriangleEqual: "\u22b5", RightUpDownVector: "\u294f", RightUpTeeVector: "\u295c", RightUpVectorBar: "\u2954", RightUpVector: "\u21be", RightVectorBar: "\u2953", RightVector: "\u21c0", ring: "\u02da", risingdotseq: "\u2253", rlarr: "\u21c4", rlhar: "\u21cc", rlm: "\u200f", rmoustache: "\u23b1", rmoust: "\u23b1", rnmid: "\u2aee", roang: "\u27ed", roarr: "\u21fe", robrk: "\u27e7", ropar: "\u2986", ropf: "\ud835\udd63", Ropf: "\u211d", roplus: "\u2a2e", rotimes: "\u2a35", RoundImplies: "\u2970", rpar: ")", rpargt: "\u2994", rppolint: "\u2a12", rrarr: "\u21c9", Rrightarrow: "\u21db", rsaquo: "\u203a", rscr: "\ud835\udcc7", Rscr: "\u211b", rsh: "\u21b1", Rsh: "\u21b1", rsqb: "]", rsquo: "\u2019", rsquor: "\u2019", rthree: "\u22cc", rtimes: "\u22ca", rtri: "\u25b9", rtrie: "\u22b5", rtrif: "\u25b8", rtriltri: "\u29ce", RuleDelayed: "\u29f4", ruluhar: "\u2968", rx: "\u211e", Sacute: "\u015a", sacute: "\u015b", sbquo: "\u201a", scap: "\u2ab8", Scaron: "\u0160", scaron: "\u0161", Sc: "\u2abc", sc: "\u227b", sccue: "\u227d", sce: "\u2ab0", scE: "\u2ab4", Scedil: "\u015e", scedil: "\u015f", Scirc: "\u015c", scirc: "\u015d", scnap: "\u2aba", scnE: "\u2ab6", scnsim: "\u22e9", scpolint: "\u2a13", scsim: "\u227f", Scy: "\u0421", scy: "\u0441", sdotb: "\u22a1", sdot: "\u22c5", sdote: "\u2a66", searhk: "\u2925", searr: "\u2198", seArr: "\u21d8", searrow: "\u2198", sect: "\xa7", semi: ";", seswar: "\u2929", setminus: "\u2216", setmn: "\u2216", sext: "\u2736", Sfr: "\ud835\udd16", sfr: "\ud835\udd30", sfrown: "\u2322", sharp: "\u266f", SHCHcy: "\u0429", shchcy: "\u0449", SHcy: "\u0428", shcy: "\u0448", ShortDownArrow: "\u2193", ShortLeftArrow: "\u2190", shortmid: "\u2223", shortparallel: "\u2225", ShortRightArrow: "\u2192", ShortUpArrow: "\u2191", shy: "\xad", Sigma: "\u03a3", sigma: "\u03c3", sigmaf: "\u03c2", sigmav: "\u03c2", sim: "\u223c", simdot: "\u2a6a", sime: "\u2243", simeq: "\u2243", simg: "\u2a9e", simgE: "\u2aa0", siml: "\u2a9d", simlE: "\u2a9f", simne: "\u2246", simplus: "\u2a24", simrarr: "\u2972", slarr: "\u2190", SmallCircle: "\u2218", smallsetminus: "\u2216", smashp: "\u2a33", smeparsl: "\u29e4", smid: "\u2223", smile: "\u2323", smt: "\u2aaa", smte: "\u2aac", smtes: "\u2aac\ufe00", SOFTcy: "\u042c", softcy: "\u044c", solbar: "\u233f", solb: "\u29c4", sol: "/", Sopf: "\ud835\udd4a", sopf: "\ud835\udd64", spades: "\u2660", spadesuit: "\u2660", spar: "\u2225", sqcap: "\u2293", sqcaps: "\u2293\ufe00", sqcup: "\u2294", sqcups: "\u2294\ufe00", Sqrt: "\u221a", sqsub: "\u228f", sqsube: "\u2291", sqsubset: "\u228f", sqsubseteq: "\u2291", sqsup: "\u2290", sqsupe: "\u2292", sqsupset: "\u2290", sqsupseteq: "\u2292", square: "\u25a1", Square: "\u25a1", SquareIntersection: "\u2293", SquareSubset: "\u228f", SquareSubsetEqual: "\u2291", SquareSuperset: "\u2290", SquareSupersetEqual: "\u2292", SquareUnion: "\u2294", squarf: "\u25aa", squ: "\u25a1", squf: "\u25aa", srarr: "\u2192", Sscr: "\ud835\udcae", sscr: "\ud835\udcc8", ssetmn: "\u2216", ssmile: "\u2323", sstarf: "\u22c6", Star: "\u22c6", star: "\u2606", starf: "\u2605", straightepsilon: "\u03f5", straightphi: "\u03d5", strns: "\xaf", sub: "\u2282", Sub: "\u22d0", subdot: "\u2abd", subE: "\u2ac5", sube: "\u2286", subedot: "\u2ac3", submult: "\u2ac1", subnE: "\u2acb", subne: "\u228a", subplus: "\u2abf", subrarr: "\u2979", subset: "\u2282", Subset: "\u22d0", subseteq: "\u2286", subseteqq: "\u2ac5", SubsetEqual: "\u2286", subsetneq: "\u228a", subsetneqq: "\u2acb", subsim: "\u2ac7", subsub: "\u2ad5", subsup: "\u2ad3", succapprox: "\u2ab8", succ: "\u227b", succcurlyeq: "\u227d", Succeeds: "\u227b", SucceedsEqual: "\u2ab0", SucceedsSlantEqual: "\u227d", SucceedsTilde: "\u227f", succeq: "\u2ab0", succnapprox: "\u2aba", succneqq: "\u2ab6", succnsim: "\u22e9", succsim: "\u227f", SuchThat: "\u220b", sum: "\u2211", Sum: "\u2211", sung: "\u266a", sup1: "\xb9", sup2: "\xb2", sup3: "\xb3", sup: "\u2283", Sup: "\u22d1", supdot: "\u2abe", supdsub: "\u2ad8", supE: "\u2ac6", supe: "\u2287", supedot: "\u2ac4", Superset: "\u2283", SupersetEqual: "\u2287", suphsol: "\u27c9", suphsub: "\u2ad7", suplarr: "\u297b", supmult: "\u2ac2", supnE: "\u2acc", supne: "\u228b", supplus: "\u2ac0", supset: "\u2283", Supset: "\u22d1", supseteq: "\u2287", supseteqq: "\u2ac6", supsetneq: "\u228b", supsetneqq: "\u2acc", supsim: "\u2ac8", supsub: "\u2ad4", supsup: "\u2ad6", swarhk: "\u2926", swarr: "\u2199", swArr: "\u21d9", swarrow: "\u2199", swnwar: "\u292a", szlig: "\xdf", Tab: "\t", target: "\u2316", Tau: "\u03a4", tau: "\u03c4", tbrk: "\u23b4", Tcaron: "\u0164", tcaron: "\u0165", Tcedil: "\u0162", tcedil: "\u0163", Tcy: "\u0422", tcy: "\u0442", tdot: "\u20db", telrec: "\u2315", Tfr: "\ud835\udd17", tfr: "\ud835\udd31", there4: "\u2234", therefore: "\u2234", Therefore: "\u2234", Theta: "\u0398", theta: "\u03b8", thetasym: "\u03d1", thetav: "\u03d1", thickapprox: "\u2248", thicksim: "\u223c", ThickSpace: "\u205f\u200a", ThinSpace: "\u2009", thinsp: "\u2009", thkap: "\u2248", thksim: "\u223c", THORN: "\xde", thorn: "\xfe", tilde: "\u02dc", Tilde: "\u223c", TildeEqual: "\u2243", TildeFullEqual: "\u2245", TildeTilde: "\u2248", timesbar: "\u2a31", timesb: "\u22a0", times: "\xd7", timesd: "\u2a30", tint: "\u222d", toea: "\u2928", topbot: "\u2336", topcir: "\u2af1", top: "\u22a4", Topf: "\ud835\udd4b", topf: "\ud835\udd65", topfork: "\u2ada", tosa: "\u2929", tprime: "\u2034", trade: "\u2122", TRADE: "\u2122", triangle: "\u25b5", triangledown: "\u25bf", triangleleft: "\u25c3", trianglelefteq: "\u22b4", triangleq: "\u225c", triangleright: "\u25b9", trianglerighteq: "\u22b5", tridot: "\u25ec", trie: "\u225c", triminus: "\u2a3a", TripleDot: "\u20db", triplus: "\u2a39", trisb: "\u29cd", tritime: "\u2a3b", trpezium: "\u23e2", Tscr: "\ud835\udcaf", tscr: "\ud835\udcc9", TScy: "\u0426", tscy: "\u0446", TSHcy: "\u040b", tshcy: "\u045b", Tstrok: "\u0166", tstrok: "\u0167", twixt: "\u226c", twoheadleftarrow: "\u219e", twoheadrightarrow: "\u21a0", Uacute: "\xda", uacute: "\xfa", uarr: "\u2191", Uarr: "\u219f", uArr: "\u21d1", Uarrocir: "\u2949", Ubrcy: "\u040e", ubrcy: "\u045e", Ubreve: "\u016c", ubreve: "\u016d", Ucirc: "\xdb", ucirc: "\xfb", Ucy: "\u0423", ucy: "\u0443", udarr: "\u21c5", Udblac: "\u0170", udblac: "\u0171", udhar: "\u296e", ufisht: "\u297e", Ufr: "\ud835\udd18", ufr: "\ud835\udd32", Ugrave: "\xd9", ugrave: "\xf9", uHar: "\u2963", uharl: "\u21bf", uharr: "\u21be", uhblk: "\u2580", ulcorn: "\u231c", ulcorner: "\u231c", ulcrop: "\u230f", ultri: "\u25f8", Umacr: "\u016a", umacr: "\u016b", uml: "\xa8", UnderBar: "_", UnderBrace: "\u23df", UnderBracket: "\u23b5", UnderParenthesis: "\u23dd", Union: "\u22c3", UnionPlus: "\u228e", Uogon: "\u0172", uogon: "\u0173", Uopf: "\ud835\udd4c", uopf: "\ud835\udd66", UpArrowBar: "\u2912", uparrow: "\u2191", UpArrow: "\u2191", Uparrow: "\u21d1", UpArrowDownArrow: "\u21c5", updownarrow: "\u2195", UpDownArrow: "\u2195", Updownarrow: "\u21d5", UpEquilibrium: "\u296e", upharpoonleft: "\u21bf", upharpoonright: "\u21be", uplus: "\u228e", UpperLeftArrow: "\u2196", UpperRightArrow: "\u2197", upsi: "\u03c5", Upsi: "\u03d2", upsih: "\u03d2", Upsilon: "\u03a5", upsilon: "\u03c5", UpTeeArrow: "\u21a5", UpTee: "\u22a5", upuparrows: "\u21c8", urcorn: "\u231d", urcorner: "\u231d", urcrop: "\u230e", Uring: "\u016e", uring: "\u016f", urtri: "\u25f9", Uscr: "\ud835\udcb0", uscr: "\ud835\udcca", utdot: "\u22f0", Utilde: "\u0168", utilde: "\u0169", utri: "\u25b5", utrif: "\u25b4", uuarr: "\u21c8", Uuml: "\xdc", uuml: "\xfc", uwangle: "\u29a7", vangrt: "\u299c", varepsilon: "\u03f5", varkappa: "\u03f0", varnothing: "\u2205", varphi: "\u03d5", varpi: "\u03d6", varpropto: "\u221d", varr: "\u2195", vArr: "\u21d5", varrho: "\u03f1", varsigma: "\u03c2", varsubsetneq: "\u228a\ufe00", varsubsetneqq: "\u2acb\ufe00", varsupsetneq: "\u228b\ufe00", varsupsetneqq: "\u2acc\ufe00", vartheta: "\u03d1", vartriangleleft: "\u22b2", vartriangleright: "\u22b3", vBar: "\u2ae8", Vbar: "\u2aeb", vBarv: "\u2ae9", Vcy: "\u0412", vcy: "\u0432", vdash: "\u22a2", vDash: "\u22a8", Vdash: "\u22a9", VDash: "\u22ab", Vdashl: "\u2ae6", veebar: "\u22bb", vee: "\u2228", Vee: "\u22c1", veeeq: "\u225a", vellip: "\u22ee", verbar: "|", Verbar: "\u2016", vert: "|", Vert: "\u2016", VerticalBar: "\u2223", VerticalLine: "|", VerticalSeparator: "\u2758", VerticalTilde: "\u2240", VeryThinSpace: "\u200a", Vfr: "\ud835\udd19", vfr: "\ud835\udd33", vltri: "\u22b2", vnsub: "\u2282\u20d2", vnsup: "\u2283\u20d2", Vopf: "\ud835\udd4d", vopf: "\ud835\udd67", vprop: "\u221d", vrtri: "\u22b3", Vscr: "\ud835\udcb1", vscr: "\ud835\udccb", vsubnE: "\u2acb\ufe00", vsubne: "\u228a\ufe00", vsupnE: "\u2acc\ufe00", vsupne: "\u228b\ufe00", Vvdash: "\u22aa", vzigzag: "\u299a", Wcirc: "\u0174", wcirc: "\u0175", wedbar: "\u2a5f", wedge: "\u2227", Wedge: "\u22c0", wedgeq: "\u2259", weierp: "\u2118", Wfr: "\ud835\udd1a", wfr: "\ud835\udd34", Wopf: "\ud835\udd4e", wopf: "\ud835\udd68", wp: "\u2118", wr: "\u2240", wreath: "\u2240", Wscr: "\ud835\udcb2", wscr: "\ud835\udccc", xcap: "\u22c2", xcirc: "\u25ef", xcup: "\u22c3", xdtri: "\u25bd", Xfr: "\ud835\udd1b", xfr: "\ud835\udd35", xharr: "\u27f7", xhArr: "\u27fa", Xi: "\u039e", xi: "\u03be", xlarr: "\u27f5", xlArr: "\u27f8", xmap: "\u27fc", xnis: "\u22fb", xodot: "\u2a00", Xopf: "\ud835\udd4f", xopf: "\ud835\udd69", xoplus: "\u2a01", xotime: "\u2a02", xrarr: "\u27f6", xrArr: "\u27f9", Xscr: "\ud835\udcb3", xscr: "\ud835\udccd", xsqcup: "\u2a06", xuplus: "\u2a04", xutri: "\u25b3", xvee: "\u22c1", xwedge: "\u22c0", Yacute: "\xdd", yacute: "\xfd", YAcy: "\u042f", yacy: "\u044f", Ycirc: "\u0176", ycirc: "\u0177", Ycy: "\u042b", ycy: "\u044b", yen: "\xa5", Yfr: "\ud835\udd1c", yfr: "\ud835\udd36", YIcy: "\u0407", yicy: "\u0457", Yopf: "\ud835\udd50", yopf: "\ud835\udd6a", Yscr: "\ud835\udcb4", yscr: "\ud835\udcce", YUcy: "\u042e", yucy: "\u044e", yuml: "\xff", Yuml: "\u0178", Zacute: "\u0179", zacute: "\u017a", Zcaron: "\u017d", zcaron: "\u017e", Zcy: "\u0417", zcy: "\u0437", Zdot: "\u017b", zdot: "\u017c", zeetrf: "\u2128", ZeroWidthSpace: "\u200b", Zeta: "\u0396", zeta: "\u03b6", zfr: "\ud835\udd37", Zfr: "\u2128", ZHcy: "\u0416", zhcy: "\u0436", zigrarr: "\u21dd", zopf: "\ud835\udd6b", Zopf: "\u2124", Zscr: "\ud835\udcb5", zscr: "\ud835\udccf", zwj: "\u200d", zwnj: "\u200c" }; /*eslint quotes:0*/ var entities = require$$0; var regex$4 = /[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/; var encodeCache = {}; // Create a lookup array where anything but characters in `chars` string // and alphanumeric chars is percent-encoded. function getEncodeCache(exclude) { var i, ch, cache = encodeCache[exclude]; if (cache) { return cache; } cache = encodeCache[exclude] = []; for (i = 0; i < 128; i++) { ch = String.fromCharCode(i); if (/^[0-9a-z]$/i.test(ch)) { // always allow unencoded alphanumeric characters cache.push(ch); } else { cache.push("%" + ("0" + i.toString(16).toUpperCase()).slice(-2)); } } for (i = 0; i < exclude.length; i++) { cache[exclude.charCodeAt(i)] = exclude[i]; } return cache; } // Encode unsafe characters with percent-encoding, skipping already // encoded sequences. // - string - string to encode // - exclude - list of characters to ignore (in addition to a-zA-Z0-9) // - keepEscaped - don't encode '%' in a correct escape sequence (default: true) function encode$2(string, exclude, keepEscaped) { var i, l, code, nextCode, cache, result = ""; if (typeof exclude !== "string") { // encode(string, keepEscaped) keepEscaped = exclude; exclude = encode$2.defaultChars; } if (typeof keepEscaped === "undefined") { keepEscaped = true; } cache = getEncodeCache(exclude); for (i = 0, l = string.length; i < l; i++) { code = string.charCodeAt(i); if (keepEscaped && code === 37 /* % */ && i + 2 < l) { if (/^[0-9a-f]{2}$/i.test(string.slice(i + 1, i + 3))) { result += string.slice(i, i + 3); i += 2; continue; } } if (code < 128) { result += cache[code]; continue; } if (code >= 55296 && code <= 57343) { if (code >= 55296 && code <= 56319 && i + 1 < l) { nextCode = string.charCodeAt(i + 1); if (nextCode >= 56320 && nextCode <= 57343) { result += encodeURIComponent(string[i] + string[i + 1]); i++; continue; } } result += "%EF%BF%BD"; continue; } result += encodeURIComponent(string[i]); } return result; } encode$2.defaultChars = ";/?:@&=+$,-_.!~*'()#"; encode$2.componentChars = "-_.!~*'()"; var encode_1 = encode$2; /* eslint-disable no-bitwise */ var decodeCache = {}; function getDecodeCache(exclude) { var i, ch, cache = decodeCache[exclude]; if (cache) { return cache; } cache = decodeCache[exclude] = []; for (i = 0; i < 128; i++) { ch = String.fromCharCode(i); cache.push(ch); } for (i = 0; i < exclude.length; i++) { ch = exclude.charCodeAt(i); cache[ch] = "%" + ("0" + ch.toString(16).toUpperCase()).slice(-2); } return cache; } // Decode percent-encoded string. function decode$2(string, exclude) { var cache; if (typeof exclude !== "string") { exclude = decode$2.defaultChars; } cache = getDecodeCache(exclude); return string.replace(/(%[a-f0-9]{2})+/gi, (function(seq) { var i, l, b1, b2, b3, b4, chr, result = ""; for (i = 0, l = seq.length; i < l; i += 3) { b1 = parseInt(seq.slice(i + 1, i + 3), 16); if (b1 < 128) { result += cache[b1]; continue; } if ((b1 & 224) === 192 && i + 3 < l) { // 110xxxxx 10xxxxxx b2 = parseInt(seq.slice(i + 4, i + 6), 16); if ((b2 & 192) === 128) { chr = b1 << 6 & 1984 | b2 & 63; if (chr < 128) { result += "\ufffd\ufffd"; } else { result += String.fromCharCode(chr); } i += 3; continue; } } if ((b1 & 240) === 224 && i + 6 < l) { // 1110xxxx 10xxxxxx 10xxxxxx b2 = parseInt(seq.slice(i + 4, i + 6), 16); b3 = parseInt(seq.slice(i + 7, i + 9), 16); if ((b2 & 192) === 128 && (b3 & 192) === 128) { chr = b1 << 12 & 61440 | b2 << 6 & 4032 | b3 & 63; if (chr < 2048 || chr >= 55296 && chr <= 57343) { result += "\ufffd\ufffd\ufffd"; } else { result += String.fromCharCode(chr); } i += 6; continue; } } if ((b1 & 248) === 240 && i + 9 < l) { // 111110xx 10xxxxxx 10xxxxxx 10xxxxxx b2 = parseInt(seq.slice(i + 4, i + 6), 16); b3 = parseInt(seq.slice(i + 7, i + 9), 16); b4 = parseInt(seq.slice(i + 10, i + 12), 16); if ((b2 & 192) === 128 && (b3 & 192) === 128 && (b4 & 192) === 128) { chr = b1 << 18 & 1835008 | b2 << 12 & 258048 | b3 << 6 & 4032 | b4 & 63; if (chr < 65536 || chr > 1114111) { result += "\ufffd\ufffd\ufffd\ufffd"; } else { chr -= 65536; result += String.fromCharCode(55296 + (chr >> 10), 56320 + (chr & 1023)); } i += 9; continue; } } result += "\ufffd"; } return result; })); } decode$2.defaultChars = ";/?:@&=+$,#"; decode$2.componentChars = ""; var decode_1 = decode$2; var format$1 = function format(url) { var result = ""; result += url.protocol || ""; result += url.slashes ? "//" : ""; result += url.auth ? url.auth + "@" : ""; if (url.hostname && url.hostname.indexOf(":") !== -1) { // ipv6 address result += "[" + url.hostname + "]"; } else { result += url.hostname || ""; } result += url.port ? ":" + url.port : ""; result += url.pathname || ""; result += url.search || ""; result += url.hash || ""; return result; }; // Copyright Joyent, Inc. and other Node contributors. // Changes from joyent/node: // 1. No leading slash in paths, // e.g. in `url.parse('http://foo?bar')` pathname is ``, not `/` // 2. Backslashes are not replaced with slashes, // so `http:\\example.org\` is treated like a relative path // 3. Trailing colon is treated like a part of the path, // i.e. in `http://example.org:foo` pathname is `:foo` // 4. Nothing is URL-encoded in the resulting object, // (in joyent/node some chars in auth and paths are encoded) // 5. `url.parse()` does not have `parseQueryString` argument // 6. Removed extraneous result properties: `host`, `path`, `query`, etc., // which can be constructed using other parts of the url. function Url() { this.protocol = null; this.slashes = null; this.auth = null; this.port = null; this.hostname = null; this.hash = null; this.search = null; this.pathname = null; } // Reference: RFC 3986, RFC 1808, RFC 2396 // define these here so at least they only have to be // compiled once on the first module load. var protocolPattern = /^([a-z0-9.+-]+:)/i, portPattern = /:[0-9]*$/, // Special case for a simple path URL simplePathPattern = /^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/, // RFC 2396: characters reserved for delimiting URLs. // We actually just auto-escape these. delims = [ "<", ">", '"', "`", " ", "\r", "\n", "\t" ], // RFC 2396: characters not allowed for various reasons. unwise = [ "{", "}", "|", "\\", "^", "`" ].concat(delims), // Allowed by RFCs, but cause of XSS attacks. Always escape these. autoEscape = [ "'" ].concat(unwise), // Characters that are never ever allowed in a hostname. // Note that any invalid chars are also handled, but these // are the ones that are *expected* to be seen, so we fast-path // them. nonHostChars = [ "%", "/", "?", ";", "#" ].concat(autoEscape), hostEndingChars = [ "/", "?", "#" ], hostnameMaxLen = 255, hostnamePartPattern = /^[+a-z0-9A-Z_-]{0,63}$/, hostnamePartStart = /^([+a-z0-9A-Z_-]{0,63})(.*)$/, // protocols that can allow "unsafe" and "unwise" chars. /* eslint-disable no-script-url */ // protocols that never have a hostname. hostlessProtocol = { javascript: true, "javascript:": true }, // protocols that always contain a // bit. slashedProtocol = { http: true, https: true, ftp: true, gopher: true, file: true, "http:": true, "https:": true, "ftp:": true, "gopher:": true, "file:": true }; /* eslint-enable no-script-url */ function urlParse(url, slashesDenoteHost) { if (url && url instanceof Url) { return url; } var u = new Url; u.parse(url, slashesDenoteHost); return u; } Url.prototype.parse = function(url, slashesDenoteHost) { var i, l, lowerProto, hec, slashes, rest = url; // trim before proceeding. // This is to support parse stuff like " http://foo.com \n" rest = rest.trim(); if (!slashesDenoteHost && url.split("#").length === 1) { // Try fast path regexp var simplePath = simplePathPattern.exec(rest); if (simplePath) { this.pathname = simplePath[1]; if (simplePath[2]) { this.search = simplePath[2]; } return this; } } var proto = protocolPattern.exec(rest); if (proto) { proto = proto[0]; lowerProto = proto.toLowerCase(); this.protocol = proto; rest = rest.substr(proto.length); } // figure out if it's got a host // user@server is *always* interpreted as a hostname, and url // resolution will treat //foo/bar as host=foo,path=bar because that's // how the browser resolves relative URLs. if (slashesDenoteHost || proto || rest.match(/^\/\/[^@\/]+@[^@\/]+/)) { slashes = rest.substr(0, 2) === "//"; if (slashes && !(proto && hostlessProtocol[proto])) { rest = rest.substr(2); this.slashes = true; } } if (!hostlessProtocol[proto] && (slashes || proto && !slashedProtocol[proto])) { // there's a hostname. // the first instance of /, ?, ;, or # ends the host. // If there is an @ in the hostname, then non-host chars *are* allowed // to the left of the last @ sign, unless some host-ending character // comes *before* the @-sign. // URLs are obnoxious. // ex: // http://a@b@c/ => user:a@b host:c // http://a@b?@c => user:a host:c path:/?@c // v0.12 TODO(isaacs): This is not quite how Chrome does things. // Review our test case against browsers more comprehensively. // find the first instance of any hostEndingChars var hostEnd = -1; for (i = 0; i < hostEndingChars.length; i++) { hec = rest.indexOf(hostEndingChars[i]); if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { hostEnd = hec; } } // at this point, either we have an explicit point where the // auth portion cannot go past, or the last @ char is the decider. var auth, atSign; if (hostEnd === -1) { // atSign can be anywhere. atSign = rest.lastIndexOf("@"); } else { // atSign must be in auth portion. // http://a@b/c@d => host:b auth:a path:/c@d atSign = rest.lastIndexOf("@", hostEnd); } // Now we have a portion which is definitely the auth. // Pull that off. if (atSign !== -1) { auth = rest.slice(0, atSign); rest = rest.slice(atSign + 1); this.auth = auth; } // the host is the remaining to the left of the first non-host char hostEnd = -1; for (i = 0; i < nonHostChars.length; i++) { hec = rest.indexOf(nonHostChars[i]); if (hec !== -1 && (hostEnd === -1 || hec < hostEnd)) { hostEnd = hec; } } // if we still have not hit it, then the entire thing is a host. if (hostEnd === -1) { hostEnd = rest.length; } if (rest[hostEnd - 1] === ":") { hostEnd--; } var host = rest.slice(0, hostEnd); rest = rest.slice(hostEnd); // pull out port. this.parseHost(host); // we've indicated that there is a hostname, // so even if it's empty, it has to be present. this.hostname = this.hostname || ""; // if hostname begins with [ and ends with ] // assume that it's an IPv6 address. var ipv6Hostname = this.hostname[0] === "[" && this.hostname[this.hostname.length - 1] === "]"; // validate a little. if (!ipv6Hostname) { var hostparts = this.hostname.split(/\./); for (i = 0, l = hostparts.length; i < l; i++) { var part = hostparts[i]; if (!part) { continue; } if (!part.match(hostnamePartPattern)) { var newpart = ""; for (var j = 0, k = part.length; j < k; j++) { if (part.charCodeAt(j) > 127) { // we replace non-ASCII char with a temporary placeholder // we need this to make sure size of hostname is not // broken by replacing non-ASCII by nothing newpart += "x"; } else { newpart += part[j]; } } // we test again with ASCII char only if (!newpart.match(hostnamePartPattern)) { var validParts = hostparts.slice(0, i); var notHost = hostparts.slice(i + 1); var bit = part.match(hostnamePartStart); if (bit) { validParts.push(bit[1]); notHost.unshift(bit[2]); } if (notHost.length) { rest = notHost.join(".") + rest; } this.hostname = validParts.join("."); break; } } } } if (this.hostname.length > hostnameMaxLen) { this.hostname = ""; } // strip [ and ] from the hostname // the host field still retains them, though if (ipv6Hostname) { this.hostname = this.hostname.substr(1, this.hostname.length - 2); } } // chop off from the tail first. var hash = rest.indexOf("#"); if (hash !== -1) { // got a fragment string. this.hash = rest.substr(hash); rest = rest.slice(0, hash); } var qm = rest.indexOf("?"); if (qm !== -1) { this.search = rest.substr(qm); rest = rest.slice(0, qm); } if (rest) { this.pathname = rest; } if (slashedProtocol[lowerProto] && this.hostname && !this.pathname) { this.pathname = ""; } return this; }; Url.prototype.parseHost = function(host) { var port = portPattern.exec(host); if (port) { port = port[0]; if (port !== ":") { this.port = port.substr(1); } host = host.substr(0, host.length - port.length); } if (host) { this.hostname = host; } }; var parse$1 = urlParse; var encode$1 = encode_1; var decode$1 = decode_1; var format = format$1; var parse = parse$1; var mdurl = { encode: encode$1, decode: decode$1, format: format, parse: parse }; var regex$3 = /[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/; var regex$2 = /[\0-\x1F\x7F-\x9F]/; var regex$1 = /[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/; var regex = /[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/; var Any = regex$3; var Cc = regex$2; var Cf = regex$1; var P = regex$4; var Z = regex; var uc_micro = { Any: Any, Cc: Cc, Cf: Cf, P: P, Z: Z }; var utils = createCommonjsModule((function(module, exports) { function _class(obj) { return Object.prototype.toString.call(obj); } function isString(obj) { return _class(obj) === "[object String]"; } var _hasOwnProperty = Object.prototype.hasOwnProperty; function has(object, key) { return _hasOwnProperty.call(object, key); } // Merge objects function assign(obj /*from1, from2, from3, ...*/) { var sources = Array.prototype.slice.call(arguments, 1); sources.forEach((function(source) { if (!source) { return; } if (typeof source !== "object") { throw new TypeError(source + "must be object"); } Object.keys(source).forEach((function(key) { obj[key] = source[key]; })); })); return obj; } // Remove element from array and put another array at those position. // Useful for some operations with tokens function arrayReplaceAt(src, pos, newElements) { return [].concat(src.slice(0, pos), newElements, src.slice(pos + 1)); } //////////////////////////////////////////////////////////////////////////////// function isValidEntityCode(c) { /*eslint no-bitwise:0*/ // broken sequence if (c >= 55296 && c <= 57343) { return false; } // never used if (c >= 64976 && c <= 65007) { return false; } if ((c & 65535) === 65535 || (c & 65535) === 65534) { return false; } // control codes if (c >= 0 && c <= 8) { return false; } if (c === 11) { return false; } if (c >= 14 && c <= 31) { return false; } if (c >= 127 && c <= 159) { return false; } // out of range if (c > 1114111) { return false; } return true; } function fromCodePoint(c) { /*eslint no-bitwise:0*/ if (c > 65535) { c -= 65536; var surrogate1 = 55296 + (c >> 10), surrogate2 = 56320 + (c & 1023); return String.fromCharCode(surrogate1, surrogate2); } return String.fromCharCode(c); } var UNESCAPE_MD_RE = /\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g; var ENTITY_RE = /&([a-z#][a-z0-9]{1,31});/gi; var UNESCAPE_ALL_RE = new RegExp(UNESCAPE_MD_RE.source + "|" + ENTITY_RE.source, "gi"); var DIGITAL_ENTITY_TEST_RE = /^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i; function replaceEntityPattern(match, name) { var code = 0; if (has(entities, name)) { return entities[name]; } if (name.charCodeAt(0) === 35 /* # */ && DIGITAL_ENTITY_TEST_RE.test(name)) { code = name[1].toLowerCase() === "x" ? parseInt(name.slice(2), 16) : parseInt(name.slice(1), 10); if (isValidEntityCode(code)) { return fromCodePoint(code); } } return match; } /*function replaceEntities(str) { if (str.indexOf('&') < 0) { return str; } return str.replace(ENTITY_RE, replaceEntityPattern); }*/ function unescapeMd(str) { if (str.indexOf("\\") < 0) { return str; } return str.replace(UNESCAPE_MD_RE, "$1"); } function unescapeAll(str) { if (str.indexOf("\\") < 0 && str.indexOf("&") < 0) { return str; } return str.replace(UNESCAPE_ALL_RE, (function(match, escaped, entity) { if (escaped) { return escaped; } return replaceEntityPattern(match, entity); })); } //////////////////////////////////////////////////////////////////////////////// var HTML_ESCAPE_TEST_RE = /[&<>"]/; var HTML_ESCAPE_REPLACE_RE = /[&<>"]/g; var HTML_REPLACEMENTS = { "&": "&", "<": "<", ">": ">", '"': """ }; function replaceUnsafeChar(ch) { return HTML_REPLACEMENTS[ch]; } function escapeHtml(str) { if (HTML_ESCAPE_TEST_RE.test(str)) { return str.replace(HTML_ESCAPE_REPLACE_RE, replaceUnsafeChar); } return str; } //////////////////////////////////////////////////////////////////////////////// var REGEXP_ESCAPE_RE = /[.?*+^$[\]\\(){}|-]/g; function escapeRE(str) { return str.replace(REGEXP_ESCAPE_RE, "\\$&"); } //////////////////////////////////////////////////////////////////////////////// function isSpace(code) { switch (code) { case 9: case 32: return true; } return false; } // Zs (unicode class) || [\t\f\v\r\n] function isWhiteSpace(code) { if (code >= 8192 && code <= 8202) { return true; } switch (code) { case 9: // \t case 10: // \n case 11: // \v case 12: // \f case 13: // \r case 32: case 160: case 5760: case 8239: case 8287: case 12288: return true; } return false; } //////////////////////////////////////////////////////////////////////////////// /*eslint-disable max-len*/ // Currently without astral characters support. function isPunctChar(ch) { return regex$4.test(ch); } // Markdown ASCII punctuation characters. // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ // http://spec.commonmark.org/0.15/#ascii-punctuation-character // Don't confuse with unicode punctuation !!! It lacks some chars in ascii range. function isMdAsciiPunct(ch) { switch (ch) { case 33 /* ! */ : case 34 /* " */ : case 35 /* # */ : case 36 /* $ */ : case 37 /* % */ : case 38 /* & */ : case 39 /* ' */ : case 40 /* ( */ : case 41 /* ) */ : case 42 /* * */ : case 43 /* + */ : case 44 /* , */ : case 45 /* - */ : case 46 /* . */ : case 47 /* / */ : case 58 /* : */ : case 59 /* ; */ : case 60 /* < */ : case 61 /* = */ : case 62 /* > */ : case 63 /* ? */ : case 64 /* @ */ : case 91 /* [ */ : case 92 /* \ */ : case 93 /* ] */ : case 94 /* ^ */ : case 95 /* _ */ : case 96 /* ` */ : case 123 /* { */ : case 124 /* | */ : case 125 /* } */ : case 126 /* ~ */ : return true; default: return false; } } // Hepler to unify [reference labels]. function normalizeReference(str) { // Trim and collapse whitespace str = str.trim().replace(/\s+/g, " "); // In node v10 'ẞ'.toLowerCase() === 'Ṿ', which is presumed to be a bug // fixed in v12 (couldn't find any details). // So treat this one as a special case // (remove this when node v10 is no longer supported). if ("\u1e9e".toLowerCase() === "\u1e7e") { str = str.replace(/\u1e9e/g, "\xdf"); } // .toLowerCase().toUpperCase() should get rid of all differences // between letter variants. // Simple .toLowerCase() doesn't normalize 125 code points correctly, // and .toUpperCase doesn't normalize 6 of them (list of exceptions: // İ, ϴ, ẞ, Ω, K, Å - those are already uppercased, but have differently // uppercased versions). // Here's an example showing how it happens. Lets take greek letter omega: // uppercase U+0398 (Θ), U+03f4 (ϴ) and lowercase U+03b8 (θ), U+03d1 (ϑ) // Unicode entries: // 0398;GREEK CAPITAL LETTER THETA;Lu;0;L;;;;;N;;;;03B8; // 03B8;GREEK SMALL LETTER THETA;Ll;0;L;;;;;N;;;0398;;0398 // 03D1;GREEK THETA SYMBOL;Ll;0;L;<compat> 03B8;;;;N;GREEK SMALL LETTER SCRIPT THETA;;0398;;0398 // 03F4;GREEK CAPITAL THETA SYMBOL;Lu;0;L;<compat> 0398;;;;N;;;;03B8; // Case-insensitive comparison should treat all of them as equivalent. // But .toLowerCase() doesn't change ϑ (it's already lowercase), // and .toUpperCase() doesn't change ϴ (already uppercase). // Applying first lower then upper case normalizes any character: // '\u0398\u03f4\u03b8\u03d1'.toLowerCase().toUpperCase() === '\u0398\u0398\u0398\u0398' // Note: this is equivalent to unicode case folding; unicode normalization // is a different step that is not required here. // Final result should be uppercased, because it's later stored in an object // (this avoid a conflict with Object.prototype members, // most notably, `__proto__`) return str.toLowerCase().toUpperCase(); } //////////////////////////////////////////////////////////////////////////////// // Re-export libraries commonly used in both markdown-it and its plugins, // so plugins won't have to depend on them explicitly, which reduces their // bundled size (e.g. a browser build). exports.lib = {}; exports.lib.mdurl = mdurl; exports.lib.ucmicro = uc_micro; exports.assign = assign; exports.isString = isString; exports.has = has; exports.unescapeMd = unescapeMd; exports.unescapeAll = unescapeAll; exports.isValidEntityCode = isValidEntityCode; exports.fromCodePoint = fromCodePoint; // exports.replaceEntities = replaceEntities; exports.escapeHtml = escapeHtml; exports.arrayReplaceAt = arrayReplaceAt; exports.isSpace = isSpace; exports.isWhiteSpace = isWhiteSpace; exports.isMdAsciiPunct = isMdAsciiPunct; exports.isPunctChar = isPunctChar; exports.escapeRE = escapeRE; exports.normalizeReference = normalizeReference; })); // Parse link label var parse_link_label = function parseLinkLabel(state, start, disableNested) { var level, found, marker, prevPos, labelEnd = -1, max = state.posMax, oldPos = state.pos; state.pos = start + 1; level = 1; while (state.pos < max) { marker = state.src.charCodeAt(state.pos); if (marker === 93 /* ] */) { level--; if (level === 0) { found = true; break; } } prevPos = state.pos; state.md.inline.skipToken(state); if (marker === 91 /* [ */) { if (prevPos === state.pos - 1) { // increase level if we find text `[`, which is not a part of any token level++; } else if (disableNested) { state.pos = oldPos; return -1; } } } if (found) { labelEnd = state.pos; } // restore old state state.pos = oldPos; return labelEnd; }; var unescapeAll$2 = utils.unescapeAll; var parse_link_destination = function parseLinkDestination(str, pos, max) { var code, level, lines = 0, start = pos, result = { ok: false, pos: 0, lines: 0, str: "" }; if (str.charCodeAt(pos) === 60 /* < */) { pos++; while (pos < max) { code = str.charCodeAt(pos); if (code === 10 /* \n */) { return result; } if (code === 60 /* < */) { return result; } if (code === 62 /* > */) { result.pos = pos + 1; result.str = unescapeAll$2(str.slice(start + 1, pos)); result.ok = true; return result; } if (code === 92 /* \ */ && pos + 1 < max) { pos += 2; continue; } pos++; } // no closing '>' return result; } // this should be ... } else { ... branch level = 0; while (pos < max) { code = str.charCodeAt(pos); if (code === 32) { break; } // ascii control characters if (code < 32 || code === 127) { break; } if (code === 92 /* \ */ && pos + 1 < max) { if (str.charCodeAt(pos + 1) === 32) { break; } pos += 2; continue; } if (code === 40 /* ( */) { level++; if (level > 32) { return result; } } if (code === 41 /* ) */) { if (level === 0) { break; } level--; } pos++; } if (start === pos) { return result; } if (level !== 0) { return result; } result.str = unescapeAll$2(str.slice(start, pos)); result.lines = lines; result.pos = pos; result.ok = true; return result; }; var unescapeAll$1 = utils.unescapeAll; var parse_link_title = function parseLinkTitle(str, pos, max) { var code, marker, lines = 0, start = pos, result = { ok: false, pos: 0, lines: 0, str: "" }; if (pos >= max) { return result; } marker = str.charCodeAt(pos); if (marker !== 34 /* " */ && marker !== 39 /* ' */ && marker !== 40 /* ( */) { return result; } pos++; // if opening marker is "(", switch it to closing marker ")" if (marker === 40) { marker = 41; } while (pos < max) { code = str.charCodeAt(pos); if (code === marker) { result.pos = pos + 1; result.lines = lines; result.str = unescapeAll$1(str.slice(start + 1, pos)); result.ok = true; return result; } else if (code === 40 /* ( */ && marker === 41 /* ) */) { return result; } else if (code === 10) { lines++; } else if (code === 92 /* \ */ && pos + 1 < max) { pos++; if (str.charCodeAt(pos) === 10) { lines++; } } pos++; } return result; }; var parseLinkLabel = parse_link_label; var parseLinkDestination = parse_link_destination; var parseLinkTitle = parse_link_title; var helpers = { parseLinkLabel: parseLinkLabel, parseLinkDestination: parseLinkDestination, parseLinkTitle: parseLinkTitle }; var assign$1 = utils.assign; var unescapeAll = utils.unescapeAll; var escapeHtml = utils.escapeHtml; //////////////////////////////////////////////////////////////////////////////// var default_rules = {}; default_rules.code_inline = function(tokens, idx, options, env, slf) { var token = tokens[idx]; return "<code" + slf.renderAttrs(token) + ">" + escapeHtml(tokens[idx].content) + "</code>"; }; default_rules.code_block = function(tokens, idx, options, env, slf) { var token = tokens[idx]; return "<pre" + slf.renderAttrs(token) + "><code>" + escapeHtml(tokens[idx].content) + "</code></pre>\n"; }; default_rules.fence = function(tokens, idx, options, env, slf) { var token = tokens[idx], info = token.info ? unescapeAll(token.info).trim() : "", langName = "", langAttrs = "", highlighted, i, arr, tmpAttrs, tmpToken; if (info) { arr = info.split(/(\s+)/g); langName = arr[0]; langAttrs = arr.slice(2).join(""); } if (options.highlight) { highlighted = options.highlight(token.content, langName, langAttrs) || escapeHtml(token.content); } else { highlighted = escapeHtml(token.content); } if (highlighted.indexOf("<pre") === 0) { return highlighted + "\n"; } // If language exists, inject class gently, without modifying original token. // May be, one day we will add .deepClone() for token and simplify this part, but // now we prefer to keep things local. if (info) { i = token.attrIndex("class"); tmpAttrs = token.attrs ? token.attrs.slice() : []; if (i < 0) { tmpAttrs.push([ "class", options.langPrefix + langName ]); } else { tmpAttrs[i] = tmpAttrs[i].slice(); tmpAttrs[i][1] += " " + options.langPrefix + langName; } // Fake token just to render attributes tmpToken = { attrs: tmpAttrs }; return "<pre><code" + slf.renderAttrs(tmpToken) + ">" + highlighted + "</code></pre>\n"; } return "<pre><code" + slf.renderAttrs(token) + ">" + highlighted + "</code></pre>\n"; }; default_rules.image = function(tokens, idx, options, env, slf) { var token = tokens[idx]; // "alt" attr MUST be set, even if empty. Because it's mandatory and // should be placed on proper position for tests. // Replace content with actual value token.attrs[token.attrIndex("alt")][1] = slf.renderInlineAsText(token.children, options, env); return slf.renderToken(tokens, idx, options); }; default_rules.hardbreak = function(tokens, idx, options /*, env */) { return options.xhtmlOut ? "<br />\n" : "<br>\n"; }; default_rules.softbreak = function(tokens, idx, options /*, env */) { return options.breaks ? options.xhtmlOut ? "<br />\n" : "<br>\n" : "\n"; }; default_rules.text = function(tokens, idx /*, options, env */) { return escapeHtml(tokens[idx].content); }; default_rules.html_block = function(tokens, idx /*, options, env */) { return tokens[idx].content; }; default_rules.html_inline = function(tokens, idx /*, options, env */) { return tokens[idx].content; }; /** * new Renderer() * * Creates new [[Renderer]] instance and fill [[Renderer#rules]] with defaults. **/ function Renderer() { /** * Renderer#rules -> Object * * Contains render rules for tokens. Can be updated and extended. * * ##### Example * * ```javascript * var md = require('markdown-it')(); * * md.renderer.rules.strong_open = function () { return '<b>'; }; * md.renderer.rules.strong_close = function () { return '</b>'; }; * * var result = md.renderInline(...); * ``` * * Each rule is called as independent static function with fixed signature: * * ```javascript * function my_token_render(tokens, idx, options, env, renderer) { * // ... * return renderedHTML; * } * ``` * * See [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js) * for more details and examples. **/ this.rules = assign$1({}, default_rules); } /** * Renderer.renderAttrs(token) -> String * * Render token attributes to string. **/ Renderer.prototype.renderAttrs = function renderAttrs(token) { var i, l, result; if (!token.attrs) { return ""; } result = ""; for (i = 0, l = token.attrs.length; i < l; i++) { result += " " + escapeHtml(token.attrs[i][0]) + '="' + escapeHtml(token.attrs[i][1]) + '"'; } return result; }; /** * Renderer.renderToken(tokens, idx, options) -> String * - tokens (Array): list of tokens * - idx (Numbed): token index to render * - options (Object): params of parser instance * * Default token renderer. Can be overriden by custom function * in [[Renderer#rules]]. **/ Renderer.prototype.renderToken = function renderToken(tokens, idx, options) { var nextToken, result = "", needLf = false, token = tokens[idx]; // Tight list paragraphs if (token.hidden) { return ""; } // Insert a newline between hidden paragraph and subsequent opening // block-level tag. // For example, here we should insert a newline before blockquote: // - a // > if (token.block && token.nesting !== -1 && idx && tokens[idx - 1].hidden) { result += "\n"; } // Add token name, e.g. `<img` result += (token.nesting === -1 ? "</" : "<") + token.tag; // Encode attributes, e.g. `<img src="foo"` result += this.renderAttrs(token); // Add a slash for self-closing tags, e.g. `<img src="foo" /` if (token.nesting === 0 && options.xhtmlOut) { result += " /"; } // Check if we need to add a newline after this tag if (token.block) { needLf = true; if (token.nesting === 1) { if (idx + 1 < tokens.length) { nextToken = tokens[idx + 1]; if (nextToken.type === "inline" || nextToken.hidden) { // Block-level tag containing an inline tag. needLf = false; } else if (nextToken.nesting === -1 && nextToken.tag === token.tag) { // Opening tag + closing tag of the same type. E.g. `<li></li>`. needLf = false; } } } } result += needLf ? ">\n" : ">"; return result; }; /** * Renderer.renderInline(tokens, options, env) -> String * - tokens (Array): list on block tokens to renter * - options (Object): params of parser instance * - env (Object): additional data from parsed input (references, for example) * * The same as [[Renderer.render]], but for single token of `inline` type. **/ Renderer.prototype.renderInline = function(tokens, options, env) { var type, result = "", rules = this.rules; for (var i = 0, len = tokens.length; i < len; i++) { type = tokens[i].type; if (typeof rules[type] !== "undefined") { result += rules[type](tokens, i, options, env, this); } else { result += this.renderToken(tokens, i, options); } } return result; }; /** internal * Renderer.renderInlineAsText(tokens, options, env) -> String * - tokens (Array): list on block tokens to renter * - options (Object): params of parser instance * - env (Object): additional data from parsed input (references, for example) * * Special kludge for image `alt` attributes to conform CommonMark spec. * Don't try to use it! Spec requires to show `alt` content with stripped markup, * instead of simple escaping. **/ Renderer.prototype.renderInlineAsText = function(tokens, options, env) { var result = ""; for (var i = 0, len = tokens.length; i < len; i++) { if (tokens[i].type === "text") { result += tokens[i].content; } else if (tokens[i].type === "image") { result += this.renderInlineAsText(tokens[i].children, options, env); } else if (tokens[i].type === "softbreak") { result += "\n"; } } return result; }; /** * Renderer.render(tokens, options, env) -> String * - tokens (Array): list on block tokens to renter * - options (Object): params of parser instance * - env (Object): additional data from parsed input (references, for example) * * Takes token stream and generates HTML. Probably, you will never need to call * this method directly. **/ Renderer.prototype.render = function(tokens, options, env) { var i, len, type, result = "", rules = this.rules; for (i = 0, len = tokens.length; i < len; i++) { type = tokens[i].type; if (type === "inline") { result += this.renderInline(tokens[i].children, options, env); } else if (typeof rules[type] !== "undefined") { result += rules[tokens[i].type](tokens, i, options, env, this); } else { result += this.renderToken(tokens, i, options, env); } } return result; }; var renderer = Renderer; /** * class Ruler * * Helper class, used by [[MarkdownIt#core]], [[MarkdownIt#block]] and * [[MarkdownIt#inline]] to manage sequences of functions (rules): * * - keep rules in defined order * - assign the name to each rule * - enable/disable rules * - add/replace rules * - allow assign rules to additional named chains (in the same) * - cacheing lists of active rules * * You will not need use this class directly until write plugins. For simple * rules control use [[MarkdownIt.disable]], [[MarkdownIt.enable]] and * [[MarkdownIt.use]]. **/ /** * new Ruler() **/ function Ruler() { // List of added rules. Each element is: // { // name: XXX, // enabled: Boolean, // fn: Function(), // alt: [ name2, name3 ] // } this.__rules__ = []; // Cached rule chains. // First level - chain name, '' for default. // Second level - diginal anchor for fast filtering by charcodes. this.__cache__ = null; } //////////////////////////////////////////////////////////////////////////////// // Helper methods, should not be used directly // Find rule index by name Ruler.prototype.__find__ = function(name) { for (var i = 0; i < this.__rules__.length; i++) { if (this.__rules__[i].name === name) { return i; } } return -1; }; // Build rules lookup cache Ruler.prototype.__compile__ = function() { var self = this; var chains = [ "" ]; // collect unique names self.__rules__.forEach((function(rule) { if (!rule.enabled) { return; } rule.alt.forEach((function(altName) { if (chains.indexOf(altName) < 0) { chains.push(altName); } })); })); self.__cache__ = {}; chains.forEach((function(chain) { self.__cache__[chain] = []; self.__rules__.forEach((function(rule) { if (!rule.enabled) { return; } if (chain && rule.alt.indexOf(chain) < 0) { return; } self.__cache__[chain].push(rule.fn); })); })); }; /** * Ruler.at(name, fn [, options]) * - name (String): rule name to replace. * - fn (Function): new rule function. * - options (Object): new rule options (not mandatory). * * Replace rule by name with new function & options. Throws error if name not * found. * * ##### Options: * * - __alt__ - array with names of "alternate" chains. * * ##### Example * * Replace existing typographer replacement rule with new one: * * ```javascript * var md = require('markdown-it')(); * * md.core.ruler.at('replacements', function replace(state) { * //... * }); * ``` **/ Ruler.prototype.at = function(name, fn, options) { var index = this.__find__(name); var opt = options || {}; if (index === -1) { throw new Error("Parser rule not found: " + name); } this.__rules__[index].fn = fn; this.__rules__[index].alt = opt.alt || []; this.__cache__ = null; }; /** * Ruler.before(beforeName, ruleName, fn [, options]) * - beforeName (String): new rule will be added before this one. * - ruleName (String): name of added rule. * - fn (Function): rule function. * - options (Object): rule options (not mandatory). * * Add new rule to chain before one with given name. See also * [[Ruler.after]], [[Ruler.push]]. * * ##### Options: * * - __alt__ - array with names of "alternate" chains. * * ##### Example * * ```javascript * var md = require('markdown-it')(); * * md.block.ruler.before('paragraph', 'my_rule', function replace(state) { * //... * }); * ``` **/ Ruler.prototype.before = function(beforeName, ruleName, fn, options) { var index = this.__find__(beforeName); var opt = options || {}; if (index === -1) { throw new Error("Parser rule not found: " + beforeName); } this.__rules__.splice(index, 0, { name: ruleName, enabled: true, fn: fn, alt: opt.alt || [] }); this.__cache__ = null; }; /** * Ruler.after(afterName, ruleName, fn [, options]) * - afterName (String): new rule will be added after this one. * - ruleName (String): name of added rule. * - fn (Function): rule function. * - options (Object): rule options (not mandatory). * * Add new rule to chain after one with given name. See also * [[Ruler.before]], [[Ruler.push]]. * * ##### Options: * * - __alt__ - array with names of "alternate" chains. * * ##### Example * * ```javascript * var md = require('markdown-it')(); * * md.inline.ruler.after('text', 'my_rule', function replace(state) { * //... * }); * ``` **/ Ruler.prototype.after = function(afterName, ruleName, fn, options) { var index = this.__find__(afterName); var opt = options || {}; if (index === -1) { throw new Error("Parser rule not found: " + afterName); } this.__rules__.splice(index + 1, 0, { name: ruleName, enabled: true, fn: fn, alt: opt.alt || [] }); this.__cache__ = null; }; /** * Ruler.push(ruleName, fn [, options]) * - ruleName (String): name of added rule. * - fn (Function): rule function. * - options (Object): rule options (not mandatory). * * Push new rule to the end of chain. See also * [[Ruler.before]], [[Ruler.after]]. * * ##### Options: * * - __alt__ - array with names of "alternate" chains. * * ##### Example * * ```javascript * var md = require('markdown-it')(); * * md.core.ruler.push('my_rule', function replace(state) { * //... * }); * ``` **/ Ruler.prototype.push = function(ruleName, fn, options) { var opt = options || {}; this.__rules__.push({ name: ruleName, enabled: true, fn: fn, alt: opt.alt || [] }); this.__cache__ = null; }; /** * Ruler.enable(list [, ignoreInvalid]) -> Array * - list (String|Array): list of rule names to enable. * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. * * Enable rules with given names. If any rule name not found - throw Error. * Errors can be disabled by second param. * * Returns list of found rule names (if no exception happened). * * See also [[Ruler.disable]], [[Ruler.enableOnly]]. **/ Ruler.prototype.enable = function(list, ignoreInvalid) { if (!Array.isArray(list)) { list = [ list ]; } var result = []; // Search by name and enable list.forEach((function(name) { var idx = this.__find__(name); if (idx < 0) { if (ignoreInvalid) { return; } throw new Error("Rules manager: invalid rule name " + name); } this.__rules__[idx].enabled = true; result.push(name); }), this); this.__cache__ = null; return result; }; /** * Ruler.enableOnly(list [, ignoreInvalid]) * - list (String|Array): list of rule names to enable (whitelist). * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. * * Enable rules with given names, and disable everything else. If any rule name * not found - throw Error. Errors can be disabled by second param. * * See also [[Ruler.disable]], [[Ruler.enable]]. **/ Ruler.prototype.enableOnly = function(list, ignoreInvalid) { if (!Array.isArray(list)) { list = [ list ]; } this.__rules__.forEach((function(rule) { rule.enabled = false; })); this.enable(list, ignoreInvalid); }; /** * Ruler.disable(list [, ignoreInvalid]) -> Array * - list (String|Array): list of rule names to disable. * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. * * Disable rules with given names. If any rule name not found - throw Error. * Errors can be disabled by second param. * * Returns list of found rule names (if no exception happened). * * See also [[Ruler.enable]], [[Ruler.enableOnly]]. **/ Ruler.prototype.disable = function(list, ignoreInvalid) { if (!Array.isArray(list)) { list = [ list ]; } var result = []; // Search by name and disable list.forEach((function(name) { var idx = this.__find__(name); if (idx < 0) { if (ignoreInvalid) { return; } throw new Error("Rules manager: invalid rule name " + name); } this.__rules__[idx].enabled = false; result.push(name); }), this); this.__cache__ = null; return result; }; /** * Ruler.getRules(chainName) -> Array * * Return array of active functions (rules) for given chain name. It analyzes * rules configuration, compiles caches if not exists and returns result. * * Default chain name is `''` (empty string). It can't be skipped. That's * done intentionally, to keep signature monomorphic for high speed. **/ Ruler.prototype.getRules = function(chainName) { if (this.__cache__ === null) { this.__compile__(); } // Chain can be empty, if rules disabled. But we still have to return Array. return this.__cache__[chainName] || []; }; var ruler = Ruler; // Normalize input string // https://spec.commonmark.org/0.29/#line-ending var NEWLINES_RE = /\r\n?|\n/g; var NULL_RE = /\0/g; var normalize = function normalize(state) { var str; // Normalize newlines str = state.src.replace(NEWLINES_RE, "\n"); // Replace NULL characters str = str.replace(NULL_RE, "\ufffd"); state.src = str; }; var block = function block(state) { var token; if (state.inlineMode) { token = new state.Token("inline", "", 0); token.content = state.src; token.map = [ 0, 1 ]; token.children = []; state.tokens.push(token); } else { state.md.block.parse(state.src, state.md, state.env, state.tokens); } }; var inline = function inline(state) { var tokens = state.tokens, tok, i, l; // Parse inlines for (i = 0, l = tokens.length; i < l; i++) { tok = tokens[i]; if (tok.type === "inline") { state.md.inline.parse(tok.content, state.md, state.env, tok.children); } } }; var arrayReplaceAt = utils.arrayReplaceAt; function isLinkOpen(str) { return /^<a[>\s]/i.test(str); } function isLinkClose(str) { return /^<\/a\s*>/i.test(str); } var linkify = function linkify(state) { var i, j, l, tokens, token, currentToken, nodes, ln, text, pos, lastPos, level, htmlLinkLevel, url, fullUrl, urlText, blockTokens = state.tokens, links; if (!state.md.options.linkify) { return; } for (j = 0, l = blockTokens.length; j < l; j++) { if (blockTokens[j].type !== "inline" || !state.md.linkify.pretest(blockTokens[j].content)) { continue; } tokens = blockTokens[j].children; htmlLinkLevel = 0; // We scan from the end, to keep position when new tags added. // Use reversed logic in links start/end match for (i = tokens.length - 1; i >= 0; i--) { currentToken = tokens[i]; // Skip content of markdown links if (currentToken.type === "link_close") { i--; while (tokens[i].level !== currentToken.level && tokens[i].type !== "link_open") { i--; } continue; } // Skip content of html tag links if (currentToken.type === "html_inline") { if (isLinkOpen(currentToken.content) && htmlLinkLevel > 0) { htmlLinkLevel--; } if (isLinkClose(currentToken.content)) { htmlLinkLevel++; } } if (htmlLinkLevel > 0) { continue; } if (currentToken.type === "text" && state.md.linkify.test(currentToken.content)) { text = currentToken.content; links = state.md.linkify.match(text); // Now split string to nodes nodes = []; level = currentToken.level; lastPos = 0; for (ln = 0; ln < links.length; ln++) { url = links[ln].url; fullUrl = state.md.normalizeLink(url); if (!state.md.validateLink(fullUrl)) { continue; } urlText = links[ln].text; // Linkifier might send raw hostnames like "example.com", where url // starts with domain name. So we prepend http:// in those cases, // and remove it afterwards. if (!links[ln].schema) { urlText = state.md.normalizeLinkText("http://" + urlText).replace(/^http:\/\//, ""); } else if (links[ln].schema === "mailto:" && !/^mailto:/i.test(urlText)) { urlText = state.md.normalizeLinkText("mailto:" + urlText).replace(/^mailto:/, ""); } else { urlText = state.md.normalizeLinkText(urlText); } pos = links[ln].index; if (pos > lastPos) { token = new state.Token("text", "", 0); token.content = text.slice(lastPos, pos); token.level = level; nodes.push(token); } token = new state.Token("link_open", "a", 1); token.attrs = [ [ "href", fullUrl ] ]; token.level = level++; token.markup = "linkify"; token.info = "auto"; nodes.push(token); token = new state.Token("text", "", 0); token.content = urlText; token.level = level; nodes.push(token); token = new state.Token("link_close", "a", -1); token.level = --level; token.markup = "linkify"; token.info = "auto"; nodes.push(token); lastPos = links[ln].lastIndex; } if (lastPos < text.length) { token = new state.Token("text", "", 0); token.content = text.slice(lastPos); token.level = level; nodes.push(token); } // replace current node blockTokens[j].children = tokens = arrayReplaceAt(tokens, i, nodes); } } } }; // Simple typographic replacements // TODO: // - fractionals 1/2, 1/4, 3/4 -> ½, ¼, ¾ // - miltiplication 2 x 4 -> 2 × 4 var RARE_RE = /\+-|\.\.|\?\?\?\?|!!!!|,,|--/; // Workaround for phantomjs - need regex without /g flag, // or root check will fail every second time var SCOPED_ABBR_TEST_RE = /\((c|tm|r|p)\)/i; var SCOPED_ABBR_RE = /\((c|tm|r|p)\)/gi; var SCOPED_ABBR = { c: "\xa9", r: "\xae", p: "\xa7", tm: "\u2122" }; function replaceFn(match, name) { return SCOPED_ABBR[name.toLowerCase()]; } function replace_scoped(inlineTokens) { var i, token, inside_autolink = 0; for (i = inlineTokens.length - 1; i >= 0; i--) { token = inlineTokens[i]; if (token.type === "text" && !inside_autolink) { token.content = token.content.replace(SCOPED_ABBR_RE, replaceFn); } if (token.type === "link_open" && token.info === "auto") { inside_autolink--; } if (token.type === "link_close" && token.info === "auto") { inside_autolink++; } } } function replace_rare(inlineTokens) { var i, token, inside_autolink = 0; for (i = inlineTokens.length - 1; i >= 0; i--) { token = inlineTokens[i]; if (token.type === "text" && !inside_autolink) { if (RARE_RE.test(token.content)) { token.content = token.content.replace(/\+-/g, "\xb1").replace(/\.{2,}/g, "\u2026").replace(/([?!])\u2026/g, "$1..").replace(/([?!]){4,}/g, "$1$1$1").replace(/,{2,}/g, ",").replace(/(^|[^-])---(?=[^-]|$)/gm, "$1\u2014").replace(/(^|\s)--(?=\s|$)/gm, "$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm, "$1\u2013"); } } if (token.type === "link_open" && token.info === "auto") { inside_autolink--; } if (token.type === "link_close" && token.info === "auto") { inside_autolink++; } } } var replacements = function replace(state) { var blkIdx; if (!state.md.options.typographer) { return; } for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { if (state.tokens[blkIdx].type !== "inline") { continue; } if (SCOPED_ABBR_TEST_RE.test(state.tokens[blkIdx].content)) { replace_scoped(state.tokens[blkIdx].children); } if (RARE_RE.test(state.tokens[blkIdx].content)) { replace_rare(state.tokens[blkIdx].children); } } }; var isWhiteSpace$1 = utils.isWhiteSpace; var isPunctChar$1 = utils.isPunctChar; var isMdAsciiPunct$1 = utils.isMdAsciiPunct; var QUOTE_TEST_RE = /['"]/; var QUOTE_RE = /['"]/g; var APOSTROPHE = "\u2019"; /* ’ */ function replaceAt(str, index, ch) { return str.substr(0, index) + ch + str.substr(index + 1); } function process_inlines(tokens, state) { var i, token, text, t, pos, max, thisLevel, item, lastChar, nextChar, isLastPunctChar, isNextPunctChar, isLastWhiteSpace, isNextWhiteSpace, canOpen, canClose, j, isSingle, stack, openQuote, closeQuote; stack = []; for (i = 0; i < tokens.length; i++) { token = tokens[i]; thisLevel = tokens[i].level; for (j = stack.length - 1; j >= 0; j--) { if (stack[j].level <= thisLevel) { break; } } stack.length = j + 1; if (token.type !== "text") { continue; } text = token.content; pos = 0; max = text.length; /*eslint no-labels:0,block-scoped-var:0*/ OUTER: while (pos < max) { QUOTE_RE.lastIndex = pos; t = QUOTE_RE.exec(text); if (!t) { break; } canOpen = canClose = true; pos = t.index + 1; isSingle = t[0] === "'"; // Find previous character, // default to space if it's the beginning of the line lastChar = 32; if (t.index - 1 >= 0) { lastChar = text.charCodeAt(t.index - 1); } else { for (j = i - 1; j >= 0; j--) { if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; // lastChar defaults to 0x20 if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline' lastChar = tokens[j].content.charCodeAt(tokens[j].content.length - 1); break; } } // Find next character, // default to space if it's the end of the line nextChar = 32; if (pos < max) { nextChar = text.charCodeAt(pos); } else { for (j = i + 1; j < tokens.length; j++) { if (tokens[j].type === "softbreak" || tokens[j].type === "hardbreak") break; // nextChar defaults to 0x20 if (!tokens[j].content) continue; // should skip all tokens except 'text', 'html_inline' or 'code_inline' nextChar = tokens[j].content.charCodeAt(0); break; } } isLastPunctChar = isMdAsciiPunct$1(lastChar) || isPunctChar$1(String.fromCharCode(lastChar)); isNextPunctChar = isMdAsciiPunct$1(nextChar) || isPunctChar$1(String.fromCharCode(nextChar)); isLastWhiteSpace = isWhiteSpace$1(lastChar); isNextWhiteSpace = isWhiteSpace$1(nextChar); if (isNextWhiteSpace) { canOpen = false; } else if (isNextPunctChar) { if (!(isLastWhiteSpace || isLastPunctChar)) { canOpen = false; } } if (isLastWhiteSpace) { canClose = false; } else if (isLastPunctChar) { if (!(isNextWhiteSpace || isNextPunctChar)) { canClose = false; } } if (nextChar === 34 /* " */ && t[0] === '"') { if (lastChar >= 48 /* 0 */ && lastChar <= 57 /* 9 */) { // special case: 1"" - count first quote as an inch canClose = canOpen = false; } } if (canOpen && canClose) { // Replace quotes in the middle of punctuation sequence, but not // in the middle of the words, i.e.: // 1. foo " bar " baz - not replaced // 2. foo-"-bar-"-baz - replaced // 3. foo"bar"baz - not replaced canOpen = isLastPunctChar; canClose = isNextPunctChar; } if (!canOpen && !canClose) { // middle of word if (isSingle) { token.content = replaceAt(token.content, t.index, APOSTROPHE); } continue; } if (canClose) { // this could be a closing quote, rewind the stack to get a match for (j = stack.length - 1; j >= 0; j--) { item = stack[j]; if (stack[j].level < thisLevel) { break; } if (item.single === isSingle && stack[j].level === thisLevel) { item = stack[j]; if (isSingle) { openQuote = state.md.options.quotes[2]; closeQuote = state.md.options.quotes[3]; } else { openQuote = state.md.options.quotes[0]; closeQuote = state.md.options.quotes[1]; } // replace token.content *before* tokens[item.token].content, // because, if they are pointing at the same token, replaceAt // could mess up indices when quote length != 1 token.content = replaceAt(token.content, t.index, closeQuote); tokens[item.token].content = replaceAt(tokens[item.token].content, item.pos, openQuote); pos += closeQuote.length - 1; if (item.token === i) { pos += openQuote.length - 1; } text = token.content; max = text.length; stack.length = j; continue OUTER; } } } if (canOpen) { stack.push({ token: i, pos: t.index, single: isSingle, level: thisLevel }); } else if (canClose && isSingle) { token.content = replaceAt(token.content, t.index, APOSTROPHE); } } } } var smartquotes = function smartquotes(state) { /*eslint max-depth:0*/ var blkIdx; if (!state.md.options.typographer) { return; } for (blkIdx = state.tokens.length - 1; blkIdx >= 0; blkIdx--) { if (state.tokens[blkIdx].type !== "inline" || !QUOTE_TEST_RE.test(state.tokens[blkIdx].content)) { continue; } process_inlines(state.tokens[blkIdx].children, state); } }; // Token class /** * class Token **/ /** * new Token(type, tag, nesting) * * Create new token and fill passed properties. **/ function Token(type, tag, nesting) { /** * Token#type -> String * * Type of the token (string, e.g. "paragraph_open") **/ this.type = type; /** * Token#tag -> String * * html tag name, e.g. "p" **/ this.tag = tag; /** * Token#attrs -> Array * * Html attributes. Format: `[ [ name1, value1 ], [ name2, value2 ] ]` **/ this.attrs = null; /** * Token#map -> Array * * Source map info. Format: `[ line_begin, line_end ]` **/ this.map = null; /** * Token#nesting -> Number * * Level change (number in {-1, 0, 1} set), where: * * - `1` means the tag is opening * - `0` means the tag is self-closing * - `-1` means the tag is closing **/ this.nesting = nesting; /** * Token#level -> Number * * nesting level, the same as `state.level` **/ this.level = 0; /** * Token#children -> Array * * An array of child nodes (inline and img tokens) **/ this.children = null; /** * Token#content -> String * * In a case of self-closing tag (code, html, fence, etc.), * it has contents of this tag. **/ this.content = ""; /** * Token#markup -> String * * '*' or '_' for emphasis, fence string for fence, etc. **/ this.markup = ""; /** * Token#info -> String * * Additional information: * * - Info string for "fence" tokens * - The value "auto" for autolink "link_open" and "link_close" tokens * - The string value of the item marker for ordered-list "list_item_open" tokens **/ this.info = ""; /** * Token#meta -> Object * * A place for plugins to store an arbitrary data **/ this.meta = null; /** * Token#block -> Boolean * * True for block-level tokens, false for inline tokens. * Used in renderer to calculate line breaks **/ this.block = false; /** * Token#hidden -> Boolean * * If it's true, ignore this element when rendering. Used for tight lists * to hide paragraphs. **/ this.hidden = false; } /** * Token.attrIndex(name) -> Number * * Search attribute index by name. **/ Token.prototype.attrIndex = function attrIndex(name) { var attrs, i, len; if (!this.attrs) { return -1; } attrs = this.attrs; for (i = 0, len = attrs.length; i < len; i++) { if (attrs[i][0] === name) { return i; } } return -1; }; /** * Token.attrPush(attrData) * * Add `[ name, value ]` attribute to list. Init attrs if necessary **/ Token.prototype.attrPush = function attrPush(attrData) { if (this.attrs) { this.attrs.push(attrData); } else { this.attrs = [ attrData ]; } }; /** * Token.attrSet(name, value) * * Set `name` attribute to `value`. Override old value if exists. **/ Token.prototype.attrSet = function attrSet(name, value) { var idx = this.attrIndex(name), attrData = [ name, value ]; if (idx < 0) { this.attrPush(attrData); } else { this.attrs[idx] = attrData; } }; /** * Token.attrGet(name) * * Get the value of attribute `name`, or null if it does not exist. **/ Token.prototype.attrGet = function attrGet(name) { var idx = this.attrIndex(name), value = null; if (idx >= 0) { value = this.attrs[idx][1]; } return value; }; /** * Token.attrJoin(name, value) * * Join value to existing attribute via space. Or create new attribute if not * exists. Useful to operate with token classes. **/ Token.prototype.attrJoin = function attrJoin(name, value) { var idx = this.attrIndex(name); if (idx < 0) { this.attrPush([ name, value ]); } else { this.attrs[idx][1] = this.attrs[idx][1] + " " + value; } }; var token = Token; function StateCore(src, md, env) { this.src = src; this.env = env; this.tokens = []; this.inlineMode = false; this.md = md; // link to parser instance } // re-export Token class to use in core rules StateCore.prototype.Token = token; var state_core = StateCore; var _rules$2 = [ [ "normalize", normalize ], [ "block", block ], [ "inline", inline ], [ "linkify", linkify ], [ "replacements", replacements ], [ "smartquotes", smartquotes ] ]; /** * new Core() **/ function Core() { /** * Core#ruler -> Ruler * * [[Ruler]] instance. Keep configuration of core rules. **/ this.ruler = new ruler; for (var i = 0; i < _rules$2.length; i++) { this.ruler.push(_rules$2[i][0], _rules$2[i][1]); } } /** * Core.process(state) * * Executes core chain rules. **/ Core.prototype.process = function(state) { var i, l, rules; rules = this.ruler.getRules(""); for (i = 0, l = rules.length; i < l; i++) { rules[i](state); } }; Core.prototype.State = state_core; var parser_core = Core; var isSpace$a = utils.isSpace; function getLine(state, line) { var pos = state.bMarks[line] + state.tShift[line], max = state.eMarks[line]; return state.src.substr(pos, max - pos); } function escapedSplit(str) { var result = [], pos = 0, max = str.length, ch, isEscaped = false, lastPos = 0, current = ""; ch = str.charCodeAt(pos); while (pos < max) { if (ch === 124 /* | */) { if (!isEscaped) { // pipe separating cells, '|' result.push(current + str.substring(lastPos, pos)); current = ""; lastPos = pos + 1; } else { // escaped pipe, '\|' current += str.substring(lastPos, pos - 1); lastPos = pos; } } isEscaped = ch === 92 /* \ */; pos++; ch = str.charCodeAt(pos); } result.push(current + str.substring(lastPos)); return result; } var table = function table(state, startLine, endLine, silent) { var ch, lineText, pos, i, l, nextLine, columns, columnCount, token, aligns, t, tableLines, tbodyLines, oldParentType, terminate, terminatorRules, firstCh, secondCh; // should have at least two lines if (startLine + 2 > endLine) { return false; } nextLine = startLine + 1; if (state.sCount[nextLine] < state.blkIndent) { return false; } // if it's indented more than 3 spaces, it should be a code block if (state.sCount[nextLine] - state.blkIndent >= 4) { return false; } // first character of the second line should be '|', '-', ':', // and no other characters are allowed but spaces; // basically, this is the equivalent of /^[-:|][-:|\s]*$/ regexp pos = state.bMarks[nextLine] + state.tShift[nextLine]; if (pos >= state.eMarks[nextLine]) { return false; } firstCh = state.src.charCodeAt(pos++); if (firstCh !== 124 /* | */ && firstCh !== 45 /* - */ && firstCh !== 58 /* : */) { return false; } if (pos >= state.eMarks[nextLine]) { return false; } secondCh = state.src.charCodeAt(pos++); if (secondCh !== 124 /* | */ && secondCh !== 45 /* - */ && secondCh !== 58 /* : */ && !isSpace$a(secondCh)) { return false; } // if first character is '-', then second character must not be a space // (due to parsing ambiguity with list) if (firstCh === 45 /* - */ && isSpace$a(secondCh)) { return false; } while (pos < state.eMarks[nextLine]) { ch = state.src.charCodeAt(pos); if (ch !== 124 /* | */ && ch !== 45 /* - */ && ch !== 58 /* : */ && !isSpace$a(ch)) { return false; } pos++; } lineText = getLine(state, startLine + 1); columns = lineText.split("|"); aligns = []; for (i = 0; i < columns.length; i++) { t = columns[i].trim(); if (!t) { // allow empty columns before and after table, but not in between columns; // e.g. allow ` |---| `, disallow ` ---||--- ` if (i === 0 || i === columns.length - 1) { continue; } else { return false; } } if (!/^:?-+:?$/.test(t)) { return false; } if (t.charCodeAt(t.length - 1) === 58 /* : */) { aligns.push(t.charCodeAt(0) === 58 /* : */ ? "center" : "right"); } else if (t.charCodeAt(0) === 58 /* : */) { aligns.push("left"); } else { aligns.push(""); } } lineText = getLine(state, startLine).trim(); if (lineText.indexOf("|") === -1) { return false; } if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } columns = escapedSplit(lineText); if (columns.length && columns[0] === "") columns.shift(); if (columns.length && columns[columns.length - 1] === "") columns.pop(); // header row will define an amount of columns in the entire table, // and align row should be exactly the same (the rest of the rows can differ) columnCount = columns.length; if (columnCount === 0 || columnCount !== aligns.length) { return false; } if (silent) { return true; } oldParentType = state.parentType; state.parentType = "table"; // use 'blockquote' lists for termination because it's // the most similar to tables terminatorRules = state.md.block.ruler.getRules("blockquote"); token = state.push("table_open", "table", 1); token.map = tableLines = [ startLine, 0 ]; token = state.push("thead_open", "thead", 1); token.map = [ startLine, startLine + 1 ]; token = state.push("tr_open", "tr", 1); token.map = [ startLine, startLine + 1 ]; for (i = 0; i < columns.length; i++) { token = state.push("th_open", "th", 1); if (aligns[i]) { token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; } token = state.push("inline", "", 0); token.content = columns[i].trim(); token.children = []; token = state.push("th_close", "th", -1); } token = state.push("tr_close", "tr", -1); token = state.push("thead_close", "thead", -1); for (nextLine = startLine + 2; nextLine < endLine; nextLine++) { if (state.sCount[nextLine] < state.blkIndent) { break; } terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { break; } lineText = getLine(state, nextLine).trim(); if (!lineText) { break; } if (state.sCount[nextLine] - state.blkIndent >= 4) { break; } columns = escapedSplit(lineText); if (columns.length && columns[0] === "") columns.shift(); if (columns.length && columns[columns.length - 1] === "") columns.pop(); if (nextLine === startLine + 2) { token = state.push("tbody_open", "tbody", 1); token.map = tbodyLines = [ startLine + 2, 0 ]; } token = state.push("tr_open", "tr", 1); token.map = [ nextLine, nextLine + 1 ]; for (i = 0; i < columnCount; i++) { token = state.push("td_open", "td", 1); if (aligns[i]) { token.attrs = [ [ "style", "text-align:" + aligns[i] ] ]; } token = state.push("inline", "", 0); token.content = columns[i] ? columns[i].trim() : ""; token.children = []; token = state.push("td_close", "td", -1); } token = state.push("tr_close", "tr", -1); } if (tbodyLines) { token = state.push("tbody_close", "tbody", -1); tbodyLines[1] = nextLine; } token = state.push("table_close", "table", -1); tableLines[1] = nextLine; state.parentType = oldParentType; state.line = nextLine; return true; }; // Code block (4 spaces padded) var code = function code(state, startLine, endLine /*, silent*/) { var nextLine, last, token; if (state.sCount[startLine] - state.blkIndent < 4) { return false; } last = nextLine = startLine + 1; while (nextLine < endLine) { if (state.isEmpty(nextLine)) { nextLine++; continue; } if (state.sCount[nextLine] - state.blkIndent >= 4) { nextLine++; last = nextLine; continue; } break; } state.line = last; token = state.push("code_block", "code", 0); token.content = state.getLines(startLine, last, 4 + state.blkIndent, false) + "\n"; token.map = [ startLine, state.line ]; return true; }; // fences (``` lang, ~~~ lang) var fence = function fence(state, startLine, endLine, silent) { var marker, len, params, nextLine, mem, token, markup, haveEndMarker = false, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } if (pos + 3 > max) { return false; } marker = state.src.charCodeAt(pos); if (marker !== 126 /* ~ */ && marker !== 96 /* ` */) { return false; } // scan marker length mem = pos; pos = state.skipChars(pos, marker); len = pos - mem; if (len < 3) { return false; } markup = state.src.slice(mem, pos); params = state.src.slice(pos, max); if (marker === 96 /* ` */) { if (params.indexOf(String.fromCharCode(marker)) >= 0) { return false; } } // Since start is found, we can report success here in validation mode if (silent) { return true; } // search end of block nextLine = startLine; for (;;) { nextLine++; if (nextLine >= endLine) { // unclosed block should be autoclosed by end of document. // also block seems to be autoclosed by end of parent break; } pos = mem = state.bMarks[nextLine] + state.tShift[nextLine]; max = state.eMarks[nextLine]; if (pos < max && state.sCount[nextLine] < state.blkIndent) { // non-empty line with negative indent should stop the list: // - ``` // test break; } if (state.src.charCodeAt(pos) !== marker) { continue; } if (state.sCount[nextLine] - state.blkIndent >= 4) { // closing fence should be indented less than 4 spaces continue; } pos = state.skipChars(pos, marker); // closing code fence must be at least as long as the opening one if (pos - mem < len) { continue; } // make sure tail has spaces only pos = state.skipSpaces(pos); if (pos < max) { continue; } haveEndMarker = true; // found! break; } // If a fence has heading spaces, they should be removed from its inner block len = state.sCount[startLine]; state.line = nextLine + (haveEndMarker ? 1 : 0); token = state.push("fence", "code", 0); token.info = params; token.content = state.getLines(startLine + 1, nextLine, len, true); token.markup = markup; token.map = [ startLine, state.line ]; return true; }; var isSpace$9 = utils.isSpace; var blockquote = function blockquote(state, startLine, endLine, silent) { var adjustTab, ch, i, initial, l, lastLineEmpty, lines, nextLine, offset, oldBMarks, oldBSCount, oldIndent, oldParentType, oldSCount, oldTShift, spaceAfterMarker, terminate, terminatorRules, token, isOutdented, oldLineMax = state.lineMax, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } // check the block quote marker if (state.src.charCodeAt(pos++) !== 62 /* > */) { return false; } // we know that it's going to be a valid blockquote, // so no point trying to find the end of it in silent mode if (silent) { return true; } // set offset past spaces and ">" initial = offset = state.sCount[startLine] + 1; // skip one optional space after '>' if (state.src.charCodeAt(pos) === 32 /* space */) { // ' > test ' // ^ -- position start of line here: pos++; initial++; offset++; adjustTab = false; spaceAfterMarker = true; } else if (state.src.charCodeAt(pos) === 9 /* tab */) { spaceAfterMarker = true; if ((state.bsCount[startLine] + offset) % 4 === 3) { // ' >\t test ' // ^ -- position start of line here (tab has width===1) pos++; initial++; offset++; adjustTab = false; } else { // ' >\t test ' // ^ -- position start of line here + shift bsCount slightly // to make extra space appear adjustTab = true; } } else { spaceAfterMarker = false; } oldBMarks = [ state.bMarks[startLine] ]; state.bMarks[startLine] = pos; while (pos < max) { ch = state.src.charCodeAt(pos); if (isSpace$9(ch)) { if (ch === 9) { offset += 4 - (offset + state.bsCount[startLine] + (adjustTab ? 1 : 0)) % 4; } else { offset++; } } else { break; } pos++; } oldBSCount = [ state.bsCount[startLine] ]; state.bsCount[startLine] = state.sCount[startLine] + 1 + (spaceAfterMarker ? 1 : 0); lastLineEmpty = pos >= max; oldSCount = [ state.sCount[startLine] ]; state.sCount[startLine] = offset - initial; oldTShift = [ state.tShift[startLine] ]; state.tShift[startLine] = pos - state.bMarks[startLine]; terminatorRules = state.md.block.ruler.getRules("blockquote"); oldParentType = state.parentType; state.parentType = "blockquote"; // Search the end of the block // Block ends with either: // 1. an empty line outside: // ``` // > test // ``` // 2. an empty line inside: // ``` // > // test // ``` // 3. another tag: // ``` // > test // - - - // ``` for (nextLine = startLine + 1; nextLine < endLine; nextLine++) { // check if it's outdented, i.e. it's inside list item and indented // less than said list item: // ``` // 1. anything // > current blockquote // 2. checking this line // ``` isOutdented = state.sCount[nextLine] < state.blkIndent; pos = state.bMarks[nextLine] + state.tShift[nextLine]; max = state.eMarks[nextLine]; if (pos >= max) { // Case 1: line is not inside the blockquote, and this line is empty. break; } if (state.src.charCodeAt(pos++) === 62 /* > */ && !isOutdented) { // This line is inside the blockquote. // set offset past spaces and ">" initial = offset = state.sCount[nextLine] + 1; // skip one optional space after '>' if (state.src.charCodeAt(pos) === 32 /* space */) { // ' > test ' // ^ -- position start of line here: pos++; initial++; offset++; adjustTab = false; spaceAfterMarker = true; } else if (state.src.charCodeAt(pos) === 9 /* tab */) { spaceAfterMarker = true; if ((state.bsCount[nextLine] + offset) % 4 === 3) { // ' >\t test ' // ^ -- position start of line here (tab has width===1) pos++; initial++; offset++; adjustTab = false; } else { // ' >\t test ' // ^ -- position start of line here + shift bsCount slightly // to make extra space appear adjustTab = true; } } else { spaceAfterMarker = false; } oldBMarks.push(state.bMarks[nextLine]); state.bMarks[nextLine] = pos; while (pos < max) { ch = state.src.charCodeAt(pos); if (isSpace$9(ch)) { if (ch === 9) { offset += 4 - (offset + state.bsCount[nextLine] + (adjustTab ? 1 : 0)) % 4; } else { offset++; } } else { break; } pos++; } lastLineEmpty = pos >= max; oldBSCount.push(state.bsCount[nextLine]); state.bsCount[nextLine] = state.sCount[nextLine] + 1 + (spaceAfterMarker ? 1 : 0); oldSCount.push(state.sCount[nextLine]); state.sCount[nextLine] = offset - initial; oldTShift.push(state.tShift[nextLine]); state.tShift[nextLine] = pos - state.bMarks[nextLine]; continue; } // Case 2: line is not inside the blockquote, and the last line was empty. if (lastLineEmpty) { break; } // Case 3: another tag found. terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { // Quirk to enforce "hard termination mode" for paragraphs; // normally if you call `tokenize(state, startLine, nextLine)`, // paragraphs will look below nextLine for paragraph continuation, // but if blockquote is terminated by another tag, they shouldn't state.lineMax = nextLine; if (state.blkIndent !== 0) { // state.blkIndent was non-zero, we now set it to zero, // so we need to re-calculate all offsets to appear as // if indent wasn't changed oldBMarks.push(state.bMarks[nextLine]); oldBSCount.push(state.bsCount[nextLine]); oldTShift.push(state.tShift[nextLine]); oldSCount.push(state.sCount[nextLine]); state.sCount[nextLine] -= state.blkIndent; } break; } oldBMarks.push(state.bMarks[nextLine]); oldBSCount.push(state.bsCount[nextLine]); oldTShift.push(state.tShift[nextLine]); oldSCount.push(state.sCount[nextLine]); // A negative indentation means that this is a paragraph continuation state.sCount[nextLine] = -1; } oldIndent = state.blkIndent; state.blkIndent = 0; token = state.push("blockquote_open", "blockquote", 1); token.markup = ">"; token.map = lines = [ startLine, 0 ]; state.md.block.tokenize(state, startLine, nextLine); token = state.push("blockquote_close", "blockquote", -1); token.markup = ">"; state.lineMax = oldLineMax; state.parentType = oldParentType; lines[1] = state.line; // Restore original tShift; this might not be necessary since the parser // has already been here, but just to make sure we can do that. for (i = 0; i < oldTShift.length; i++) { state.bMarks[i + startLine] = oldBMarks[i]; state.tShift[i + startLine] = oldTShift[i]; state.sCount[i + startLine] = oldSCount[i]; state.bsCount[i + startLine] = oldBSCount[i]; } state.blkIndent = oldIndent; return true; }; var isSpace$8 = utils.isSpace; var hr = function hr(state, startLine, endLine, silent) { var marker, cnt, ch, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } marker = state.src.charCodeAt(pos++); // Check hr marker if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 95 /* _ */) { return false; } // markers can be mixed with spaces, but there should be at least 3 of them cnt = 1; while (pos < max) { ch = state.src.charCodeAt(pos++); if (ch !== marker && !isSpace$8(ch)) { return false; } if (ch === marker) { cnt++; } } if (cnt < 3) { return false; } if (silent) { return true; } state.line = startLine + 1; token = state.push("hr", "hr", 0); token.map = [ startLine, state.line ]; token.markup = Array(cnt + 1).join(String.fromCharCode(marker)); return true; }; var isSpace$7 = utils.isSpace; // Search `[-+*][\n ]`, returns next pos after marker on success // or -1 on fail. function skipBulletListMarker(state, startLine) { var marker, pos, max, ch; pos = state.bMarks[startLine] + state.tShift[startLine]; max = state.eMarks[startLine]; marker = state.src.charCodeAt(pos++); // Check bullet if (marker !== 42 /* * */ && marker !== 45 /* - */ && marker !== 43 /* + */) { return -1; } if (pos < max) { ch = state.src.charCodeAt(pos); if (!isSpace$7(ch)) { // " -test " - is not a list item return -1; } } return pos; } // Search `\d+[.)][\n ]`, returns next pos after marker on success // or -1 on fail. function skipOrderedListMarker(state, startLine) { var ch, start = state.bMarks[startLine] + state.tShift[startLine], pos = start, max = state.eMarks[startLine]; // List marker should have at least 2 chars (digit + dot) if (pos + 1 >= max) { return -1; } ch = state.src.charCodeAt(pos++); if (ch < 48 /* 0 */ || ch > 57 /* 9 */) { return -1; } for (;;) { // EOL -> fail if (pos >= max) { return -1; } ch = state.src.charCodeAt(pos++); if (ch >= 48 /* 0 */ && ch <= 57 /* 9 */) { // List marker should have no more than 9 digits // (prevents integer overflow in browsers) if (pos - start >= 10) { return -1; } continue; } // found valid marker if (ch === 41 /* ) */ || ch === 46 /* . */) { break; } return -1; } if (pos < max) { ch = state.src.charCodeAt(pos); if (!isSpace$7(ch)) { // " 1.test " - is not a list item return -1; } } return pos; } function markTightParagraphs(state, idx) { var i, l, level = state.level + 2; for (i = idx + 2, l = state.tokens.length - 2; i < l; i++) { if (state.tokens[i].level === level && state.tokens[i].type === "paragraph_open") { state.tokens[i + 2].hidden = true; state.tokens[i].hidden = true; i += 2; } } } var list = function list(state, startLine, endLine, silent) { var ch, contentStart, i, indent, indentAfterMarker, initial, isOrdered, itemLines, l, listLines, listTokIdx, markerCharCode, markerValue, max, nextLine, offset, oldListIndent, oldParentType, oldSCount, oldTShift, oldTight, pos, posAfterMarker, prevEmptyEnd, start, terminate, terminatorRules, token, isTerminatingParagraph = false, tight = true; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } // Special case: // - item 1 // - item 2 // - item 3 // - item 4 // - this one is a paragraph continuation if (state.listIndent >= 0 && state.sCount[startLine] - state.listIndent >= 4 && state.sCount[startLine] < state.blkIndent) { return false; } // limit conditions when list can interrupt // a paragraph (validation mode only) if (silent && state.parentType === "paragraph") { // Next list item should still terminate previous list item; // This code can fail if plugins use blkIndent as well as lists, // but I hope the spec gets fixed long before that happens. if (state.tShift[startLine] >= state.blkIndent) { isTerminatingParagraph = true; } } // Detect list type and position after marker if ((posAfterMarker = skipOrderedListMarker(state, startLine)) >= 0) { isOrdered = true; start = state.bMarks[startLine] + state.tShift[startLine]; markerValue = Number(state.src.slice(start, posAfterMarker - 1)); // If we're starting a new ordered list right after // a paragraph, it should start with 1. if (isTerminatingParagraph && markerValue !== 1) return false; } else if ((posAfterMarker = skipBulletListMarker(state, startLine)) >= 0) { isOrdered = false; } else { return false; } // If we're starting a new unordered list right after // a paragraph, first line should not be empty. if (isTerminatingParagraph) { if (state.skipSpaces(posAfterMarker) >= state.eMarks[startLine]) return false; } // We should terminate list on style change. Remember first one to compare. markerCharCode = state.src.charCodeAt(posAfterMarker - 1); // For validation mode we can terminate immediately if (silent) { return true; } // Start list listTokIdx = state.tokens.length; if (isOrdered) { token = state.push("ordered_list_open", "ol", 1); if (markerValue !== 1) { token.attrs = [ [ "start", markerValue ] ]; } } else { token = state.push("bullet_list_open", "ul", 1); } token.map = listLines = [ startLine, 0 ]; token.markup = String.fromCharCode(markerCharCode); // Iterate list items nextLine = startLine; prevEmptyEnd = false; terminatorRules = state.md.block.ruler.getRules("list"); oldParentType = state.parentType; state.parentType = "list"; while (nextLine < endLine) { pos = posAfterMarker; max = state.eMarks[nextLine]; initial = offset = state.sCount[nextLine] + posAfterMarker - (state.bMarks[startLine] + state.tShift[startLine]); while (pos < max) { ch = state.src.charCodeAt(pos); if (ch === 9) { offset += 4 - (offset + state.bsCount[nextLine]) % 4; } else if (ch === 32) { offset++; } else { break; } pos++; } contentStart = pos; if (contentStart >= max) { // trimming space in "- \n 3" case, indent is 1 here indentAfterMarker = 1; } else { indentAfterMarker = offset - initial; } // If we have more than 4 spaces, the indent is 1 // (the rest is just indented code block) if (indentAfterMarker > 4) { indentAfterMarker = 1; } // " - test" // ^^^^^ - calculating total length of this thing indent = initial + indentAfterMarker; // Run subparser & write tokens token = state.push("list_item_open", "li", 1); token.markup = String.fromCharCode(markerCharCode); token.map = itemLines = [ startLine, 0 ]; if (isOrdered) { token.info = state.src.slice(start, posAfterMarker - 1); } // change current state, then restore it after parser subcall oldTight = state.tight; oldTShift = state.tShift[startLine]; oldSCount = state.sCount[startLine]; // - example list // ^ listIndent position will be here // ^ blkIndent position will be here oldListIndent = state.listIndent; state.listIndent = state.blkIndent; state.blkIndent = indent; state.tight = true; state.tShift[startLine] = contentStart - state.bMarks[startLine]; state.sCount[startLine] = offset; if (contentStart >= max && state.isEmpty(startLine + 1)) { // workaround for this case // (list item is empty, list terminates before "foo"): // ~~~~~~~~ // - // foo // ~~~~~~~~ state.line = Math.min(state.line + 2, endLine); } else { state.md.block.tokenize(state, startLine, endLine, true); } // If any of list item is tight, mark list as tight if (!state.tight || prevEmptyEnd) { tight = false; } // Item become loose if finish with empty line, // but we should filter last element, because it means list finish prevEmptyEnd = state.line - startLine > 1 && state.isEmpty(state.line - 1); state.blkIndent = state.listIndent; state.listIndent = oldListIndent; state.tShift[startLine] = oldTShift; state.sCount[startLine] = oldSCount; state.tight = oldTight; token = state.push("list_item_close", "li", -1); token.markup = String.fromCharCode(markerCharCode); nextLine = startLine = state.line; itemLines[1] = nextLine; contentStart = state.bMarks[startLine]; if (nextLine >= endLine) { break; } // Try to check if list is terminated or continued. if (state.sCount[nextLine] < state.blkIndent) { break; } // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { break; } // fail if terminating block found terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { break; } // fail if list has another type if (isOrdered) { posAfterMarker = skipOrderedListMarker(state, nextLine); if (posAfterMarker < 0) { break; } start = state.bMarks[nextLine] + state.tShift[nextLine]; } else { posAfterMarker = skipBulletListMarker(state, nextLine); if (posAfterMarker < 0) { break; } } if (markerCharCode !== state.src.charCodeAt(posAfterMarker - 1)) { break; } } // Finalize list if (isOrdered) { token = state.push("ordered_list_close", "ol", -1); } else { token = state.push("bullet_list_close", "ul", -1); } token.markup = String.fromCharCode(markerCharCode); listLines[1] = nextLine; state.line = nextLine; state.parentType = oldParentType; // mark paragraphs tight if needed if (tight) { markTightParagraphs(state, listTokIdx); } return true; }; var normalizeReference$2 = utils.normalizeReference; var isSpace$6 = utils.isSpace; var reference = function reference(state, startLine, _endLine, silent) { var ch, destEndPos, destEndLineNo, endLine, href, i, l, label, labelEnd, oldParentType, res, start, str, terminate, terminatorRules, title, lines = 0, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine], nextLine = startLine + 1; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } if (state.src.charCodeAt(pos) !== 91 /* [ */) { return false; } // Simple check to quickly interrupt scan on [link](url) at the start of line. // Can be useful on practice: https://github.com/markdown-it/markdown-it/issues/54 while (++pos < max) { if (state.src.charCodeAt(pos) === 93 /* ] */ && state.src.charCodeAt(pos - 1) !== 92 /* \ */) { if (pos + 1 === max) { return false; } if (state.src.charCodeAt(pos + 1) !== 58 /* : */) { return false; } break; } } endLine = state.lineMax; // jump line-by-line until empty one or EOF terminatorRules = state.md.block.ruler.getRules("reference"); oldParentType = state.parentType; state.parentType = "reference"; for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { // this would be a code block normally, but after paragraph // it's considered a lazy continuation regardless of what's there if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } // quirk for blockquotes, this line should already be checked by that rule if (state.sCount[nextLine] < 0) { continue; } // Some tags can terminate paragraph without empty line. terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { break; } } str = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); max = str.length; for (pos = 1; pos < max; pos++) { ch = str.charCodeAt(pos); if (ch === 91 /* [ */) { return false; } else if (ch === 93 /* ] */) { labelEnd = pos; break; } else if (ch === 10 /* \n */) { lines++; } else if (ch === 92 /* \ */) { pos++; if (pos < max && str.charCodeAt(pos) === 10) { lines++; } } } if (labelEnd < 0 || str.charCodeAt(labelEnd + 1) !== 58 /* : */) { return false; } // [label]: destination 'title' // ^^^ skip optional whitespace here for (pos = labelEnd + 2; pos < max; pos++) { ch = str.charCodeAt(pos); if (ch === 10) { lines++; } else if (isSpace$6(ch)) ; else { break; } } // [label]: destination 'title' // ^^^^^^^^^^^ parse this res = state.md.helpers.parseLinkDestination(str, pos, max); if (!res.ok) { return false; } href = state.md.normalizeLink(res.str); if (!state.md.validateLink(href)) { return false; } pos = res.pos; lines += res.lines; // save cursor state, we could require to rollback later destEndPos = pos; destEndLineNo = lines; // [label]: destination 'title' // ^^^ skipping those spaces start = pos; for (;pos < max; pos++) { ch = str.charCodeAt(pos); if (ch === 10) { lines++; } else if (isSpace$6(ch)) ; else { break; } } // [label]: destination 'title' // ^^^^^^^ parse this res = state.md.helpers.parseLinkTitle(str, pos, max); if (pos < max && start !== pos && res.ok) { title = res.str; pos = res.pos; lines += res.lines; } else { title = ""; pos = destEndPos; lines = destEndLineNo; } // skip trailing spaces until the rest of the line while (pos < max) { ch = str.charCodeAt(pos); if (!isSpace$6(ch)) { break; } pos++; } if (pos < max && str.charCodeAt(pos) !== 10) { if (title) { // garbage at the end of the line after title, // but it could still be a valid reference if we roll back title = ""; pos = destEndPos; lines = destEndLineNo; while (pos < max) { ch = str.charCodeAt(pos); if (!isSpace$6(ch)) { break; } pos++; } } } if (pos < max && str.charCodeAt(pos) !== 10) { // garbage at the end of the line return false; } label = normalizeReference$2(str.slice(1, labelEnd)); if (!label) { // CommonMark 0.20 disallows empty labels return false; } // Reference can not terminate anything. This check is for safety only. /*istanbul ignore if*/ if (silent) { return true; } if (typeof state.env.references === "undefined") { state.env.references = {}; } if (typeof state.env.references[label] === "undefined") { state.env.references[label] = { title: title, href: href }; } state.parentType = oldParentType; state.line = startLine + lines + 1; return true; }; // List of valid html blocks names, accorting to commonmark spec var html_blocks = [ "address", "article", "aside", "base", "basefont", "blockquote", "body", "caption", "center", "col", "colgroup", "dd", "details", "dialog", "dir", "div", "dl", "dt", "fieldset", "figcaption", "figure", "footer", "form", "frame", "frameset", "h1", "h2", "h3", "h4", "h5", "h6", "head", "header", "hr", "html", "iframe", "legend", "li", "link", "main", "menu", "menuitem", "nav", "noframes", "ol", "optgroup", "option", "p", "param", "section", "source", "summary", "table", "tbody", "td", "tfoot", "th", "thead", "title", "tr", "track", "ul" ]; // Regexps to match html elements var attr_name = "[a-zA-Z_:][a-zA-Z0-9:._-]*"; var unquoted = "[^\"'=<>`\\x00-\\x20]+"; var single_quoted = "'[^']*'"; var double_quoted = '"[^"]*"'; var attr_value = "(?:" + unquoted + "|" + single_quoted + "|" + double_quoted + ")"; var attribute = "(?:\\s+" + attr_name + "(?:\\s*=\\s*" + attr_value + ")?)"; var open_tag = "<[A-Za-z][A-Za-z0-9\\-]*" + attribute + "*\\s*\\/?>"; var close_tag = "<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>"; var comment = "\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e"; var processing = "<[?][\\s\\S]*?[?]>"; var declaration = "<![A-Z]+\\s+[^>]*>"; var cdata = "<!\\[CDATA\\[[\\s\\S]*?\\]\\]>"; var HTML_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + "|" + comment + "|" + processing + "|" + declaration + "|" + cdata + ")"); var HTML_OPEN_CLOSE_TAG_RE$1 = new RegExp("^(?:" + open_tag + "|" + close_tag + ")"); var HTML_TAG_RE_1 = HTML_TAG_RE$1; var HTML_OPEN_CLOSE_TAG_RE_1 = HTML_OPEN_CLOSE_TAG_RE$1; var html_re = { HTML_TAG_RE: HTML_TAG_RE_1, HTML_OPEN_CLOSE_TAG_RE: HTML_OPEN_CLOSE_TAG_RE_1 }; var HTML_OPEN_CLOSE_TAG_RE = html_re.HTML_OPEN_CLOSE_TAG_RE; // An array of opening and corresponding closing sequences for html tags, // last argument defines whether it can terminate a paragraph or not var HTML_SEQUENCES = [ [ /^<(script|pre|style|textarea)(?=(\s|>|$))/i, /<\/(script|pre|style|textarea)>/i, true ], [ /^<!--/, /-->/, true ], [ /^<\?/, /\?>/, true ], [ /^<![A-Z]/, />/, true ], [ /^<!\[CDATA\[/, /\]\]>/, true ], [ new RegExp("^</?(" + html_blocks.join("|") + ")(?=(\\s|/?>|$))", "i"), /^$/, true ], [ new RegExp(HTML_OPEN_CLOSE_TAG_RE.source + "\\s*$"), /^$/, false ] ]; var html_block = function html_block(state, startLine, endLine, silent) { var i, nextLine, token, lineText, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } if (!state.md.options.html) { return false; } if (state.src.charCodeAt(pos) !== 60 /* < */) { return false; } lineText = state.src.slice(pos, max); for (i = 0; i < HTML_SEQUENCES.length; i++) { if (HTML_SEQUENCES[i][0].test(lineText)) { break; } } if (i === HTML_SEQUENCES.length) { return false; } if (silent) { // true if this sequence can be a terminator, false otherwise return HTML_SEQUENCES[i][2]; } nextLine = startLine + 1; // If we are here - we detected HTML block. // Let's roll down till block end. if (!HTML_SEQUENCES[i][1].test(lineText)) { for (;nextLine < endLine; nextLine++) { if (state.sCount[nextLine] < state.blkIndent) { break; } pos = state.bMarks[nextLine] + state.tShift[nextLine]; max = state.eMarks[nextLine]; lineText = state.src.slice(pos, max); if (HTML_SEQUENCES[i][1].test(lineText)) { if (lineText.length !== 0) { nextLine++; } break; } } } state.line = nextLine; token = state.push("html_block", "", 0); token.map = [ startLine, nextLine ]; token.content = state.getLines(startLine, nextLine, state.blkIndent, true); return true; }; var isSpace$5 = utils.isSpace; var heading = function heading(state, startLine, endLine, silent) { var ch, level, tmp, token, pos = state.bMarks[startLine] + state.tShift[startLine], max = state.eMarks[startLine]; // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } ch = state.src.charCodeAt(pos); if (ch !== 35 /* # */ || pos >= max) { return false; } // count heading level level = 1; ch = state.src.charCodeAt(++pos); while (ch === 35 /* # */ && pos < max && level <= 6) { level++; ch = state.src.charCodeAt(++pos); } if (level > 6 || pos < max && !isSpace$5(ch)) { return false; } if (silent) { return true; } // Let's cut tails like ' ### ' from the end of string max = state.skipSpacesBack(max, pos); tmp = state.skipCharsBack(max, 35, pos); // # if (tmp > pos && isSpace$5(state.src.charCodeAt(tmp - 1))) { max = tmp; } state.line = startLine + 1; token = state.push("heading_open", "h" + String(level), 1); token.markup = "########".slice(0, level); token.map = [ startLine, state.line ]; token = state.push("inline", "", 0); token.content = state.src.slice(pos, max).trim(); token.map = [ startLine, state.line ]; token.children = []; token = state.push("heading_close", "h" + String(level), -1); token.markup = "########".slice(0, level); return true; }; // lheading (---, ===) var lheading = function lheading(state, startLine, endLine /*, silent*/) { var content, terminate, i, l, token, pos, max, level, marker, nextLine = startLine + 1, oldParentType, terminatorRules = state.md.block.ruler.getRules("paragraph"); // if it's indented more than 3 spaces, it should be a code block if (state.sCount[startLine] - state.blkIndent >= 4) { return false; } oldParentType = state.parentType; state.parentType = "paragraph"; // use paragraph to match terminatorRules // jump line-by-line until empty one or EOF for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { // this would be a code block normally, but after paragraph // it's considered a lazy continuation regardless of what's there if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } // Check for underline in setext header if (state.sCount[nextLine] >= state.blkIndent) { pos = state.bMarks[nextLine] + state.tShift[nextLine]; max = state.eMarks[nextLine]; if (pos < max) { marker = state.src.charCodeAt(pos); if (marker === 45 /* - */ || marker === 61 /* = */) { pos = state.skipChars(pos, marker); pos = state.skipSpaces(pos); if (pos >= max) { level = marker === 61 /* = */ ? 1 : 2; break; } } } } // quirk for blockquotes, this line should already be checked by that rule if (state.sCount[nextLine] < 0) { continue; } // Some tags can terminate paragraph without empty line. terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { break; } } if (!level) { // Didn't find valid underline return false; } content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); state.line = nextLine + 1; token = state.push("heading_open", "h" + String(level), 1); token.markup = String.fromCharCode(marker); token.map = [ startLine, state.line ]; token = state.push("inline", "", 0); token.content = content; token.map = [ startLine, state.line - 1 ]; token.children = []; token = state.push("heading_close", "h" + String(level), -1); token.markup = String.fromCharCode(marker); state.parentType = oldParentType; return true; }; // Paragraph var paragraph = function paragraph(state, startLine /*, endLine*/) { var content, terminate, i, l, token, oldParentType, nextLine = startLine + 1, terminatorRules = state.md.block.ruler.getRules("paragraph"), endLine = state.lineMax; oldParentType = state.parentType; state.parentType = "paragraph"; // jump line-by-line until empty one or EOF for (;nextLine < endLine && !state.isEmpty(nextLine); nextLine++) { // this would be a code block normally, but after paragraph // it's considered a lazy continuation regardless of what's there if (state.sCount[nextLine] - state.blkIndent > 3) { continue; } // quirk for blockquotes, this line should already be checked by that rule if (state.sCount[nextLine] < 0) { continue; } // Some tags can terminate paragraph without empty line. terminate = false; for (i = 0, l = terminatorRules.length; i < l; i++) { if (terminatorRules[i](state, nextLine, endLine, true)) { terminate = true; break; } } if (terminate) { break; } } content = state.getLines(startLine, nextLine, state.blkIndent, false).trim(); state.line = nextLine; token = state.push("paragraph_open", "p", 1); token.map = [ startLine, state.line ]; token = state.push("inline", "", 0); token.content = content; token.map = [ startLine, state.line ]; token.children = []; token = state.push("paragraph_close", "p", -1); state.parentType = oldParentType; return true; }; var isSpace$4 = utils.isSpace; function StateBlock(src, md, env, tokens) { var ch, s, start, pos, len, indent, offset, indent_found; this.src = src; // link to parser instance this.md = md; this.env = env; // Internal state vartiables this.tokens = tokens; this.bMarks = []; // line begin offsets for fast jumps this.eMarks = []; // line end offsets for fast jumps this.tShift = []; // offsets of the first non-space characters (tabs not expanded) this.sCount = []; // indents for each line (tabs expanded) // An amount of virtual spaces (tabs expanded) between beginning // of each line (bMarks) and real beginning of that line. // It exists only as a hack because blockquotes override bMarks // losing information in the process. // It's used only when expanding tabs, you can think about it as // an initial tab length, e.g. bsCount=21 applied to string `\t123` // means first tab should be expanded to 4-21%4 === 3 spaces. this.bsCount = []; // block parser variables this.blkIndent = 0; // required block content indent (for example, if we are // inside a list, it would be positioned after list marker) this.line = 0; // line index in src this.lineMax = 0; // lines count this.tight = false; // loose/tight mode for lists this.ddIndent = -1; // indent of the current dd block (-1 if there isn't any) this.listIndent = -1; // indent of the current list block (-1 if there isn't any) // can be 'blockquote', 'list', 'root', 'paragraph' or 'reference' // used in lists to determine if they interrupt a paragraph this.parentType = "root"; this.level = 0; // renderer this.result = ""; // Create caches // Generate markers. s = this.src; indent_found = false; for (start = pos = indent = offset = 0, len = s.length; pos < len; pos++) { ch = s.charCodeAt(pos); if (!indent_found) { if (isSpace$4(ch)) { indent++; if (ch === 9) { offset += 4 - offset % 4; } else { offset++; } continue; } else { indent_found = true; } } if (ch === 10 || pos === len - 1) { if (ch !== 10) { pos++; } this.bMarks.push(start); this.eMarks.push(pos); this.tShift.push(indent); this.sCount.push(offset); this.bsCount.push(0); indent_found = false; indent = 0; offset = 0; start = pos + 1; } } // Push fake entry to simplify cache bounds checks this.bMarks.push(s.length); this.eMarks.push(s.length); this.tShift.push(0); this.sCount.push(0); this.bsCount.push(0); this.lineMax = this.bMarks.length - 1; // don't count last fake line } // Push new token to "stream". StateBlock.prototype.push = function(type, tag, nesting) { var token$1 = new token(type, tag, nesting); token$1.block = true; if (nesting < 0) this.level--; // closing tag token$1.level = this.level; if (nesting > 0) this.level++; // opening tag this.tokens.push(token$1); return token$1; }; StateBlock.prototype.isEmpty = function isEmpty(line) { return this.bMarks[line] + this.tShift[line] >= this.eMarks[line]; }; StateBlock.prototype.skipEmptyLines = function skipEmptyLines(from) { for (var max = this.lineMax; from < max; from++) { if (this.bMarks[from] + this.tShift[from] < this.eMarks[from]) { break; } } return from; }; // Skip spaces from given position. StateBlock.prototype.skipSpaces = function skipSpaces(pos) { var ch; for (var max = this.src.length; pos < max; pos++) { ch = this.src.charCodeAt(pos); if (!isSpace$4(ch)) { break; } } return pos; }; // Skip spaces from given position in reverse. StateBlock.prototype.skipSpacesBack = function skipSpacesBack(pos, min) { if (pos <= min) { return pos; } while (pos > min) { if (!isSpace$4(this.src.charCodeAt(--pos))) { return pos + 1; } } return pos; }; // Skip char codes from given position StateBlock.prototype.skipChars = function skipChars(pos, code) { for (var max = this.src.length; pos < max; pos++) { if (this.src.charCodeAt(pos) !== code) { break; } } return pos; }; // Skip char codes reverse from given position - 1 StateBlock.prototype.skipCharsBack = function skipCharsBack(pos, code, min) { if (pos <= min) { return pos; } while (pos > min) { if (code !== this.src.charCodeAt(--pos)) { return pos + 1; } } return pos; }; // cut lines range from source. StateBlock.prototype.getLines = function getLines(begin, end, indent, keepLastLF) { var i, lineIndent, ch, first, last, queue, lineStart, line = begin; if (begin >= end) { return ""; } queue = new Array(end - begin); for (i = 0; line < end; line++, i++) { lineIndent = 0; lineStart = first = this.bMarks[line]; if (line + 1 < end || keepLastLF) { // No need for bounds check because we have fake entry on tail. last = this.eMarks[line] + 1; } else { last = this.eMarks[line]; } while (first < last && lineIndent < indent) { ch = this.src.charCodeAt(first); if (isSpace$4(ch)) { if (ch === 9) { lineIndent += 4 - (lineIndent + this.bsCount[line]) % 4; } else { lineIndent++; } } else if (first - lineStart < this.tShift[line]) { // patched tShift masked characters to look like spaces (blockquotes, list markers) lineIndent++; } else { break; } first++; } if (lineIndent > indent) { // partially expanding tabs in code blocks, e.g '\t\tfoobar' // with indent=2 becomes ' \tfoobar' queue[i] = new Array(lineIndent - indent + 1).join(" ") + this.src.slice(first, last); } else { queue[i] = this.src.slice(first, last); } } return queue.join(""); }; // re-export Token class to use in block rules StateBlock.prototype.Token = token; var state_block = StateBlock; var _rules$1 = [ // First 2 params - rule name & source. Secondary array - list of rules, // which can be terminated by this one. [ "table", table, [ "paragraph", "reference" ] ], [ "code", code ], [ "fence", fence, [ "paragraph", "reference", "blockquote", "list" ] ], [ "blockquote", blockquote, [ "paragraph", "reference", "blockquote", "list" ] ], [ "hr", hr, [ "paragraph", "reference", "blockquote", "list" ] ], [ "list", list, [ "paragraph", "reference", "blockquote" ] ], [ "reference", reference ], [ "html_block", html_block, [ "paragraph", "reference", "blockquote" ] ], [ "heading", heading, [ "paragraph", "reference", "blockquote" ] ], [ "lheading", lheading ], [ "paragraph", paragraph ] ]; /** * new ParserBlock() **/ function ParserBlock() { /** * ParserBlock#ruler -> Ruler * * [[Ruler]] instance. Keep configuration of block rules. **/ this.ruler = new ruler; for (var i = 0; i < _rules$1.length; i++) { this.ruler.push(_rules$1[i][0], _rules$1[i][1], { alt: (_rules$1[i][2] || []).slice() }); } } // Generate tokens for input range ParserBlock.prototype.tokenize = function(state, startLine, endLine) { var ok, i, rules = this.ruler.getRules(""), len = rules.length, line = startLine, hasEmptyLines = false, maxNesting = state.md.options.maxNesting; while (line < endLine) { state.line = line = state.skipEmptyLines(line); if (line >= endLine) { break; } // Termination condition for nested calls. // Nested calls currently used for blockquotes & lists if (state.sCount[line] < state.blkIndent) { break; } // If nesting level exceeded - skip tail to the end. That's not ordinary // situation and we should not care about content. if (state.level >= maxNesting) { state.line = endLine; break; } // Try all possible rules. // On success, rule should: // - update `state.line` // - update `state.tokens` // - return true for (i = 0; i < len; i++) { ok = rules[i](state, line, endLine, false); if (ok) { break; } } // set state.tight if we had an empty line before current tag // i.e. latest empty line should not count state.tight = !hasEmptyLines; // paragraph might "eat" one newline after it in nested lists if (state.isEmpty(state.line - 1)) { hasEmptyLines = true; } line = state.line; if (line < endLine && state.isEmpty(line)) { hasEmptyLines = true; line++; state.line = line; } } }; /** * ParserBlock.parse(str, md, env, outTokens) * * Process input string and push block tokens into `outTokens` **/ ParserBlock.prototype.parse = function(src, md, env, outTokens) { var state; if (!src) { return; } state = new this.State(src, md, env, outTokens); this.tokenize(state, state.line, state.lineMax); }; ParserBlock.prototype.State = state_block; var parser_block = ParserBlock; // Skip text characters for text token, place those to pending buffer // Rule to skip pure text // '{}$%@~+=:' reserved for extentions // !, ", #, $, %, &, ', (, ), *, +, ,, -, ., /, :, ;, <, =, >, ?, @, [, \, ], ^, _, `, {, |, }, or ~ // !!!! Don't confuse with "Markdown ASCII Punctuation" chars // http://spec.commonmark.org/0.15/#ascii-punctuation-character function isTerminatorChar(ch) { switch (ch) { case 10 /* \n */ : case 33 /* ! */ : case 35 /* # */ : case 36 /* $ */ : case 37 /* % */ : case 38 /* & */ : case 42 /* * */ : case 43 /* + */ : case 45 /* - */ : case 58 /* : */ : case 60 /* < */ : case 61 /* = */ : case 62 /* > */ : case 64 /* @ */ : case 91 /* [ */ : case 92 /* \ */ : case 93 /* ] */ : case 94 /* ^ */ : case 95 /* _ */ : case 96 /* ` */ : case 123 /* { */ : case 125 /* } */ : case 126 /* ~ */ : return true; default: return false; } } var text = function text(state, silent) { var pos = state.pos; while (pos < state.posMax && !isTerminatorChar(state.src.charCodeAt(pos))) { pos++; } if (pos === state.pos) { return false; } if (!silent) { state.pending += state.src.slice(state.pos, pos); } state.pos = pos; return true; }; var isSpace$3 = utils.isSpace; var newline = function newline(state, silent) { var pmax, max, pos = state.pos; if (state.src.charCodeAt(pos) !== 10 /* \n */) { return false; } pmax = state.pending.length - 1; max = state.posMax; // ' \n' -> hardbreak // Lookup in pending chars is bad practice! Don't copy to other rules! // Pending string is stored in concat mode, indexed lookups will cause // convertion to flat mode. if (!silent) { if (pmax >= 0 && state.pending.charCodeAt(pmax) === 32) { if (pmax >= 1 && state.pending.charCodeAt(pmax - 1) === 32) { state.pending = state.pending.replace(/ +$/, ""); state.push("hardbreak", "br", 0); } else { state.pending = state.pending.slice(0, -1); state.push("softbreak", "br", 0); } } else { state.push("softbreak", "br", 0); } } pos++; // skip heading spaces for next line while (pos < max && isSpace$3(state.src.charCodeAt(pos))) { pos++; } state.pos = pos; return true; }; var isSpace$2 = utils.isSpace; var ESCAPED = []; for (var i = 0; i < 256; i++) { ESCAPED.push(0); } "\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(ch) { ESCAPED[ch.charCodeAt(0)] = 1; })); var _escape = function escape(state, silent) { var ch, pos = state.pos, max = state.posMax; if (state.src.charCodeAt(pos) !== 92 /* \ */) { return false; } pos++; if (pos < max) { ch = state.src.charCodeAt(pos); if (ch < 256 && ESCAPED[ch] !== 0) { if (!silent) { state.pending += state.src[pos]; } state.pos += 2; return true; } if (ch === 10) { if (!silent) { state.push("hardbreak", "br", 0); } pos++; // skip leading whitespaces from next line while (pos < max) { ch = state.src.charCodeAt(pos); if (!isSpace$2(ch)) { break; } pos++; } state.pos = pos; return true; } } if (!silent) { state.pending += "\\"; } state.pos++; return true; }; // Parse backticks var backticks = function backtick(state, silent) { var start, max, marker, token, matchStart, matchEnd, openerLength, closerLength, pos = state.pos, ch = state.src.charCodeAt(pos); if (ch !== 96 /* ` */) { return false; } start = pos; pos++; max = state.posMax; // scan marker length while (pos < max && state.src.charCodeAt(pos) === 96 /* ` */) { pos++; } marker = state.src.slice(start, pos); openerLength = marker.length; if (state.backticksScanned && (state.backticks[openerLength] || 0) <= start) { if (!silent) state.pending += marker; state.pos += openerLength; return true; } matchStart = matchEnd = pos; // Nothing found in the cache, scan until the end of the line (or until marker is found) while ((matchStart = state.src.indexOf("`", matchEnd)) !== -1) { matchEnd = matchStart + 1; // scan marker length while (matchEnd < max && state.src.charCodeAt(matchEnd) === 96 /* ` */) { matchEnd++; } closerLength = matchEnd - matchStart; if (closerLength === openerLength) { // Found matching closer length. if (!silent) { token = state.push("code_inline", "code", 0); token.markup = marker; token.content = state.src.slice(pos, matchStart).replace(/\n/g, " ").replace(/^ (.+) $/, "$1"); } state.pos = matchEnd; return true; } // Some different length found, put it in cache as upper limit of where closer can be found state.backticks[closerLength] = matchStart; } // Scanned through the end, didn't find anything state.backticksScanned = true; if (!silent) state.pending += marker; state.pos += openerLength; return true; }; // ~~strike through~~ // Insert each marker as a separate text token, and add it to delimiter list var tokenize$1 = function strikethrough(state, silent) { var i, scanned, token, len, ch, start = state.pos, marker = state.src.charCodeAt(start); if (silent) { return false; } if (marker !== 126 /* ~ */) { return false; } scanned = state.scanDelims(state.pos, true); len = scanned.length; ch = String.fromCharCode(marker); if (len < 2) { return false; } if (len % 2) { token = state.push("text", "", 0); token.content = ch; len--; } for (i = 0; i < len; i += 2) { token = state.push("text", "", 0); token.content = ch + ch; state.delimiters.push({ marker: marker, length: 0, // disable "rule of 3" length checks meant for emphasis jump: i / 2, // for `~~` 1 marker = 2 characters token: state.tokens.length - 1, end: -1, open: scanned.can_open, close: scanned.can_close }); } state.pos += scanned.length; return true; }; function postProcess$1(state, delimiters) { var i, j, startDelim, endDelim, token, loneMarkers = [], max = delimiters.length; for (i = 0; i < max; i++) { startDelim = delimiters[i]; if (startDelim.marker !== 126 /* ~ */) { continue; } if (startDelim.end === -1) { continue; } endDelim = delimiters[startDelim.end]; token = state.tokens[startDelim.token]; token.type = "s_open"; token.tag = "s"; token.nesting = 1; token.markup = "~~"; token.content = ""; token = state.tokens[endDelim.token]; token.type = "s_close"; token.tag = "s"; token.nesting = -1; token.markup = "~~"; token.content = ""; if (state.tokens[endDelim.token - 1].type === "text" && state.tokens[endDelim.token - 1].content === "~") { loneMarkers.push(endDelim.token - 1); } } // If a marker sequence has an odd number of characters, it's splitted // like this: `~~~~~` -> `~` + `~~` + `~~`, leaving one marker at the // start of the sequence. // So, we have to move all those markers after subsequent s_close tags. while (loneMarkers.length) { i = loneMarkers.pop(); j = i + 1; while (j < state.tokens.length && state.tokens[j].type === "s_close") { j++; } j--; if (i !== j) { token = state.tokens[j]; state.tokens[j] = state.tokens[i]; state.tokens[i] = token; } } } // Walk through delimiter list and replace text tokens with tags var postProcess_1$1 = function strikethrough(state) { var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; postProcess$1(state, state.delimiters); for (curr = 0; curr < max; curr++) { if (tokens_meta[curr] && tokens_meta[curr].delimiters) { postProcess$1(state, tokens_meta[curr].delimiters); } } }; var strikethrough = { tokenize: tokenize$1, postProcess: postProcess_1$1 }; // Process *this* and _that_ // Insert each marker as a separate text token, and add it to delimiter list var tokenize = function emphasis(state, silent) { var i, scanned, token, start = state.pos, marker = state.src.charCodeAt(start); if (silent) { return false; } if (marker !== 95 /* _ */ && marker !== 42 /* * */) { return false; } scanned = state.scanDelims(state.pos, marker === 42); for (i = 0; i < scanned.length; i++) { token = state.push("text", "", 0); token.content = String.fromCharCode(marker); state.delimiters.push({ // Char code of the starting marker (number). marker: marker, // Total length of these series of delimiters. length: scanned.length, // An amount of characters before this one that's equivalent to // current one. In plain English: if this delimiter does not open // an emphasis, neither do previous `jump` characters. // Used to skip sequences like "*****" in one step, for 1st asterisk // value will be 0, for 2nd it's 1 and so on. jump: i, // A position of the token this delimiter corresponds to. token: state.tokens.length - 1, // If this delimiter is matched as a valid opener, `end` will be // equal to its position, otherwise it's `-1`. end: -1, // Boolean flags that determine if this delimiter could open or close // an emphasis. open: scanned.can_open, close: scanned.can_close }); } state.pos += scanned.length; return true; }; function postProcess(state, delimiters) { var i, startDelim, endDelim, token, ch, isStrong, max = delimiters.length; for (i = max - 1; i >= 0; i--) { startDelim = delimiters[i]; if (startDelim.marker !== 95 /* _ */ && startDelim.marker !== 42 /* * */) { continue; } // Process only opening markers if (startDelim.end === -1) { continue; } endDelim = delimiters[startDelim.end]; // If the previous delimiter has the same marker and is adjacent to this one, // merge those into one strong delimiter. // `<em><em>whatever</em></em>` -> `<strong>whatever</strong>` isStrong = i > 0 && delimiters[i - 1].end === startDelim.end + 1 && delimiters[i - 1].token === startDelim.token - 1 && delimiters[startDelim.end + 1].token === endDelim.token + 1 && delimiters[i - 1].marker === startDelim.marker; ch = String.fromCharCode(startDelim.marker); token = state.tokens[startDelim.token]; token.type = isStrong ? "strong_open" : "em_open"; token.tag = isStrong ? "strong" : "em"; token.nesting = 1; token.markup = isStrong ? ch + ch : ch; token.content = ""; token = state.tokens[endDelim.token]; token.type = isStrong ? "strong_close" : "em_close"; token.tag = isStrong ? "strong" : "em"; token.nesting = -1; token.markup = isStrong ? ch + ch : ch; token.content = ""; if (isStrong) { state.tokens[delimiters[i - 1].token].content = ""; state.tokens[delimiters[startDelim.end + 1].token].content = ""; i--; } } } // Walk through delimiter list and replace text tokens with tags var postProcess_1 = function emphasis(state) { var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; postProcess(state, state.delimiters); for (curr = 0; curr < max; curr++) { if (tokens_meta[curr] && tokens_meta[curr].delimiters) { postProcess(state, tokens_meta[curr].delimiters); } } }; var emphasis = { tokenize: tokenize, postProcess: postProcess_1 }; var normalizeReference$1 = utils.normalizeReference; var isSpace$1 = utils.isSpace; var link = function link(state, silent) { var attrs, code, label, labelEnd, labelStart, pos, res, ref, token, href = "", title = "", oldPos = state.pos, max = state.posMax, start = state.pos, parseReference = true; if (state.src.charCodeAt(state.pos) !== 91 /* [ */) { return false; } labelStart = state.pos + 1; labelEnd = state.md.helpers.parseLinkLabel(state, state.pos, true); // parser failed to find ']', so it's not a valid link if (labelEnd < 0) { return false; } pos = labelEnd + 1; if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { // Inline link // might have found a valid shortcut link, disable reference parsing parseReference = false; // [link]( <href> "title" ) // ^^ skipping these spaces pos++; for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace$1(code) && code !== 10) { break; } } if (pos >= max) { return false; } // [link]( <href> "title" ) // ^^^^^^ parsing link destination start = pos; res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); if (res.ok) { href = state.md.normalizeLink(res.str); if (state.md.validateLink(href)) { pos = res.pos; } else { href = ""; } // [link]( <href> "title" ) // ^^ skipping these spaces start = pos; for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace$1(code) && code !== 10) { break; } } // [link]( <href> "title" ) // ^^^^^^^ parsing link title res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); if (pos < max && start !== pos && res.ok) { title = res.str; pos = res.pos; // [link]( <href> "title" ) // ^^ skipping these spaces for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace$1(code) && code !== 10) { break; } } } } if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { // parsing a valid shortcut link failed, fallback to reference parseReference = true; } pos++; } if (parseReference) { // Link reference if (typeof state.env.references === "undefined") { return false; } if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { start = pos + 1; pos = state.md.helpers.parseLinkLabel(state, pos); if (pos >= 0) { label = state.src.slice(start, pos++); } else { pos = labelEnd + 1; } } else { pos = labelEnd + 1; } // covers label === '' and label === undefined // (collapsed reference link and shortcut reference link respectively) if (!label) { label = state.src.slice(labelStart, labelEnd); } ref = state.env.references[normalizeReference$1(label)]; if (!ref) { state.pos = oldPos; return false; } href = ref.href; title = ref.title; } // We found the end of the link, and know for a fact it's a valid link; // so all that's left to do is to call tokenizer. if (!silent) { state.pos = labelStart; state.posMax = labelEnd; token = state.push("link_open", "a", 1); token.attrs = attrs = [ [ "href", href ] ]; if (title) { attrs.push([ "title", title ]); } state.md.inline.tokenize(state); token = state.push("link_close", "a", -1); } state.pos = pos; state.posMax = max; return true; }; var normalizeReference = utils.normalizeReference; var isSpace = utils.isSpace; var image = function image(state, silent) { var attrs, code, content, label, labelEnd, labelStart, pos, ref, res, title, token, tokens, start, href = "", oldPos = state.pos, max = state.posMax; if (state.src.charCodeAt(state.pos) !== 33 /* ! */) { return false; } if (state.src.charCodeAt(state.pos + 1) !== 91 /* [ */) { return false; } labelStart = state.pos + 2; labelEnd = state.md.helpers.parseLinkLabel(state, state.pos + 1, false); // parser failed to find ']', so it's not a valid link if (labelEnd < 0) { return false; } pos = labelEnd + 1; if (pos < max && state.src.charCodeAt(pos) === 40 /* ( */) { // Inline link // [link]( <href> "title" ) // ^^ skipping these spaces pos++; for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace(code) && code !== 10) { break; } } if (pos >= max) { return false; } // [link]( <href> "title" ) // ^^^^^^ parsing link destination start = pos; res = state.md.helpers.parseLinkDestination(state.src, pos, state.posMax); if (res.ok) { href = state.md.normalizeLink(res.str); if (state.md.validateLink(href)) { pos = res.pos; } else { href = ""; } } // [link]( <href> "title" ) // ^^ skipping these spaces start = pos; for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace(code) && code !== 10) { break; } } // [link]( <href> "title" ) // ^^^^^^^ parsing link title res = state.md.helpers.parseLinkTitle(state.src, pos, state.posMax); if (pos < max && start !== pos && res.ok) { title = res.str; pos = res.pos; // [link]( <href> "title" ) // ^^ skipping these spaces for (;pos < max; pos++) { code = state.src.charCodeAt(pos); if (!isSpace(code) && code !== 10) { break; } } } else { title = ""; } if (pos >= max || state.src.charCodeAt(pos) !== 41 /* ) */) { state.pos = oldPos; return false; } pos++; } else { // Link reference if (typeof state.env.references === "undefined") { return false; } if (pos < max && state.src.charCodeAt(pos) === 91 /* [ */) { start = pos + 1; pos = state.md.helpers.parseLinkLabel(state, pos); if (pos >= 0) { label = state.src.slice(start, pos++); } else { pos = labelEnd + 1; } } else { pos = labelEnd + 1; } // covers label === '' and label === undefined // (collapsed reference link and shortcut reference link respectively) if (!label) { label = state.src.slice(labelStart, labelEnd); } ref = state.env.references[normalizeReference(label)]; if (!ref) { state.pos = oldPos; return false; } href = ref.href; title = ref.title; } // We found the end of the link, and know for a fact it's a valid link; // so all that's left to do is to call tokenizer. if (!silent) { content = state.src.slice(labelStart, labelEnd); state.md.inline.parse(content, state.md, state.env, tokens = []); token = state.push("image", "img", 0); token.attrs = attrs = [ [ "src", href ], [ "alt", "" ] ]; token.children = tokens; token.content = content; if (title) { attrs.push([ "title", title ]); } } state.pos = pos; state.posMax = max; return true; }; // Process autolinks '<protocol:...>' /*eslint max-len:0*/ var EMAIL_RE = /^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/; var AUTOLINK_RE = /^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/; var autolink = function autolink(state, silent) { var url, fullUrl, token, ch, start, max, pos = state.pos; if (state.src.charCodeAt(pos) !== 60 /* < */) { return false; } start = state.pos; max = state.posMax; for (;;) { if (++pos >= max) return false; ch = state.src.charCodeAt(pos); if (ch === 60 /* < */) return false; if (ch === 62 /* > */) break; } url = state.src.slice(start + 1, pos); if (AUTOLINK_RE.test(url)) { fullUrl = state.md.normalizeLink(url); if (!state.md.validateLink(fullUrl)) { return false; } if (!silent) { token = state.push("link_open", "a", 1); token.attrs = [ [ "href", fullUrl ] ]; token.markup = "autolink"; token.info = "auto"; token = state.push("text", "", 0); token.content = state.md.normalizeLinkText(url); token = state.push("link_close", "a", -1); token.markup = "autolink"; token.info = "auto"; } state.pos += url.length + 2; return true; } if (EMAIL_RE.test(url)) { fullUrl = state.md.normalizeLink("mailto:" + url); if (!state.md.validateLink(fullUrl)) { return false; } if (!silent) { token = state.push("link_open", "a", 1); token.attrs = [ [ "href", fullUrl ] ]; token.markup = "autolink"; token.info = "auto"; token = state.push("text", "", 0); token.content = state.md.normalizeLinkText(url); token = state.push("link_close", "a", -1); token.markup = "autolink"; token.info = "auto"; } state.pos += url.length + 2; return true; } return false; }; var HTML_TAG_RE = html_re.HTML_TAG_RE; function isLetter(ch) { /*eslint no-bitwise:0*/ var lc = ch | 32; // to lower case return lc >= 97 /* a */ && lc <= 122 /* z */; } var html_inline = function html_inline(state, silent) { var ch, match, max, token, pos = state.pos; if (!state.md.options.html) { return false; } // Check start max = state.posMax; if (state.src.charCodeAt(pos) !== 60 /* < */ || pos + 2 >= max) { return false; } // Quick fail on second char ch = state.src.charCodeAt(pos + 1); if (ch !== 33 /* ! */ && ch !== 63 /* ? */ && ch !== 47 /* / */ && !isLetter(ch)) { return false; } match = state.src.slice(pos).match(HTML_TAG_RE); if (!match) { return false; } if (!silent) { token = state.push("html_inline", "", 0); token.content = state.src.slice(pos, pos + match[0].length); } state.pos += match[0].length; return true; }; var has = utils.has; var isValidEntityCode = utils.isValidEntityCode; var fromCodePoint = utils.fromCodePoint; var DIGITAL_RE = /^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i; var NAMED_RE = /^&([a-z][a-z0-9]{1,31});/i; var entity = function entity(state, silent) { var ch, code, match, pos = state.pos, max = state.posMax; if (state.src.charCodeAt(pos) !== 38 /* & */) { return false; } if (pos + 1 < max) { ch = state.src.charCodeAt(pos + 1); if (ch === 35 /* # */) { match = state.src.slice(pos).match(DIGITAL_RE); if (match) { if (!silent) { code = match[1][0].toLowerCase() === "x" ? parseInt(match[1].slice(1), 16) : parseInt(match[1], 10); state.pending += isValidEntityCode(code) ? fromCodePoint(code) : fromCodePoint(65533); } state.pos += match[0].length; return true; } } else { match = state.src.slice(pos).match(NAMED_RE); if (match) { if (has(entities, match[1])) { if (!silent) { state.pending += entities[match[1]]; } state.pos += match[0].length; return true; } } } } if (!silent) { state.pending += "&"; } state.pos++; return true; }; // For each opening emphasis-like marker find a matching closing one function processDelimiters(state, delimiters) { var closerIdx, openerIdx, closer, opener, minOpenerIdx, newMinOpenerIdx, isOddMatch, lastJump, openersBottom = {}, max = delimiters.length; for (closerIdx = 0; closerIdx < max; closerIdx++) { closer = delimiters[closerIdx]; // Length is only used for emphasis-specific "rule of 3", // if it's not defined (in strikethrough or 3rd party plugins), // we can default it to 0 to disable those checks. closer.length = closer.length || 0; if (!closer.close) continue; // Previously calculated lower bounds (previous fails) // for each marker, each delimiter length modulo 3, // and for whether this closer can be an opener; // https://github.com/commonmark/cmark/commit/34250e12ccebdc6372b8b49c44fab57c72443460 if (!openersBottom.hasOwnProperty(closer.marker)) { openersBottom[closer.marker] = [ -1, -1, -1, -1, -1, -1 ]; } minOpenerIdx = openersBottom[closer.marker][(closer.open ? 3 : 0) + closer.length % 3]; openerIdx = closerIdx - closer.jump - 1; // avoid crash if `closer.jump` is pointing outside of the array, see #742 if (openerIdx < -1) openerIdx = -1; newMinOpenerIdx = openerIdx; for (;openerIdx > minOpenerIdx; openerIdx -= opener.jump + 1) { opener = delimiters[openerIdx]; if (opener.marker !== closer.marker) continue; if (opener.open && opener.end < 0) { isOddMatch = false; // from spec: // If one of the delimiters can both open and close emphasis, then the // sum of the lengths of the delimiter runs containing the opening and // closing delimiters must not be a multiple of 3 unless both lengths // are multiples of 3. if (opener.close || closer.open) { if ((opener.length + closer.length) % 3 === 0) { if (opener.length % 3 !== 0 || closer.length % 3 !== 0) { isOddMatch = true; } } } if (!isOddMatch) { // If previous delimiter cannot be an opener, we can safely skip // the entire sequence in future checks. This is required to make // sure algorithm has linear complexity (see *_*_*_*_*_... case). lastJump = openerIdx > 0 && !delimiters[openerIdx - 1].open ? delimiters[openerIdx - 1].jump + 1 : 0; closer.jump = closerIdx - openerIdx + lastJump; closer.open = false; opener.end = closerIdx; opener.jump = lastJump; opener.close = false; newMinOpenerIdx = -1; break; } } } if (newMinOpenerIdx !== -1) { // If match for this delimiter run failed, we want to set lower bound for // future lookups. This is required to make sure algorithm has linear // complexity. // See details here: // https://github.com/commonmark/cmark/issues/178#issuecomment-270417442 openersBottom[closer.marker][(closer.open ? 3 : 0) + (closer.length || 0) % 3] = newMinOpenerIdx; } } } var balance_pairs = function link_pairs(state) { var curr, tokens_meta = state.tokens_meta, max = state.tokens_meta.length; processDelimiters(state, state.delimiters); for (curr = 0; curr < max; curr++) { if (tokens_meta[curr] && tokens_meta[curr].delimiters) { processDelimiters(state, tokens_meta[curr].delimiters); } } }; // Clean up tokens after emphasis and strikethrough postprocessing: var text_collapse = function text_collapse(state) { var curr, last, level = 0, tokens = state.tokens, max = state.tokens.length; for (curr = last = 0; curr < max; curr++) { // re-calculate levels after emphasis/strikethrough turns some text nodes // into opening/closing tags if (tokens[curr].nesting < 0) level--; // closing tag tokens[curr].level = level; if (tokens[curr].nesting > 0) level++; // opening tag if (tokens[curr].type === "text" && curr + 1 < max && tokens[curr + 1].type === "text") { // collapse two adjacent text nodes tokens[curr + 1].content = tokens[curr].content + tokens[curr + 1].content; } else { if (curr !== last) { tokens[last] = tokens[curr]; } last++; } } if (curr !== last) { tokens.length = last; } }; var isWhiteSpace = utils.isWhiteSpace; var isPunctChar = utils.isPunctChar; var isMdAsciiPunct = utils.isMdAsciiPunct; function StateInline(src, md, env, outTokens) { this.src = src; this.env = env; this.md = md; this.tokens = outTokens; this.tokens_meta = Array(outTokens.length); this.pos = 0; this.posMax = this.src.length; this.level = 0; this.pending = ""; this.pendingLevel = 0; // Stores { start: end } pairs. Useful for backtrack // optimization of pairs parse (emphasis, strikes). this.cache = {}; // List of emphasis-like delimiters for current tag this.delimiters = []; // Stack of delimiter lists for upper level tags this._prev_delimiters = []; // backtick length => last seen position this.backticks = {}; this.backticksScanned = false; } // Flush pending text StateInline.prototype.pushPending = function() { var token$1 = new token("text", "", 0); token$1.content = this.pending; token$1.level = this.pendingLevel; this.tokens.push(token$1); this.pending = ""; return token$1; }; // Push new token to "stream". // If pending text exists - flush it as text token StateInline.prototype.push = function(type, tag, nesting) { if (this.pending) { this.pushPending(); } var token$1 = new token(type, tag, nesting); var token_meta = null; if (nesting < 0) { // closing tag this.level--; this.delimiters = this._prev_delimiters.pop(); } token$1.level = this.level; if (nesting > 0) { // opening tag this.level++; this._prev_delimiters.push(this.delimiters); this.delimiters = []; token_meta = { delimiters: this.delimiters }; } this.pendingLevel = this.level; this.tokens.push(token$1); this.tokens_meta.push(token_meta); return token$1; }; // Scan a sequence of emphasis-like markers, and determine whether // it can start an emphasis sequence or end an emphasis sequence. // - start - position to scan from (it should point at a valid marker); // - canSplitWord - determine if these markers can be found inside a word StateInline.prototype.scanDelims = function(start, canSplitWord) { var pos = start, lastChar, nextChar, count, can_open, can_close, isLastWhiteSpace, isLastPunctChar, isNextWhiteSpace, isNextPunctChar, left_flanking = true, right_flanking = true, max = this.posMax, marker = this.src.charCodeAt(start); // treat beginning of the line as a whitespace lastChar = start > 0 ? this.src.charCodeAt(start - 1) : 32; while (pos < max && this.src.charCodeAt(pos) === marker) { pos++; } count = pos - start; // treat end of the line as a whitespace nextChar = pos < max ? this.src.charCodeAt(pos) : 32; isLastPunctChar = isMdAsciiPunct(lastChar) || isPunctChar(String.fromCharCode(lastChar)); isNextPunctChar = isMdAsciiPunct(nextChar) || isPunctChar(String.fromCharCode(nextChar)); isLastWhiteSpace = isWhiteSpace(lastChar); isNextWhiteSpace = isWhiteSpace(nextChar); if (isNextWhiteSpace) { left_flanking = false; } else if (isNextPunctChar) { if (!(isLastWhiteSpace || isLastPunctChar)) { left_flanking = false; } } if (isLastWhiteSpace) { right_flanking = false; } else if (isLastPunctChar) { if (!(isNextWhiteSpace || isNextPunctChar)) { right_flanking = false; } } if (!canSplitWord) { can_open = left_flanking && (!right_flanking || isLastPunctChar); can_close = right_flanking && (!left_flanking || isNextPunctChar); } else { can_open = left_flanking; can_close = right_flanking; } return { can_open: can_open, can_close: can_close, length: count }; }; // re-export Token class to use in block rules StateInline.prototype.Token = token; var state_inline = StateInline; //////////////////////////////////////////////////////////////////////////////// // Parser rules var _rules = [ [ "text", text ], [ "newline", newline ], [ "escape", _escape ], [ "backticks", backticks ], [ "strikethrough", strikethrough.tokenize ], [ "emphasis", emphasis.tokenize ], [ "link", link ], [ "image", image ], [ "autolink", autolink ], [ "html_inline", html_inline ], [ "entity", entity ] ]; var _rules2 = [ [ "balance_pairs", balance_pairs ], [ "strikethrough", strikethrough.postProcess ], [ "emphasis", emphasis.postProcess ], [ "text_collapse", text_collapse ] ]; /** * new ParserInline() **/ function ParserInline() { var i; /** * ParserInline#ruler -> Ruler * * [[Ruler]] instance. Keep configuration of inline rules. **/ this.ruler = new ruler; for (i = 0; i < _rules.length; i++) { this.ruler.push(_rules[i][0], _rules[i][1]); } /** * ParserInline#ruler2 -> Ruler * * [[Ruler]] instance. Second ruler used for post-processing * (e.g. in emphasis-like rules). **/ this.ruler2 = new ruler; for (i = 0; i < _rules2.length; i++) { this.ruler2.push(_rules2[i][0], _rules2[i][1]); } } // Skip single token by running all rules in validation mode; // returns `true` if any rule reported success ParserInline.prototype.skipToken = function(state) { var ok, i, pos = state.pos, rules = this.ruler.getRules(""), len = rules.length, maxNesting = state.md.options.maxNesting, cache = state.cache; if (typeof cache[pos] !== "undefined") { state.pos = cache[pos]; return; } if (state.level < maxNesting) { for (i = 0; i < len; i++) { // Increment state.level and decrement it later to limit recursion. // It's harmless to do here, because no tokens are created. But ideally, // we'd need a separate private state variable for this purpose. state.level++; ok = rules[i](state, true); state.level--; if (ok) { break; } } } else { // Too much nesting, just skip until the end of the paragraph. // NOTE: this will cause links to behave incorrectly in the following case, // when an amount of `[` is exactly equal to `maxNesting + 1`: // [[[[[[[[[[[[[[[[[[[[[foo]() // TODO: remove this workaround when CM standard will allow nested links // (we can replace it by preventing links from being parsed in // validation mode) state.pos = state.posMax; } if (!ok) { state.pos++; } cache[pos] = state.pos; }; // Generate tokens for input range ParserInline.prototype.tokenize = function(state) { var ok, i, rules = this.ruler.getRules(""), len = rules.length, end = state.posMax, maxNesting = state.md.options.maxNesting; while (state.pos < end) { // Try all possible rules. // On success, rule should: // - update `state.pos` // - update `state.tokens` // - return true if (state.level < maxNesting) { for (i = 0; i < len; i++) { ok = rules[i](state, false); if (ok) { break; } } } if (ok) { if (state.pos >= end) { break; } continue; } state.pending += state.src[state.pos++]; } if (state.pending) { state.pushPending(); } }; /** * ParserInline.parse(str, md, env, outTokens) * * Process input string and push inline tokens into `outTokens` **/ ParserInline.prototype.parse = function(str, md, env, outTokens) { var i, rules, len; var state = new this.State(str, md, env, outTokens); this.tokenize(state); rules = this.ruler2.getRules(""); len = rules.length; for (i = 0; i < len; i++) { rules[i](state); } }; ParserInline.prototype.State = state_inline; var parser_inline = ParserInline; var re = function(opts) { var re = {}; // Use direct extract instead of `regenerate` to reduse browserified size re.src_Any = regex$3.source; re.src_Cc = regex$2.source; re.src_Z = regex.source; re.src_P = regex$4.source; // \p{\Z\P\Cc\CF} (white spaces + control + format + punctuation) re.src_ZPCc = [ re.src_Z, re.src_P, re.src_Cc ].join("|"); // \p{\Z\Cc} (white spaces + control) re.src_ZCc = [ re.src_Z, re.src_Cc ].join("|"); // Experimental. List of chars, completely prohibited in links // because can separate it from other part of text var text_separators = "[><\uff5c]"; // All possible word characters (everything without punctuation, spaces & controls) // Defined via punctuation & spaces to save space // Should be something like \p{\L\N\S\M} (\w but without `_`) re.src_pseudo_letter = "(?:(?!" + text_separators + "|" + re.src_ZPCc + ")" + re.src_Any + ")"; // The same as abothe but without [0-9] // var src_pseudo_letter_non_d = '(?:(?![0-9]|' + src_ZPCc + ')' + src_Any + ')'; //////////////////////////////////////////////////////////////////////////////// re.src_ip4 = "(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)"; // Prohibit any of "@/[]()" in user/pass to avoid wrong domain fetch. re.src_auth = "(?:(?:(?!" + re.src_ZCc + "|[@/\\[\\]()]).)+@)?"; re.src_port = "(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?"; re.src_host_terminator = "(?=$|" + text_separators + "|" + re.src_ZPCc + ")(?!-|_|:\\d|\\.-|\\.(?!$|" + re.src_ZPCc + "))"; re.src_path = "(?:" + "[/?#]" + "(?:" + "(?!" + re.src_ZCc + "|" + text_separators + "|[()[\\]{}.,\"'?!\\-]).|" + "\\[(?:(?!" + re.src_ZCc + "|\\]).)*\\]|" + "\\((?:(?!" + re.src_ZCc + "|[)]).)*\\)|" + "\\{(?:(?!" + re.src_ZCc + "|[}]).)*\\}|" + '\\"(?:(?!' + re.src_ZCc + '|["]).)+\\"|' + "\\'(?:(?!" + re.src_ZCc + "|[']).)+\\'|" + "\\'(?=" + re.src_pseudo_letter + "|[-]).|" + // allow `I'm_king` if no pair found "\\.{2,}[a-zA-Z0-9%/&]|" + // google has many dots in "google search" links (#66, #81). // github has ... in commit range links, // Restrict to // - english // - percent-encoded // - parts of file path // - params separator // until more examples found. "\\.(?!" + re.src_ZCc + "|[.]).|" + (opts && opts["---"] ? "\\-(?!--(?:[^-]|$))(?:-*)|" : "\\-+|") + "\\,(?!" + re.src_ZCc + ").|" + // allow `,,,` in paths "\\!+(?!" + re.src_ZCc + "|[!]).|" + // allow `!!!` in paths, but not at the end "\\?(?!" + re.src_ZCc + "|[?])." + ")+" + "|\\/" + ")?"; // Allow anything in markdown spec, forbid quote (") at the first position // because emails enclosed in quotes are far more common re.src_email_name = '[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*'; re.src_xn = "xn--[a-z0-9\\-]{1,59}"; // More to read about domain names // http://serverfault.com/questions/638260/ re.src_domain_root = // Allow letters & digits (http://test1) "(?:" + re.src_xn + "|" + re.src_pseudo_letter + "{1,63}" + ")"; re.src_domain = "(?:" + re.src_xn + "|" + "(?:" + re.src_pseudo_letter + ")" + "|" + "(?:" + re.src_pseudo_letter + "(?:-|" + re.src_pseudo_letter + "){0,61}" + re.src_pseudo_letter + ")" + ")"; re.src_host = "(?:" + // Don't need IP check, because digits are already allowed in normal domain names // src_ip4 + // '|' + "(?:(?:(?:" + re.src_domain + ")\\.)*" + re.src_domain /*_root*/ + ")" + ")"; re.tpl_host_fuzzy = "(?:" + re.src_ip4 + "|" + "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))" + ")"; re.tpl_host_no_ip_fuzzy = "(?:(?:(?:" + re.src_domain + ")\\.)+(?:%TLDS%))"; re.src_host_strict = re.src_host + re.src_host_terminator; re.tpl_host_fuzzy_strict = re.tpl_host_fuzzy + re.src_host_terminator; re.src_host_port_strict = re.src_host + re.src_port + re.src_host_terminator; re.tpl_host_port_fuzzy_strict = re.tpl_host_fuzzy + re.src_port + re.src_host_terminator; re.tpl_host_port_no_ip_fuzzy_strict = re.tpl_host_no_ip_fuzzy + re.src_port + re.src_host_terminator; //////////////////////////////////////////////////////////////////////////////// // Main rules // Rude test fuzzy links by host, for quick deny re.tpl_host_fuzzy_test = "localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:" + re.src_ZPCc + "|>|$))"; re.tpl_email_fuzzy = "(^|" + text_separators + '|"|\\(|' + re.src_ZCc + ")" + "(" + re.src_email_name + "@" + re.tpl_host_fuzzy_strict + ")"; re.tpl_link_fuzzy = // Fuzzy link can't be prepended with .:/\- and non punctuation. // but can start with > (markdown blockquote) "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_fuzzy_strict + re.src_path + ")"; re.tpl_link_no_ip_fuzzy = // Fuzzy link can't be prepended with .:/\- and non punctuation. // but can start with > (markdown blockquote) "(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|" + re.src_ZPCc + "))" + "((?![$+<=>^`|\uff5c])" + re.tpl_host_port_no_ip_fuzzy_strict + re.src_path + ")"; return re; }; //////////////////////////////////////////////////////////////////////////////// // Helpers // Merge objects function assign(obj /*from1, from2, from3, ...*/) { var sources = Array.prototype.slice.call(arguments, 1); sources.forEach((function(source) { if (!source) { return; } Object.keys(source).forEach((function(key) { obj[key] = source[key]; })); })); return obj; } function _class(obj) { return Object.prototype.toString.call(obj); } function isString(obj) { return _class(obj) === "[object String]"; } function isObject(obj) { return _class(obj) === "[object Object]"; } function isRegExp(obj) { return _class(obj) === "[object RegExp]"; } function isFunction(obj) { return _class(obj) === "[object Function]"; } function escapeRE(str) { return str.replace(/[.?*+^$[\]\\(){}|-]/g, "\\$&"); } //////////////////////////////////////////////////////////////////////////////// var defaultOptions = { fuzzyLink: true, fuzzyEmail: true, fuzzyIP: false }; function isOptionsObj(obj) { return Object.keys(obj || {}).reduce((function(acc, k) { return acc || defaultOptions.hasOwnProperty(k); }), false); } var defaultSchemas = { "http:": { validate: function(text, pos, self) { var tail = text.slice(pos); if (!self.re.http) { // compile lazily, because "host"-containing variables can change on tlds update. self.re.http = new RegExp("^\\/\\/" + self.re.src_auth + self.re.src_host_port_strict + self.re.src_path, "i"); } if (self.re.http.test(tail)) { return tail.match(self.re.http)[0].length; } return 0; } }, "https:": "http:", "ftp:": "http:", "//": { validate: function(text, pos, self) { var tail = text.slice(pos); if (!self.re.no_http) { // compile lazily, because "host"-containing variables can change on tlds update. self.re.no_http = new RegExp("^" + self.re.src_auth + // Don't allow single-level domains, because of false positives like '//test' // with code comments "(?:localhost|(?:(?:" + self.re.src_domain + ")\\.)+" + self.re.src_domain_root + ")" + self.re.src_port + self.re.src_host_terminator + self.re.src_path, "i"); } if (self.re.no_http.test(tail)) { // should not be `://` & `///`, that protects from errors in protocol name if (pos >= 3 && text[pos - 3] === ":") { return 0; } if (pos >= 3 && text[pos - 3] === "/") { return 0; } return tail.match(self.re.no_http)[0].length; } return 0; } }, "mailto:": { validate: function(text, pos, self) { var tail = text.slice(pos); if (!self.re.mailto) { self.re.mailto = new RegExp("^" + self.re.src_email_name + "@" + self.re.src_host_strict, "i"); } if (self.re.mailto.test(tail)) { return tail.match(self.re.mailto)[0].length; } return 0; } } }; /*eslint-disable max-len*/ // RE pattern for 2-character tlds (autogenerated by ./support/tlds_2char_gen.js) var tlds_2ch_src_re = "a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"; // DON'T try to make PRs with changes. Extend TLDs with LinkifyIt.tlds() instead var tlds_default = "biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|"); /*eslint-enable max-len*/ //////////////////////////////////////////////////////////////////////////////// function resetScanCache(self) { self.__index__ = -1; self.__text_cache__ = ""; } function createValidator(re) { return function(text, pos) { var tail = text.slice(pos); if (re.test(tail)) { return tail.match(re)[0].length; } return 0; }; } function createNormalizer() { return function(match, self) { self.normalize(match); }; } // Schemas compiler. Build regexps. function compile(self) { // Load & clone RE patterns. var re$1 = self.re = re(self.__opts__); // Define dynamic patterns var tlds = self.__tlds__.slice(); self.onCompile(); if (!self.__tlds_replaced__) { tlds.push(tlds_2ch_src_re); } tlds.push(re$1.src_xn); re$1.src_tlds = tlds.join("|"); function untpl(tpl) { return tpl.replace("%TLDS%", re$1.src_tlds); } re$1.email_fuzzy = RegExp(untpl(re$1.tpl_email_fuzzy), "i"); re$1.link_fuzzy = RegExp(untpl(re$1.tpl_link_fuzzy), "i"); re$1.link_no_ip_fuzzy = RegExp(untpl(re$1.tpl_link_no_ip_fuzzy), "i"); re$1.host_fuzzy_test = RegExp(untpl(re$1.tpl_host_fuzzy_test), "i"); // Compile each schema var aliases = []; self.__compiled__ = {}; // Reset compiled data function schemaError(name, val) { throw new Error('(LinkifyIt) Invalid schema "' + name + '": ' + val); } Object.keys(self.__schemas__).forEach((function(name) { var val = self.__schemas__[name]; // skip disabled methods if (val === null) { return; } var compiled = { validate: null, link: null }; self.__compiled__[name] = compiled; if (isObject(val)) { if (isRegExp(val.validate)) { compiled.validate = createValidator(val.validate); } else if (isFunction(val.validate)) { compiled.validate = val.validate; } else { schemaError(name, val); } if (isFunction(val.normalize)) { compiled.normalize = val.normalize; } else if (!val.normalize) { compiled.normalize = createNormalizer(); } else { schemaError(name, val); } return; } if (isString(val)) { aliases.push(name); return; } schemaError(name, val); })); // Compile postponed aliases aliases.forEach((function(alias) { if (!self.__compiled__[self.__schemas__[alias]]) { // Silently fail on missed schemas to avoid errons on disable. // schemaError(alias, self.__schemas__[alias]); return; } self.__compiled__[alias].validate = self.__compiled__[self.__schemas__[alias]].validate; self.__compiled__[alias].normalize = self.__compiled__[self.__schemas__[alias]].normalize; })); // Fake record for guessed links self.__compiled__[""] = { validate: null, normalize: createNormalizer() }; // Build schema condition var slist = Object.keys(self.__compiled__).filter((function(name) { // Filter disabled & fake schemas return name.length > 0 && self.__compiled__[name]; })).map(escapeRE).join("|"); // (?!_) cause 1.5x slowdown self.re.schema_test = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "i"); self.re.schema_search = RegExp("(^|(?!_)(?:[><\uff5c]|" + re$1.src_ZPCc + "))(" + slist + ")", "ig"); self.re.pretest = RegExp("(" + self.re.schema_test.source + ")|(" + self.re.host_fuzzy_test.source + ")|@", "i"); // Cleanup resetScanCache(self); } /** * class Match * * Match result. Single element of array, returned by [[LinkifyIt#match]] **/ function Match(self, shift) { var start = self.__index__, end = self.__last_index__, text = self.__text_cache__.slice(start, end); /** * Match#schema -> String * * Prefix (protocol) for matched string. **/ this.schema = self.__schema__.toLowerCase(); /** * Match#index -> Number * * First position of matched string. **/ this.index = start + shift; /** * Match#lastIndex -> Number * * Next position after matched string. **/ this.lastIndex = end + shift; /** * Match#raw -> String * * Matched string. **/ this.raw = text; /** * Match#text -> String * * Notmalized text of matched string. **/ this.text = text; /** * Match#url -> String * * Normalized url of matched string. **/ this.url = text; } function createMatch(self, shift) { var match = new Match(self, shift); self.__compiled__[match.schema].normalize(match, self); return match; } /** * class LinkifyIt **/ /** * new LinkifyIt(schemas, options) * - schemas (Object): Optional. Additional schemas to validate (prefix/validator) * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } * * Creates new linkifier instance with optional additional schemas. * Can be called without `new` keyword for convenience. * * By default understands: * * - `http(s)://...` , `ftp://...`, `mailto:...` & `//...` links * - "fuzzy" links and emails (example.com, foo@bar.com). * * `schemas` is an object, where each key/value describes protocol/rule: * * - __key__ - link prefix (usually, protocol name with `:` at the end, `skype:` * for example). `linkify-it` makes shure that prefix is not preceeded with * alphanumeric char and symbols. Only whitespaces and punctuation allowed. * - __value__ - rule to check tail after link prefix * - _String_ - just alias to existing rule * - _Object_ * - _validate_ - validator function (should return matched length on success), * or `RegExp`. * - _normalize_ - optional function to normalize text & url of matched result * (for example, for @twitter mentions). * * `options`: * * - __fuzzyLink__ - recognige URL-s without `http(s):` prefix. Default `true`. * - __fuzzyIP__ - allow IPs in fuzzy links above. Can conflict with some texts * like version numbers. Default `false`. * - __fuzzyEmail__ - recognize emails without `mailto:` prefix. * **/ function LinkifyIt(schemas, options) { if (!(this instanceof LinkifyIt)) { return new LinkifyIt(schemas, options); } if (!options) { if (isOptionsObj(schemas)) { options = schemas; schemas = {}; } } this.__opts__ = assign({}, defaultOptions, options); // Cache last tested result. Used to skip repeating steps on next `match` call. this.__index__ = -1; this.__last_index__ = -1; // Next scan position this.__schema__ = ""; this.__text_cache__ = ""; this.__schemas__ = assign({}, defaultSchemas, schemas); this.__compiled__ = {}; this.__tlds__ = tlds_default; this.__tlds_replaced__ = false; this.re = {}; compile(this); } /** chainable * LinkifyIt#add(schema, definition) * - schema (String): rule name (fixed pattern prefix) * - definition (String|RegExp|Object): schema definition * * Add new rule definition. See constructor description for details. **/ LinkifyIt.prototype.add = function add(schema, definition) { this.__schemas__[schema] = definition; compile(this); return this; }; /** chainable * LinkifyIt#set(options) * - options (Object): { fuzzyLink|fuzzyEmail|fuzzyIP: true|false } * * Set recognition options for links without schema. **/ LinkifyIt.prototype.set = function set(options) { this.__opts__ = assign(this.__opts__, options); return this; }; /** * LinkifyIt#test(text) -> Boolean * * Searches linkifiable pattern and returns `true` on success or `false` on fail. **/ LinkifyIt.prototype.test = function test(text) { // Reset scan cache this.__text_cache__ = text; this.__index__ = -1; if (!text.length) { return false; } var m, ml, me, len, shift, next, re, tld_pos, at_pos; // try to scan for link with schema - that's the most simple rule if (this.re.schema_test.test(text)) { re = this.re.schema_search; re.lastIndex = 0; while ((m = re.exec(text)) !== null) { len = this.testSchemaAt(text, m[2], re.lastIndex); if (len) { this.__schema__ = m[2]; this.__index__ = m.index + m[1].length; this.__last_index__ = m.index + m[0].length + len; break; } } } if (this.__opts__.fuzzyLink && this.__compiled__["http:"]) { // guess schemaless links tld_pos = text.search(this.re.host_fuzzy_test); if (tld_pos >= 0) { // if tld is located after found link - no need to check fuzzy pattern if (this.__index__ < 0 || tld_pos < this.__index__) { if ((ml = text.match(this.__opts__.fuzzyIP ? this.re.link_fuzzy : this.re.link_no_ip_fuzzy)) !== null) { shift = ml.index + ml[1].length; if (this.__index__ < 0 || shift < this.__index__) { this.__schema__ = ""; this.__index__ = shift; this.__last_index__ = ml.index + ml[0].length; } } } } } if (this.__opts__.fuzzyEmail && this.__compiled__["mailto:"]) { // guess schemaless emails at_pos = text.indexOf("@"); if (at_pos >= 0) { // We can't skip this check, because this cases are possible: // 192.168.1.1@gmail.com, my.in@example.com if ((me = text.match(this.re.email_fuzzy)) !== null) { shift = me.index + me[1].length; next = me.index + me[0].length; if (this.__index__ < 0 || shift < this.__index__ || shift === this.__index__ && next > this.__last_index__) { this.__schema__ = "mailto:"; this.__index__ = shift; this.__last_index__ = next; } } } } return this.__index__ >= 0; }; /** * LinkifyIt#pretest(text) -> Boolean * * Very quick check, that can give false positives. Returns true if link MAY BE * can exists. Can be used for speed optimization, when you need to check that * link NOT exists. **/ LinkifyIt.prototype.pretest = function pretest(text) { return this.re.pretest.test(text); }; /** * LinkifyIt#testSchemaAt(text, name, position) -> Number * - text (String): text to scan * - name (String): rule (schema) name * - position (Number): text offset to check from * * Similar to [[LinkifyIt#test]] but checks only specific protocol tail exactly * at given position. Returns length of found pattern (0 on fail). **/ LinkifyIt.prototype.testSchemaAt = function testSchemaAt(text, schema, pos) { // If not supported schema check requested - terminate if (!this.__compiled__[schema.toLowerCase()]) { return 0; } return this.__compiled__[schema.toLowerCase()].validate(text, pos, this); }; /** * LinkifyIt#match(text) -> Array|null * * Returns array of found link descriptions or `null` on fail. We strongly * recommend to use [[LinkifyIt#test]] first, for best speed. * * ##### Result match description * * - __schema__ - link schema, can be empty for fuzzy links, or `//` for * protocol-neutral links. * - __index__ - offset of matched text * - __lastIndex__ - index of next char after mathch end * - __raw__ - matched text * - __text__ - normalized text * - __url__ - link, generated from matched text **/ LinkifyIt.prototype.match = function match(text) { var shift = 0, result = []; // Try to take previous element from cache, if .test() called before if (this.__index__ >= 0 && this.__text_cache__ === text) { result.push(createMatch(this, shift)); shift = this.__last_index__; } // Cut head if cache was used var tail = shift ? text.slice(shift) : text; // Scan string until end reached while (this.test(tail)) { result.push(createMatch(this, shift)); tail = tail.slice(this.__last_index__); shift += this.__last_index__; } if (result.length) { return result; } return null; }; /** chainable * LinkifyIt#tlds(list [, keepOld]) -> this * - list (Array): list of tlds * - keepOld (Boolean): merge with current list if `true` (`false` by default) * * Load (or merge) new tlds list. Those are user for fuzzy links (without prefix) * to avoid false positives. By default this algorythm used: * * - hostname with any 2-letter root zones are ok. * - biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|рф * are ok. * - encoded (`xn--...`) root zones are ok. * * If list is replaced, then exact match for 2-chars root zones will be checked. **/ LinkifyIt.prototype.tlds = function tlds(list, keepOld) { list = Array.isArray(list) ? list : [ list ]; if (!keepOld) { this.__tlds__ = list.slice(); this.__tlds_replaced__ = true; compile(this); return this; } this.__tlds__ = this.__tlds__.concat(list).sort().filter((function(el, idx, arr) { return el !== arr[idx - 1]; })).reverse(); compile(this); return this; }; /** * LinkifyIt#normalize(match) * * Default normalizer (if schema does not define it's own). **/ LinkifyIt.prototype.normalize = function normalize(match) { // Do minimal possible changes by default. Need to collect feedback prior // to move forward https://github.com/markdown-it/linkify-it/issues/1 if (!match.schema) { match.url = "http://" + match.url; } if (match.schema === "mailto:" && !/^mailto:/i.test(match.url)) { match.url = "mailto:" + match.url; } }; /** * LinkifyIt#onCompile() * * Override to modify basic RegExp-s. **/ LinkifyIt.prototype.onCompile = function onCompile() {}; var linkifyIt = LinkifyIt; /*! https://mths.be/punycode v1.4.1 by @mathias */ /** Highest positive signed 32-bit float value */ var maxInt = 2147483647; // aka. 0x7FFFFFFF or 2^31-1 /** Bootstring parameters */ var base = 36; var tMin = 1; var tMax = 26; var skew = 38; var damp = 700; var initialBias = 72; var initialN = 128; // 0x80 var delimiter = "-"; // '\x2D' /** Regular expressions */ var regexPunycode = /^xn--/; var regexNonASCII = /[^\x20-\x7E]/; // unprintable ASCII chars + non-ASCII chars var regexSeparators = /[\x2E\u3002\uFF0E\uFF61]/g; // RFC 3490 separators /** Error messages */ var errors = { overflow: "Overflow: input needs wider integers to process", "not-basic": "Illegal input >= 0x80 (not a basic code point)", "invalid-input": "Invalid input" }; /** Convenience shortcuts */ var baseMinusTMin = base - tMin; var floor = Math.floor; var stringFromCharCode = String.fromCharCode; /*--------------------------------------------------------------------------*/ /** * A generic error utility function. * @private * @param {String} type The error type. * @returns {Error} Throws a `RangeError` with the applicable error message. */ function error(type) { throw new RangeError(errors[type]); } /** * A generic `Array#map` utility function. * @private * @param {Array} array The array to iterate over. * @param {Function} callback The function that gets called for every array * item. * @returns {Array} A new array of values returned by the callback function. */ function map(array, fn) { var length = array.length; var result = []; while (length--) { result[length] = fn(array[length]); } return result; } /** * A simple `Array#map`-like wrapper to work with domain name strings or email * addresses. * @private * @param {String} domain The domain name or email address. * @param {Function} callback The function that gets called for every * character. * @returns {Array} A new string of characters returned by the callback * function. */ function mapDomain(string, fn) { var parts = string.split("@"); var result = ""; if (parts.length > 1) { // In email addresses, only the domain name should be punycoded. Leave // the local part (i.e. everything up to `@`) intact. result = parts[0] + "@"; string = parts[1]; } // Avoid `split(regex)` for IE8 compatibility. See #17. string = string.replace(regexSeparators, "."); var labels = string.split("."); var encoded = map(labels, fn).join("."); return result + encoded; } /** * Creates an array containing the numeric code points of each Unicode * character in the string. While JavaScript uses UCS-2 internally, * this function will convert a pair of surrogate halves (each of which * UCS-2 exposes as separate characters) into a single code point, * matching UTF-16. * @see `punycode.ucs2.encode` * @see <https://mathiasbynens.be/notes/javascript-encoding> * @memberOf punycode.ucs2 * @name decode * @param {String} string The Unicode input string (UCS-2). * @returns {Array} The new array of code points. */ function ucs2decode(string) { var output = [], counter = 0, length = string.length, value, extra; while (counter < length) { value = string.charCodeAt(counter++); if (value >= 55296 && value <= 56319 && counter < length) { // high surrogate, and there is a next character extra = string.charCodeAt(counter++); if ((extra & 64512) == 56320) { // low surrogate output.push(((value & 1023) << 10) + (extra & 1023) + 65536); } else { // unmatched surrogate; only append this code unit, in case the next // code unit is the high surrogate of a surrogate pair output.push(value); counter--; } } else { output.push(value); } } return output; } /** * Creates a string based on an array of numeric code points. * @see `punycode.ucs2.decode` * @memberOf punycode.ucs2 * @name encode * @param {Array} codePoints The array of numeric code points. * @returns {String} The new Unicode string (UCS-2). */ function ucs2encode(array) { return map(array, (function(value) { var output = ""; if (value > 65535) { value -= 65536; output += stringFromCharCode(value >>> 10 & 1023 | 55296); value = 56320 | value & 1023; } output += stringFromCharCode(value); return output; })).join(""); } /** * Converts a basic code point into a digit/integer. * @see `digitToBasic()` * @private * @param {Number} codePoint The basic numeric code point value. * @returns {Number} The numeric value of a basic code point (for use in * representing integers) in the range `0` to `base - 1`, or `base` if * the code point does not represent a value. */ function basicToDigit(codePoint) { if (codePoint - 48 < 10) { return codePoint - 22; } if (codePoint - 65 < 26) { return codePoint - 65; } if (codePoint - 97 < 26) { return codePoint - 97; } return base; } /** * Converts a digit/integer into a basic code point. * @see `basicToDigit()` * @private * @param {Number} digit The numeric value of a basic code point. * @returns {Number} The basic code point whose value (when used for * representing integers) is `digit`, which needs to be in the range * `0` to `base - 1`. If `flag` is non-zero, the uppercase form is * used; else, the lowercase form is used. The behavior is undefined * if `flag` is non-zero and `digit` has no uppercase form. */ function digitToBasic(digit, flag) { // 0..25 map to ASCII a..z or A..Z // 26..35 map to ASCII 0..9 return digit + 22 + 75 * (digit < 26) - ((flag != 0) << 5); } /** * Bias adaptation function as per section 3.4 of RFC 3492. * https://tools.ietf.org/html/rfc3492#section-3.4 * @private */ function adapt(delta, numPoints, firstTime) { var k = 0; delta = firstTime ? floor(delta / damp) : delta >> 1; delta += floor(delta / numPoints); for (;delta > baseMinusTMin * tMax >> 1; k += base) { delta = floor(delta / baseMinusTMin); } return floor(k + (baseMinusTMin + 1) * delta / (delta + skew)); } /** * Converts a Punycode string of ASCII-only symbols to a string of Unicode * symbols. * @memberOf punycode * @param {String} input The Punycode string of ASCII-only symbols. * @returns {String} The resulting string of Unicode symbols. */ function decode(input) { // Don't use UCS-2 var output = [], inputLength = input.length, out, i = 0, n = initialN, bias = initialBias, basic, j, index, oldi, w, k, digit, t, /** Cached calculation results */ baseMinusT; // Handle the basic code points: let `basic` be the number of input code // points before the last delimiter, or `0` if there is none, then copy // the first basic code points to the output. basic = input.lastIndexOf(delimiter); if (basic < 0) { basic = 0; } for (j = 0; j < basic; ++j) { // if it's not a basic code point if (input.charCodeAt(j) >= 128) { error("not-basic"); } output.push(input.charCodeAt(j)); } // Main decoding loop: start just after the last delimiter if any basic code // points were copied; start at the beginning otherwise. for (index = basic > 0 ? basic + 1 : 0; index < inputLength; ) { // `index` is the index of the next character to be consumed. // Decode a generalized variable-length integer into `delta`, // which gets added to `i`. The overflow checking is easier // if we increase `i` as we go, then subtract off its starting // value at the end to obtain `delta`. for (oldi = i, w = 1, k = base; ;k += base) { if (index >= inputLength) { error("invalid-input"); } digit = basicToDigit(input.charCodeAt(index++)); if (digit >= base || digit > floor((maxInt - i) / w)) { error("overflow"); } i += digit * w; t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; if (digit < t) { break; } baseMinusT = base - t; if (w > floor(maxInt / baseMinusT)) { error("overflow"); } w *= baseMinusT; } out = output.length + 1; bias = adapt(i - oldi, out, oldi == 0); // `i` was supposed to wrap around from `out` to `0`, // incrementing `n` each time, so we'll fix that now: if (floor(i / out) > maxInt - n) { error("overflow"); } n += floor(i / out); i %= out; // Insert `n` at position `i` of the output output.splice(i++, 0, n); } return ucs2encode(output); } /** * Converts a string of Unicode symbols (e.g. a domain name label) to a * Punycode string of ASCII-only symbols. * @memberOf punycode * @param {String} input The string of Unicode symbols. * @returns {String} The resulting Punycode string of ASCII-only symbols. */ function encode(input) { var n, delta, handledCPCount, basicLength, bias, j, m, q, k, t, currentValue, output = [], /** `inputLength` will hold the number of code points in `input`. */ inputLength, /** Cached calculation results */ handledCPCountPlusOne, baseMinusT, qMinusT; // Convert the input in UCS-2 to Unicode input = ucs2decode(input); // Cache the length inputLength = input.length; // Initialize the state n = initialN; delta = 0; bias = initialBias; // Handle the basic code points for (j = 0; j < inputLength; ++j) { currentValue = input[j]; if (currentValue < 128) { output.push(stringFromCharCode(currentValue)); } } handledCPCount = basicLength = output.length; // `handledCPCount` is the number of code points that have been handled; // `basicLength` is the number of basic code points. // Finish the basic string - if it is not empty - with a delimiter if (basicLength) { output.push(delimiter); } // Main encoding loop: while (handledCPCount < inputLength) { // All non-basic code points < n have been handled already. Find the next // larger one: for (m = maxInt, j = 0; j < inputLength; ++j) { currentValue = input[j]; if (currentValue >= n && currentValue < m) { m = currentValue; } } // Increase `delta` enough to advance the decoder's <n,i> state to <m,0>, // but guard against overflow handledCPCountPlusOne = handledCPCount + 1; if (m - n > floor((maxInt - delta) / handledCPCountPlusOne)) { error("overflow"); } delta += (m - n) * handledCPCountPlusOne; n = m; for (j = 0; j < inputLength; ++j) { currentValue = input[j]; if (currentValue < n && ++delta > maxInt) { error("overflow"); } if (currentValue == n) { // Represent delta as a generalized variable-length integer for (q = delta, k = base; ;k += base) { t = k <= bias ? tMin : k >= bias + tMax ? tMax : k - bias; if (q < t) { break; } qMinusT = q - t; baseMinusT = base - t; output.push(stringFromCharCode(digitToBasic(t + qMinusT % baseMinusT, 0))); q = floor(qMinusT / baseMinusT); } output.push(stringFromCharCode(digitToBasic(q, 0))); bias = adapt(delta, handledCPCountPlusOne, handledCPCount == basicLength); delta = 0; ++handledCPCount; } } ++delta; ++n; } return output.join(""); } /** * Converts a Punycode string representing a domain name or an email address * to Unicode. Only the Punycoded parts of the input will be converted, i.e. * it doesn't matter if you call it on a string that has already been * converted to Unicode. * @memberOf punycode * @param {String} input The Punycoded domain name or email address to * convert to Unicode. * @returns {String} The Unicode representation of the given Punycode * string. */ function toUnicode(input) { return mapDomain(input, (function(string) { return regexPunycode.test(string) ? decode(string.slice(4).toLowerCase()) : string; })); } /** * Converts a Unicode string representing a domain name or an email address to * Punycode. Only the non-ASCII parts of the domain name will be converted, * i.e. it doesn't matter if you call it with a domain that's already in * ASCII. * @memberOf punycode * @param {String} input The domain name or email address to convert, as a * Unicode string. * @returns {String} The Punycode representation of the given domain name or * email address. */ function toASCII(input) { return mapDomain(input, (function(string) { return regexNonASCII.test(string) ? "xn--" + encode(string) : string; })); } var version = "1.4.1"; /** * An object of methods to convert from JavaScript's internal character * representation (UCS-2) to Unicode code points, and back. * @see <https://mathiasbynens.be/notes/javascript-encoding> * @memberOf punycode * @type Object */ var ucs2 = { decode: ucs2decode, encode: ucs2encode }; var punycode$1 = { version: version, ucs2: ucs2, toASCII: toASCII, toUnicode: toUnicode, encode: encode, decode: decode }; var punycode$2 = Object.freeze({ __proto__: null, decode: decode, encode: encode, toUnicode: toUnicode, toASCII: toASCII, version: version, ucs2: ucs2, default: punycode$1 }); // markdown-it default options var _default = { options: { html: false, // Enable HTML tags in source xhtmlOut: false, // Use '/' to close single tags (<br />) breaks: false, // Convert '\n' in paragraphs into <br> langPrefix: "language-", // CSS language prefix for fenced blocks linkify: false, // autoconvert URL-like texts to links // Enable some language-neutral replacements + quotes beautification typographer: false, // Double + single quotes replacement pairs, when typographer enabled, // and smartquotes on. Could be either a String or an Array. // For example, you can use '«»„“' for Russian, '„“‚‘' for German, // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). quotes: "\u201c\u201d\u2018\u2019", /* “”‘’ */ // Highlighter function. Should return escaped HTML, // or '' if the source string is not changed and should be escaped externaly. // If result starts with <pre... internal wrapper is skipped. // function (/*str, lang*/) { return ''; } highlight: null, maxNesting: 100 }, components: { core: {}, block: {}, inline: {} } }; // "Zero" preset, with nothing enabled. Useful for manual configuring of simple var zero = { options: { html: false, // Enable HTML tags in source xhtmlOut: false, // Use '/' to close single tags (<br />) breaks: false, // Convert '\n' in paragraphs into <br> langPrefix: "language-", // CSS language prefix for fenced blocks linkify: false, // autoconvert URL-like texts to links // Enable some language-neutral replacements + quotes beautification typographer: false, // Double + single quotes replacement pairs, when typographer enabled, // and smartquotes on. Could be either a String or an Array. // For example, you can use '«»„“' for Russian, '„“‚‘' for German, // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). quotes: "\u201c\u201d\u2018\u2019", /* “”‘’ */ // Highlighter function. Should return escaped HTML, // or '' if the source string is not changed and should be escaped externaly. // If result starts with <pre... internal wrapper is skipped. // function (/*str, lang*/) { return ''; } highlight: null, maxNesting: 20 }, components: { core: { rules: [ "normalize", "block", "inline" ] }, block: { rules: [ "paragraph" ] }, inline: { rules: [ "text" ], rules2: [ "balance_pairs", "text_collapse" ] } } }; // Commonmark default options var commonmark = { options: { html: true, // Enable HTML tags in source xhtmlOut: true, // Use '/' to close single tags (<br />) breaks: false, // Convert '\n' in paragraphs into <br> langPrefix: "language-", // CSS language prefix for fenced blocks linkify: false, // autoconvert URL-like texts to links // Enable some language-neutral replacements + quotes beautification typographer: false, // Double + single quotes replacement pairs, when typographer enabled, // and smartquotes on. Could be either a String or an Array. // For example, you can use '«»„“' for Russian, '„“‚‘' for German, // and ['«\xA0', '\xA0»', '‹\xA0', '\xA0›'] for French (including nbsp). quotes: "\u201c\u201d\u2018\u2019", /* “”‘’ */ // Highlighter function. Should return escaped HTML, // or '' if the source string is not changed and should be escaped externaly. // If result starts with <pre... internal wrapper is skipped. // function (/*str, lang*/) { return ''; } highlight: null, maxNesting: 20 }, components: { core: { rules: [ "normalize", "block", "inline" ] }, block: { rules: [ "blockquote", "code", "fence", "heading", "hr", "html_block", "lheading", "list", "reference", "paragraph" ] }, inline: { rules: [ "autolink", "backticks", "emphasis", "entity", "escape", "html_inline", "image", "link", "newline", "text" ], rules2: [ "balance_pairs", "emphasis", "text_collapse" ] } } }; var punycode = getAugmentedNamespace(punycode$2); var config = { default: _default, zero: zero, commonmark: commonmark }; //////////////////////////////////////////////////////////////////////////////// // This validator can prohibit more than really needed to prevent XSS. It's a // tradeoff to keep code simple and to be secure by default. // If you need different setup - override validator method as you wish. Or // replace it with dummy function and use external sanitizer. var BAD_PROTO_RE = /^(vbscript|javascript|file|data):/; var GOOD_DATA_RE = /^data:image\/(gif|png|jpeg|webp);/; function validateLink(url) { // url should be normalized at this point, and existing entities are decoded var str = url.trim().toLowerCase(); return BAD_PROTO_RE.test(str) ? GOOD_DATA_RE.test(str) ? true : false : true; } //////////////////////////////////////////////////////////////////////////////// var RECODE_HOSTNAME_FOR = [ "http:", "https:", "mailto:" ]; function normalizeLink(url) { var parsed = mdurl.parse(url, true); if (parsed.hostname) { // Encode hostnames in urls like: // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` // We don't encode unknown schemas, because it's likely that we encode // something we shouldn't (e.g. `skype:name` treated as `skype:host`) if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { try { parsed.hostname = punycode.toASCII(parsed.hostname); } catch (er) {} } } return mdurl.encode(mdurl.format(parsed)); } function normalizeLinkText(url) { var parsed = mdurl.parse(url, true); if (parsed.hostname) { // Encode hostnames in urls like: // `http://host/`, `https://host/`, `mailto:user@host`, `//host/` // We don't encode unknown schemas, because it's likely that we encode // something we shouldn't (e.g. `skype:name` treated as `skype:host`) if (!parsed.protocol || RECODE_HOSTNAME_FOR.indexOf(parsed.protocol) >= 0) { try { parsed.hostname = punycode.toUnicode(parsed.hostname); } catch (er) {} } } // add '%' to exclude list because of https://github.com/markdown-it/markdown-it/issues/720 return mdurl.decode(mdurl.format(parsed), mdurl.decode.defaultChars + "%"); } /** * class MarkdownIt * * Main parser/renderer class. * * ##### Usage * * ```javascript * // node.js, "classic" way: * var MarkdownIt = require('markdown-it'), * md = new MarkdownIt(); * var result = md.render('# markdown-it rulezz!'); * * // node.js, the same, but with sugar: * var md = require('markdown-it')(); * var result = md.render('# markdown-it rulezz!'); * * // browser without AMD, added to "window" on script load * // Note, there are no dash. * var md = window.markdownit(); * var result = md.render('# markdown-it rulezz!'); * ``` * * Single line rendering, without paragraph wrap: * * ```javascript * var md = require('markdown-it')(); * var result = md.renderInline('__markdown-it__ rulezz!'); * ``` **/ /** * new MarkdownIt([presetName, options]) * - presetName (String): optional, `commonmark` / `zero` * - options (Object) * * Creates parser instanse with given config. Can be called without `new`. * * ##### presetName * * MarkdownIt provides named presets as a convenience to quickly * enable/disable active syntax rules and options for common use cases. * * - ["commonmark"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/commonmark.js) - * configures parser to strict [CommonMark](http://commonmark.org/) mode. * - [default](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/default.js) - * similar to GFM, used when no preset name given. Enables all available rules, * but still without html, typographer & autolinker. * - ["zero"](https://github.com/markdown-it/markdown-it/blob/master/lib/presets/zero.js) - * all rules disabled. Useful to quickly setup your config via `.enable()`. * For example, when you need only `bold` and `italic` markup and nothing else. * * ##### options: * * - __html__ - `false`. Set `true` to enable HTML tags in source. Be careful! * That's not safe! You may need external sanitizer to protect output from XSS. * It's better to extend features via plugins, instead of enabling HTML. * - __xhtmlOut__ - `false`. Set `true` to add '/' when closing single tags * (`<br />`). This is needed only for full CommonMark compatibility. In real * world you will need HTML output. * - __breaks__ - `false`. Set `true` to convert `\n` in paragraphs into `<br>`. * - __langPrefix__ - `language-`. CSS language class prefix for fenced blocks. * Can be useful for external highlighters. * - __linkify__ - `false`. Set `true` to autoconvert URL-like text to links. * - __typographer__ - `false`. Set `true` to enable [some language-neutral * replacement](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/replacements.js) + * quotes beautification (smartquotes). * - __quotes__ - `“”‘’`, String or Array. Double + single quotes replacement * pairs, when typographer enabled and smartquotes on. For example, you can * use `'«»„“'` for Russian, `'„“‚‘'` for German, and * `['«\xA0', '\xA0»', '‹\xA0', '\xA0›']` for French (including nbsp). * - __highlight__ - `null`. Highlighter function for fenced code blocks. * Highlighter `function (str, lang)` should return escaped HTML. It can also * return empty string if the source was not changed and should be escaped * externaly. If result starts with <pre... internal wrapper is skipped. * * ##### Example * * ```javascript * // commonmark mode * var md = require('markdown-it')('commonmark'); * * // default mode * var md = require('markdown-it')(); * * // enable everything * var md = require('markdown-it')({ * html: true, * linkify: true, * typographer: true * }); * ``` * * ##### Syntax highlighting * * ```js * var hljs = require('highlight.js') // https://highlightjs.org/ * * var md = require('markdown-it')({ * highlight: function (str, lang) { * if (lang && hljs.getLanguage(lang)) { * try { * return hljs.highlight(str, { language: lang, ignoreIllegals: true }).value; * } catch (__) {} * } * * return ''; // use external default escaping * } * }); * ``` * * Or with full wrapper override (if you need assign class to `<pre>`): * * ```javascript * var hljs = require('highlight.js') // https://highlightjs.org/ * * // Actual default values * var md = require('markdown-it')({ * highlight: function (str, lang) { * if (lang && hljs.getLanguage(lang)) { * try { * return '<pre class="hljs"><code>' + * hljs.highlight(str, { language: lang, ignoreIllegals: true }).value + * '</code></pre>'; * } catch (__) {} * } * * return '<pre class="hljs"><code>' + md.utils.escapeHtml(str) + '</code></pre>'; * } * }); * ``` * **/ function MarkdownIt(presetName, options) { if (!(this instanceof MarkdownIt)) { return new MarkdownIt(presetName, options); } if (!options) { if (!utils.isString(presetName)) { options = presetName || {}; presetName = "default"; } } /** * MarkdownIt#inline -> ParserInline * * Instance of [[ParserInline]]. You may need it to add new rules when * writing plugins. For simple rules control use [[MarkdownIt.disable]] and * [[MarkdownIt.enable]]. **/ this.inline = new parser_inline; /** * MarkdownIt#block -> ParserBlock * * Instance of [[ParserBlock]]. You may need it to add new rules when * writing plugins. For simple rules control use [[MarkdownIt.disable]] and * [[MarkdownIt.enable]]. **/ this.block = new parser_block; /** * MarkdownIt#core -> Core * * Instance of [[Core]] chain executor. You may need it to add new rules when * writing plugins. For simple rules control use [[MarkdownIt.disable]] and * [[MarkdownIt.enable]]. **/ this.core = new parser_core; /** * MarkdownIt#renderer -> Renderer * * Instance of [[Renderer]]. Use it to modify output look. Or to add rendering * rules for new token types, generated by plugins. * * ##### Example * * ```javascript * var md = require('markdown-it')(); * * function myToken(tokens, idx, options, env, self) { * //... * return result; * }; * * md.renderer.rules['my_token'] = myToken * ``` * * See [[Renderer]] docs and [source code](https://github.com/markdown-it/markdown-it/blob/master/lib/renderer.js). **/ this.renderer = new renderer; /** * MarkdownIt#linkify -> LinkifyIt * * [linkify-it](https://github.com/markdown-it/linkify-it) instance. * Used by [linkify](https://github.com/markdown-it/markdown-it/blob/master/lib/rules_core/linkify.js) * rule. **/ this.linkify = new linkifyIt; /** * MarkdownIt#validateLink(url) -> Boolean * * Link validation function. CommonMark allows too much in links. By default * we disable `javascript:`, `vbscript:`, `file:` schemas, and almost all `data:...` schemas * except some embedded image types. * * You can change this behaviour: * * ```javascript * var md = require('markdown-it')(); * // enable everything * md.validateLink = function () { return true; } * ``` **/ this.validateLink = validateLink; /** * MarkdownIt#normalizeLink(url) -> String * * Function used to encode link url to a machine-readable format, * which includes url-encoding, punycode, etc. **/ this.normalizeLink = normalizeLink; /** * MarkdownIt#normalizeLinkText(url) -> String * * Function used to decode link url to a human-readable format` **/ this.normalizeLinkText = normalizeLinkText; // Expose utils & helpers for easy acces from plugins /** * MarkdownIt#utils -> utils * * Assorted utility functions, useful to write plugins. See details * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/common/utils.js). **/ this.utils = utils; /** * MarkdownIt#helpers -> helpers * * Link components parser functions, useful to write plugins. See details * [here](https://github.com/markdown-it/markdown-it/blob/master/lib/helpers). **/ this.helpers = utils.assign({}, helpers); this.options = {}; this.configure(presetName); if (options) { this.set(options); } } /** chainable * MarkdownIt.set(options) * * Set parser options (in the same format as in constructor). Probably, you * will never need it, but you can change options after constructor call. * * ##### Example * * ```javascript * var md = require('markdown-it')() * .set({ html: true, breaks: true }) * .set({ typographer, true }); * ``` * * __Note:__ To achieve the best possible performance, don't modify a * `markdown-it` instance options on the fly. If you need multiple configurations * it's best to create multiple instances and initialize each with separate * config. **/ MarkdownIt.prototype.set = function(options) { utils.assign(this.options, options); return this; }; /** chainable, internal * MarkdownIt.configure(presets) * * Batch load of all options and compenent settings. This is internal method, * and you probably will not need it. But if you will - see available presets * and data structure [here](https://github.com/markdown-it/markdown-it/tree/master/lib/presets) * * We strongly recommend to use presets instead of direct config loads. That * will give better compatibility with next versions. **/ MarkdownIt.prototype.configure = function(presets) { var self = this, presetName; if (utils.isString(presets)) { presetName = presets; presets = config[presetName]; if (!presets) { throw new Error('Wrong `markdown-it` preset "' + presetName + '", check name'); } } if (!presets) { throw new Error("Wrong `markdown-it` preset, can't be empty"); } if (presets.options) { self.set(presets.options); } if (presets.components) { Object.keys(presets.components).forEach((function(name) { if (presets.components[name].rules) { self[name].ruler.enableOnly(presets.components[name].rules); } if (presets.components[name].rules2) { self[name].ruler2.enableOnly(presets.components[name].rules2); } })); } return this; }; /** chainable * MarkdownIt.enable(list, ignoreInvalid) * - list (String|Array): rule name or list of rule names to enable * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. * * Enable list or rules. It will automatically find appropriate components, * containing rules with given names. If rule not found, and `ignoreInvalid` * not set - throws exception. * * ##### Example * * ```javascript * var md = require('markdown-it')() * .enable(['sub', 'sup']) * .disable('smartquotes'); * ``` **/ MarkdownIt.prototype.enable = function(list, ignoreInvalid) { var result = []; if (!Array.isArray(list)) { list = [ list ]; } [ "core", "block", "inline" ].forEach((function(chain) { result = result.concat(this[chain].ruler.enable(list, true)); }), this); result = result.concat(this.inline.ruler2.enable(list, true)); var missed = list.filter((function(name) { return result.indexOf(name) < 0; })); if (missed.length && !ignoreInvalid) { throw new Error("MarkdownIt. Failed to enable unknown rule(s): " + missed); } return this; }; /** chainable * MarkdownIt.disable(list, ignoreInvalid) * - list (String|Array): rule name or list of rule names to disable. * - ignoreInvalid (Boolean): set `true` to ignore errors when rule not found. * * The same as [[MarkdownIt.enable]], but turn specified rules off. **/ MarkdownIt.prototype.disable = function(list, ignoreInvalid) { var result = []; if (!Array.isArray(list)) { list = [ list ]; } [ "core", "block", "inline" ].forEach((function(chain) { result = result.concat(this[chain].ruler.disable(list, true)); }), this); result = result.concat(this.inline.ruler2.disable(list, true)); var missed = list.filter((function(name) { return result.indexOf(name) < 0; })); if (missed.length && !ignoreInvalid) { throw new Error("MarkdownIt. Failed to disable unknown rule(s): " + missed); } return this; }; /** chainable * MarkdownIt.use(plugin, params) * * Load specified plugin with given params into current parser instance. * It's just a sugar to call `plugin(md, params)` with curring. * * ##### Example * * ```javascript * var iterator = require('markdown-it-for-inline'); * var md = require('markdown-it')() * .use(iterator, 'foo_replace', 'text', function (tokens, idx) { * tokens[idx].content = tokens[idx].content.replace(/foo/g, 'bar'); * }); * ``` **/ MarkdownIt.prototype.use = function(plugin /*, params, ... */) { var args = [ this ].concat(Array.prototype.slice.call(arguments, 1)); plugin.apply(plugin, args); return this; }; /** internal * MarkdownIt.parse(src, env) -> Array * - src (String): source string * - env (Object): environment sandbox * * Parse input string and return list of block tokens (special token type * "inline" will contain list of inline tokens). You should not call this * method directly, until you write custom renderer (for example, to produce * AST). * * `env` is used to pass data between "distributed" rules and return additional * metadata like reference info, needed for the renderer. It also can be used to * inject data in specific cases. Usually, you will be ok to pass `{}`, * and then pass updated object to renderer. **/ MarkdownIt.prototype.parse = function(src, env) { if (typeof src !== "string") { throw new Error("Input data should be a String"); } var state = new this.core.State(src, this, env); this.core.process(state); return state.tokens; }; /** * MarkdownIt.render(src [, env]) -> String * - src (String): source string * - env (Object): environment sandbox * * Render markdown string into html. It does all magic for you :). * * `env` can be used to inject additional metadata (`{}` by default). * But you will not need it with high probability. See also comment * in [[MarkdownIt.parse]]. **/ MarkdownIt.prototype.render = function(src, env) { env = env || {}; return this.renderer.render(this.parse(src, env), this.options, env); }; /** internal * MarkdownIt.parseInline(src, env) -> Array * - src (String): source string * - env (Object): environment sandbox * * The same as [[MarkdownIt.parse]] but skip all block rules. It returns the * block tokens list with the single `inline` element, containing parsed inline * tokens in `children` property. Also updates `env` object. **/ MarkdownIt.prototype.parseInline = function(src, env) { var state = new this.core.State(src, this, env); state.inlineMode = true; this.core.process(state); return state.tokens; }; /** * MarkdownIt.renderInline(src [, env]) -> String * - src (String): source string * - env (Object): environment sandbox * * Similar to [[MarkdownIt.render]] but for single paragraph content. Result * will NOT be wrapped into `<p>` tags. **/ MarkdownIt.prototype.renderInline = function(src, env) { env = env || {}; return this.renderer.render(this.parseInline(src, env), this.options, env); }; var lib = MarkdownIt; var markdownIt = lib; return markdownIt; })); markdown-it.min.js 0000664 00000305014 15105452314 0010125 0 ustar 00 /*! markdown-it 12.2.0 https://github.com/markdown-it/markdown-it @license MIT */ !function(e,r){"object"==typeof exports&&"undefined"!=typeof module?module.exports=r():"function"==typeof define&&define.amd?define(r):(e="undefined"!=typeof globalThis?globalThis:e||self).markdownit=r()}(this,(function(){"use strict";function e(e){if(e.__esModule)return e;var r=Object.defineProperty({},"__esModule",{value:!0});return Object.keys(e).forEach((function(t){var n=Object.getOwnPropertyDescriptor(e,t);Object.defineProperty(r,t,n.get?n:{enumerable:!0,get:function(){return e[t]}})})),r}var r={Aacute:"\xc1",aacute:"\xe1",Abreve:"\u0102",abreve:"\u0103",ac:"\u223e",acd:"\u223f",acE:"\u223e\u0333",Acirc:"\xc2",acirc:"\xe2",acute:"\xb4",Acy:"\u0410",acy:"\u0430",AElig:"\xc6",aelig:"\xe6",af:"\u2061",Afr:"\ud835\udd04",afr:"\ud835\udd1e",Agrave:"\xc0",agrave:"\xe0",alefsym:"\u2135",aleph:"\u2135",Alpha:"\u0391",alpha:"\u03b1",Amacr:"\u0100",amacr:"\u0101",amalg:"\u2a3f",amp:"&",AMP:"&",andand:"\u2a55",And:"\u2a53",and:"\u2227",andd:"\u2a5c",andslope:"\u2a58",andv:"\u2a5a",ang:"\u2220",ange:"\u29a4",angle:"\u2220",angmsdaa:"\u29a8",angmsdab:"\u29a9",angmsdac:"\u29aa",angmsdad:"\u29ab",angmsdae:"\u29ac",angmsdaf:"\u29ad",angmsdag:"\u29ae",angmsdah:"\u29af",angmsd:"\u2221",angrt:"\u221f",angrtvb:"\u22be",angrtvbd:"\u299d",angsph:"\u2222",angst:"\xc5",angzarr:"\u237c",Aogon:"\u0104",aogon:"\u0105",Aopf:"\ud835\udd38",aopf:"\ud835\udd52",apacir:"\u2a6f",ap:"\u2248",apE:"\u2a70",ape:"\u224a",apid:"\u224b",apos:"'",ApplyFunction:"\u2061",approx:"\u2248",approxeq:"\u224a",Aring:"\xc5",aring:"\xe5",Ascr:"\ud835\udc9c",ascr:"\ud835\udcb6",Assign:"\u2254",ast:"*",asymp:"\u2248",asympeq:"\u224d",Atilde:"\xc3",atilde:"\xe3",Auml:"\xc4",auml:"\xe4",awconint:"\u2233",awint:"\u2a11",backcong:"\u224c",backepsilon:"\u03f6",backprime:"\u2035",backsim:"\u223d",backsimeq:"\u22cd",Backslash:"\u2216",Barv:"\u2ae7",barvee:"\u22bd",barwed:"\u2305",Barwed:"\u2306",barwedge:"\u2305",bbrk:"\u23b5",bbrktbrk:"\u23b6",bcong:"\u224c",Bcy:"\u0411",bcy:"\u0431",bdquo:"\u201e",becaus:"\u2235",because:"\u2235",Because:"\u2235",bemptyv:"\u29b0",bepsi:"\u03f6",bernou:"\u212c",Bernoullis:"\u212c",Beta:"\u0392",beta:"\u03b2",beth:"\u2136",between:"\u226c",Bfr:"\ud835\udd05",bfr:"\ud835\udd1f",bigcap:"\u22c2",bigcirc:"\u25ef",bigcup:"\u22c3",bigodot:"\u2a00",bigoplus:"\u2a01",bigotimes:"\u2a02",bigsqcup:"\u2a06",bigstar:"\u2605",bigtriangledown:"\u25bd",bigtriangleup:"\u25b3",biguplus:"\u2a04",bigvee:"\u22c1",bigwedge:"\u22c0",bkarow:"\u290d",blacklozenge:"\u29eb",blacksquare:"\u25aa",blacktriangle:"\u25b4",blacktriangledown:"\u25be",blacktriangleleft:"\u25c2",blacktriangleright:"\u25b8",blank:"\u2423",blk12:"\u2592",blk14:"\u2591",blk34:"\u2593",block:"\u2588",bne:"=\u20e5",bnequiv:"\u2261\u20e5",bNot:"\u2aed",bnot:"\u2310",Bopf:"\ud835\udd39",bopf:"\ud835\udd53",bot:"\u22a5",bottom:"\u22a5",bowtie:"\u22c8",boxbox:"\u29c9",boxdl:"\u2510",boxdL:"\u2555",boxDl:"\u2556",boxDL:"\u2557",boxdr:"\u250c",boxdR:"\u2552",boxDr:"\u2553",boxDR:"\u2554",boxh:"\u2500",boxH:"\u2550",boxhd:"\u252c",boxHd:"\u2564",boxhD:"\u2565",boxHD:"\u2566",boxhu:"\u2534",boxHu:"\u2567",boxhU:"\u2568",boxHU:"\u2569",boxminus:"\u229f",boxplus:"\u229e",boxtimes:"\u22a0",boxul:"\u2518",boxuL:"\u255b",boxUl:"\u255c",boxUL:"\u255d",boxur:"\u2514",boxuR:"\u2558",boxUr:"\u2559",boxUR:"\u255a",boxv:"\u2502",boxV:"\u2551",boxvh:"\u253c",boxvH:"\u256a",boxVh:"\u256b",boxVH:"\u256c",boxvl:"\u2524",boxvL:"\u2561",boxVl:"\u2562",boxVL:"\u2563",boxvr:"\u251c",boxvR:"\u255e",boxVr:"\u255f",boxVR:"\u2560",bprime:"\u2035",breve:"\u02d8",Breve:"\u02d8",brvbar:"\xa6",bscr:"\ud835\udcb7",Bscr:"\u212c",bsemi:"\u204f",bsim:"\u223d",bsime:"\u22cd",bsolb:"\u29c5",bsol:"\\",bsolhsub:"\u27c8",bull:"\u2022",bullet:"\u2022",bump:"\u224e",bumpE:"\u2aae",bumpe:"\u224f",Bumpeq:"\u224e",bumpeq:"\u224f",Cacute:"\u0106",cacute:"\u0107",capand:"\u2a44",capbrcup:"\u2a49",capcap:"\u2a4b",cap:"\u2229",Cap:"\u22d2",capcup:"\u2a47",capdot:"\u2a40",CapitalDifferentialD:"\u2145",caps:"\u2229\ufe00",caret:"\u2041",caron:"\u02c7",Cayleys:"\u212d",ccaps:"\u2a4d",Ccaron:"\u010c",ccaron:"\u010d",Ccedil:"\xc7",ccedil:"\xe7",Ccirc:"\u0108",ccirc:"\u0109",Cconint:"\u2230",ccups:"\u2a4c",ccupssm:"\u2a50",Cdot:"\u010a",cdot:"\u010b",cedil:"\xb8",Cedilla:"\xb8",cemptyv:"\u29b2",cent:"\xa2",centerdot:"\xb7",CenterDot:"\xb7",cfr:"\ud835\udd20",Cfr:"\u212d",CHcy:"\u0427",chcy:"\u0447",check:"\u2713",checkmark:"\u2713",Chi:"\u03a7",chi:"\u03c7",circ:"\u02c6",circeq:"\u2257",circlearrowleft:"\u21ba",circlearrowright:"\u21bb",circledast:"\u229b",circledcirc:"\u229a",circleddash:"\u229d",CircleDot:"\u2299",circledR:"\xae",circledS:"\u24c8",CircleMinus:"\u2296",CirclePlus:"\u2295",CircleTimes:"\u2297",cir:"\u25cb",cirE:"\u29c3",cire:"\u2257",cirfnint:"\u2a10",cirmid:"\u2aef",cirscir:"\u29c2",ClockwiseContourIntegral:"\u2232",CloseCurlyDoubleQuote:"\u201d",CloseCurlyQuote:"\u2019",clubs:"\u2663",clubsuit:"\u2663",colon:":",Colon:"\u2237",Colone:"\u2a74",colone:"\u2254",coloneq:"\u2254",comma:",",commat:"@",comp:"\u2201",compfn:"\u2218",complement:"\u2201",complexes:"\u2102",cong:"\u2245",congdot:"\u2a6d",Congruent:"\u2261",conint:"\u222e",Conint:"\u222f",ContourIntegral:"\u222e",copf:"\ud835\udd54",Copf:"\u2102",coprod:"\u2210",Coproduct:"\u2210",copy:"\xa9",COPY:"\xa9",copysr:"\u2117",CounterClockwiseContourIntegral:"\u2233",crarr:"\u21b5",cross:"\u2717",Cross:"\u2a2f",Cscr:"\ud835\udc9e",cscr:"\ud835\udcb8",csub:"\u2acf",csube:"\u2ad1",csup:"\u2ad0",csupe:"\u2ad2",ctdot:"\u22ef",cudarrl:"\u2938",cudarrr:"\u2935",cuepr:"\u22de",cuesc:"\u22df",cularr:"\u21b6",cularrp:"\u293d",cupbrcap:"\u2a48",cupcap:"\u2a46",CupCap:"\u224d",cup:"\u222a",Cup:"\u22d3",cupcup:"\u2a4a",cupdot:"\u228d",cupor:"\u2a45",cups:"\u222a\ufe00",curarr:"\u21b7",curarrm:"\u293c",curlyeqprec:"\u22de",curlyeqsucc:"\u22df",curlyvee:"\u22ce",curlywedge:"\u22cf",curren:"\xa4",curvearrowleft:"\u21b6",curvearrowright:"\u21b7",cuvee:"\u22ce",cuwed:"\u22cf",cwconint:"\u2232",cwint:"\u2231",cylcty:"\u232d",dagger:"\u2020",Dagger:"\u2021",daleth:"\u2138",darr:"\u2193",Darr:"\u21a1",dArr:"\u21d3",dash:"\u2010",Dashv:"\u2ae4",dashv:"\u22a3",dbkarow:"\u290f",dblac:"\u02dd",Dcaron:"\u010e",dcaron:"\u010f",Dcy:"\u0414",dcy:"\u0434",ddagger:"\u2021",ddarr:"\u21ca",DD:"\u2145",dd:"\u2146",DDotrahd:"\u2911",ddotseq:"\u2a77",deg:"\xb0",Del:"\u2207",Delta:"\u0394",delta:"\u03b4",demptyv:"\u29b1",dfisht:"\u297f",Dfr:"\ud835\udd07",dfr:"\ud835\udd21",dHar:"\u2965",dharl:"\u21c3",dharr:"\u21c2",DiacriticalAcute:"\xb4",DiacriticalDot:"\u02d9",DiacriticalDoubleAcute:"\u02dd",DiacriticalGrave:"`",DiacriticalTilde:"\u02dc",diam:"\u22c4",diamond:"\u22c4",Diamond:"\u22c4",diamondsuit:"\u2666",diams:"\u2666",die:"\xa8",DifferentialD:"\u2146",digamma:"\u03dd",disin:"\u22f2",div:"\xf7",divide:"\xf7",divideontimes:"\u22c7",divonx:"\u22c7",DJcy:"\u0402",djcy:"\u0452",dlcorn:"\u231e",dlcrop:"\u230d",dollar:"$",Dopf:"\ud835\udd3b",dopf:"\ud835\udd55",Dot:"\xa8",dot:"\u02d9",DotDot:"\u20dc",doteq:"\u2250",doteqdot:"\u2251",DotEqual:"\u2250",dotminus:"\u2238",dotplus:"\u2214",dotsquare:"\u22a1",doublebarwedge:"\u2306",DoubleContourIntegral:"\u222f",DoubleDot:"\xa8",DoubleDownArrow:"\u21d3",DoubleLeftArrow:"\u21d0",DoubleLeftRightArrow:"\u21d4",DoubleLeftTee:"\u2ae4",DoubleLongLeftArrow:"\u27f8",DoubleLongLeftRightArrow:"\u27fa",DoubleLongRightArrow:"\u27f9",DoubleRightArrow:"\u21d2",DoubleRightTee:"\u22a8",DoubleUpArrow:"\u21d1",DoubleUpDownArrow:"\u21d5",DoubleVerticalBar:"\u2225",DownArrowBar:"\u2913",downarrow:"\u2193",DownArrow:"\u2193",Downarrow:"\u21d3",DownArrowUpArrow:"\u21f5",DownBreve:"\u0311",downdownarrows:"\u21ca",downharpoonleft:"\u21c3",downharpoonright:"\u21c2",DownLeftRightVector:"\u2950",DownLeftTeeVector:"\u295e",DownLeftVectorBar:"\u2956",DownLeftVector:"\u21bd",DownRightTeeVector:"\u295f",DownRightVectorBar:"\u2957",DownRightVector:"\u21c1",DownTeeArrow:"\u21a7",DownTee:"\u22a4",drbkarow:"\u2910",drcorn:"\u231f",drcrop:"\u230c",Dscr:"\ud835\udc9f",dscr:"\ud835\udcb9",DScy:"\u0405",dscy:"\u0455",dsol:"\u29f6",Dstrok:"\u0110",dstrok:"\u0111",dtdot:"\u22f1",dtri:"\u25bf",dtrif:"\u25be",duarr:"\u21f5",duhar:"\u296f",dwangle:"\u29a6",DZcy:"\u040f",dzcy:"\u045f",dzigrarr:"\u27ff",Eacute:"\xc9",eacute:"\xe9",easter:"\u2a6e",Ecaron:"\u011a",ecaron:"\u011b",Ecirc:"\xca",ecirc:"\xea",ecir:"\u2256",ecolon:"\u2255",Ecy:"\u042d",ecy:"\u044d",eDDot:"\u2a77",Edot:"\u0116",edot:"\u0117",eDot:"\u2251",ee:"\u2147",efDot:"\u2252",Efr:"\ud835\udd08",efr:"\ud835\udd22",eg:"\u2a9a",Egrave:"\xc8",egrave:"\xe8",egs:"\u2a96",egsdot:"\u2a98",el:"\u2a99",Element:"\u2208",elinters:"\u23e7",ell:"\u2113",els:"\u2a95",elsdot:"\u2a97",Emacr:"\u0112",emacr:"\u0113",empty:"\u2205",emptyset:"\u2205",EmptySmallSquare:"\u25fb",emptyv:"\u2205",EmptyVerySmallSquare:"\u25ab",emsp13:"\u2004",emsp14:"\u2005",emsp:"\u2003",ENG:"\u014a",eng:"\u014b",ensp:"\u2002",Eogon:"\u0118",eogon:"\u0119",Eopf:"\ud835\udd3c",eopf:"\ud835\udd56",epar:"\u22d5",eparsl:"\u29e3",eplus:"\u2a71",epsi:"\u03b5",Epsilon:"\u0395",epsilon:"\u03b5",epsiv:"\u03f5",eqcirc:"\u2256",eqcolon:"\u2255",eqsim:"\u2242",eqslantgtr:"\u2a96",eqslantless:"\u2a95",Equal:"\u2a75",equals:"=",EqualTilde:"\u2242",equest:"\u225f",Equilibrium:"\u21cc",equiv:"\u2261",equivDD:"\u2a78",eqvparsl:"\u29e5",erarr:"\u2971",erDot:"\u2253",escr:"\u212f",Escr:"\u2130",esdot:"\u2250",Esim:"\u2a73",esim:"\u2242",Eta:"\u0397",eta:"\u03b7",ETH:"\xd0",eth:"\xf0",Euml:"\xcb",euml:"\xeb",euro:"\u20ac",excl:"!",exist:"\u2203",Exists:"\u2203",expectation:"\u2130",exponentiale:"\u2147",ExponentialE:"\u2147",fallingdotseq:"\u2252",Fcy:"\u0424",fcy:"\u0444",female:"\u2640",ffilig:"\ufb03",fflig:"\ufb00",ffllig:"\ufb04",Ffr:"\ud835\udd09",ffr:"\ud835\udd23",filig:"\ufb01",FilledSmallSquare:"\u25fc",FilledVerySmallSquare:"\u25aa",fjlig:"fj",flat:"\u266d",fllig:"\ufb02",fltns:"\u25b1",fnof:"\u0192",Fopf:"\ud835\udd3d",fopf:"\ud835\udd57",forall:"\u2200",ForAll:"\u2200",fork:"\u22d4",forkv:"\u2ad9",Fouriertrf:"\u2131",fpartint:"\u2a0d",frac12:"\xbd",frac13:"\u2153",frac14:"\xbc",frac15:"\u2155",frac16:"\u2159",frac18:"\u215b",frac23:"\u2154",frac25:"\u2156",frac34:"\xbe",frac35:"\u2157",frac38:"\u215c",frac45:"\u2158",frac56:"\u215a",frac58:"\u215d",frac78:"\u215e",frasl:"\u2044",frown:"\u2322",fscr:"\ud835\udcbb",Fscr:"\u2131",gacute:"\u01f5",Gamma:"\u0393",gamma:"\u03b3",Gammad:"\u03dc",gammad:"\u03dd",gap:"\u2a86",Gbreve:"\u011e",gbreve:"\u011f",Gcedil:"\u0122",Gcirc:"\u011c",gcirc:"\u011d",Gcy:"\u0413",gcy:"\u0433",Gdot:"\u0120",gdot:"\u0121",ge:"\u2265",gE:"\u2267",gEl:"\u2a8c",gel:"\u22db",geq:"\u2265",geqq:"\u2267",geqslant:"\u2a7e",gescc:"\u2aa9",ges:"\u2a7e",gesdot:"\u2a80",gesdoto:"\u2a82",gesdotol:"\u2a84",gesl:"\u22db\ufe00",gesles:"\u2a94",Gfr:"\ud835\udd0a",gfr:"\ud835\udd24",gg:"\u226b",Gg:"\u22d9",ggg:"\u22d9",gimel:"\u2137",GJcy:"\u0403",gjcy:"\u0453",gla:"\u2aa5",gl:"\u2277",glE:"\u2a92",glj:"\u2aa4",gnap:"\u2a8a",gnapprox:"\u2a8a",gne:"\u2a88",gnE:"\u2269",gneq:"\u2a88",gneqq:"\u2269",gnsim:"\u22e7",Gopf:"\ud835\udd3e",gopf:"\ud835\udd58",grave:"`",GreaterEqual:"\u2265",GreaterEqualLess:"\u22db",GreaterFullEqual:"\u2267",GreaterGreater:"\u2aa2",GreaterLess:"\u2277",GreaterSlantEqual:"\u2a7e",GreaterTilde:"\u2273",Gscr:"\ud835\udca2",gscr:"\u210a",gsim:"\u2273",gsime:"\u2a8e",gsiml:"\u2a90",gtcc:"\u2aa7",gtcir:"\u2a7a",gt:">",GT:">",Gt:"\u226b",gtdot:"\u22d7",gtlPar:"\u2995",gtquest:"\u2a7c",gtrapprox:"\u2a86",gtrarr:"\u2978",gtrdot:"\u22d7",gtreqless:"\u22db",gtreqqless:"\u2a8c",gtrless:"\u2277",gtrsim:"\u2273",gvertneqq:"\u2269\ufe00",gvnE:"\u2269\ufe00",Hacek:"\u02c7",hairsp:"\u200a",half:"\xbd",hamilt:"\u210b",HARDcy:"\u042a",hardcy:"\u044a",harrcir:"\u2948",harr:"\u2194",hArr:"\u21d4",harrw:"\u21ad",Hat:"^",hbar:"\u210f",Hcirc:"\u0124",hcirc:"\u0125",hearts:"\u2665",heartsuit:"\u2665",hellip:"\u2026",hercon:"\u22b9",hfr:"\ud835\udd25",Hfr:"\u210c",HilbertSpace:"\u210b",hksearow:"\u2925",hkswarow:"\u2926",hoarr:"\u21ff",homtht:"\u223b",hookleftarrow:"\u21a9",hookrightarrow:"\u21aa",hopf:"\ud835\udd59",Hopf:"\u210d",horbar:"\u2015",HorizontalLine:"\u2500",hscr:"\ud835\udcbd",Hscr:"\u210b",hslash:"\u210f",Hstrok:"\u0126",hstrok:"\u0127",HumpDownHump:"\u224e",HumpEqual:"\u224f",hybull:"\u2043",hyphen:"\u2010",Iacute:"\xcd",iacute:"\xed",ic:"\u2063",Icirc:"\xce",icirc:"\xee",Icy:"\u0418",icy:"\u0438",Idot:"\u0130",IEcy:"\u0415",iecy:"\u0435",iexcl:"\xa1",iff:"\u21d4",ifr:"\ud835\udd26",Ifr:"\u2111",Igrave:"\xcc",igrave:"\xec",ii:"\u2148",iiiint:"\u2a0c",iiint:"\u222d",iinfin:"\u29dc",iiota:"\u2129",IJlig:"\u0132",ijlig:"\u0133",Imacr:"\u012a",imacr:"\u012b",image:"\u2111",ImaginaryI:"\u2148",imagline:"\u2110",imagpart:"\u2111",imath:"\u0131",Im:"\u2111",imof:"\u22b7",imped:"\u01b5",Implies:"\u21d2",incare:"\u2105",in:"\u2208",infin:"\u221e",infintie:"\u29dd",inodot:"\u0131",intcal:"\u22ba",int:"\u222b",Int:"\u222c",integers:"\u2124",Integral:"\u222b",intercal:"\u22ba",Intersection:"\u22c2",intlarhk:"\u2a17",intprod:"\u2a3c",InvisibleComma:"\u2063",InvisibleTimes:"\u2062",IOcy:"\u0401",iocy:"\u0451",Iogon:"\u012e",iogon:"\u012f",Iopf:"\ud835\udd40",iopf:"\ud835\udd5a",Iota:"\u0399",iota:"\u03b9",iprod:"\u2a3c",iquest:"\xbf",iscr:"\ud835\udcbe",Iscr:"\u2110",isin:"\u2208",isindot:"\u22f5",isinE:"\u22f9",isins:"\u22f4",isinsv:"\u22f3",isinv:"\u2208",it:"\u2062",Itilde:"\u0128",itilde:"\u0129",Iukcy:"\u0406",iukcy:"\u0456",Iuml:"\xcf",iuml:"\xef",Jcirc:"\u0134",jcirc:"\u0135",Jcy:"\u0419",jcy:"\u0439",Jfr:"\ud835\udd0d",jfr:"\ud835\udd27",jmath:"\u0237",Jopf:"\ud835\udd41",jopf:"\ud835\udd5b",Jscr:"\ud835\udca5",jscr:"\ud835\udcbf",Jsercy:"\u0408",jsercy:"\u0458",Jukcy:"\u0404",jukcy:"\u0454",Kappa:"\u039a",kappa:"\u03ba",kappav:"\u03f0",Kcedil:"\u0136",kcedil:"\u0137",Kcy:"\u041a",kcy:"\u043a",Kfr:"\ud835\udd0e",kfr:"\ud835\udd28",kgreen:"\u0138",KHcy:"\u0425",khcy:"\u0445",KJcy:"\u040c",kjcy:"\u045c",Kopf:"\ud835\udd42",kopf:"\ud835\udd5c",Kscr:"\ud835\udca6",kscr:"\ud835\udcc0",lAarr:"\u21da",Lacute:"\u0139",lacute:"\u013a",laemptyv:"\u29b4",lagran:"\u2112",Lambda:"\u039b",lambda:"\u03bb",lang:"\u27e8",Lang:"\u27ea",langd:"\u2991",langle:"\u27e8",lap:"\u2a85",Laplacetrf:"\u2112",laquo:"\xab",larrb:"\u21e4",larrbfs:"\u291f",larr:"\u2190",Larr:"\u219e",lArr:"\u21d0",larrfs:"\u291d",larrhk:"\u21a9",larrlp:"\u21ab",larrpl:"\u2939",larrsim:"\u2973",larrtl:"\u21a2",latail:"\u2919",lAtail:"\u291b",lat:"\u2aab",late:"\u2aad",lates:"\u2aad\ufe00",lbarr:"\u290c",lBarr:"\u290e",lbbrk:"\u2772",lbrace:"{",lbrack:"[",lbrke:"\u298b",lbrksld:"\u298f",lbrkslu:"\u298d",Lcaron:"\u013d",lcaron:"\u013e",Lcedil:"\u013b",lcedil:"\u013c",lceil:"\u2308",lcub:"{",Lcy:"\u041b",lcy:"\u043b",ldca:"\u2936",ldquo:"\u201c",ldquor:"\u201e",ldrdhar:"\u2967",ldrushar:"\u294b",ldsh:"\u21b2",le:"\u2264",lE:"\u2266",LeftAngleBracket:"\u27e8",LeftArrowBar:"\u21e4",leftarrow:"\u2190",LeftArrow:"\u2190",Leftarrow:"\u21d0",LeftArrowRightArrow:"\u21c6",leftarrowtail:"\u21a2",LeftCeiling:"\u2308",LeftDoubleBracket:"\u27e6",LeftDownTeeVector:"\u2961",LeftDownVectorBar:"\u2959",LeftDownVector:"\u21c3",LeftFloor:"\u230a",leftharpoondown:"\u21bd",leftharpoonup:"\u21bc",leftleftarrows:"\u21c7",leftrightarrow:"\u2194",LeftRightArrow:"\u2194",Leftrightarrow:"\u21d4",leftrightarrows:"\u21c6",leftrightharpoons:"\u21cb",leftrightsquigarrow:"\u21ad",LeftRightVector:"\u294e",LeftTeeArrow:"\u21a4",LeftTee:"\u22a3",LeftTeeVector:"\u295a",leftthreetimes:"\u22cb",LeftTriangleBar:"\u29cf",LeftTriangle:"\u22b2",LeftTriangleEqual:"\u22b4",LeftUpDownVector:"\u2951",LeftUpTeeVector:"\u2960",LeftUpVectorBar:"\u2958",LeftUpVector:"\u21bf",LeftVectorBar:"\u2952",LeftVector:"\u21bc",lEg:"\u2a8b",leg:"\u22da",leq:"\u2264",leqq:"\u2266",leqslant:"\u2a7d",lescc:"\u2aa8",les:"\u2a7d",lesdot:"\u2a7f",lesdoto:"\u2a81",lesdotor:"\u2a83",lesg:"\u22da\ufe00",lesges:"\u2a93",lessapprox:"\u2a85",lessdot:"\u22d6",lesseqgtr:"\u22da",lesseqqgtr:"\u2a8b",LessEqualGreater:"\u22da",LessFullEqual:"\u2266",LessGreater:"\u2276",lessgtr:"\u2276",LessLess:"\u2aa1",lesssim:"\u2272",LessSlantEqual:"\u2a7d",LessTilde:"\u2272",lfisht:"\u297c",lfloor:"\u230a",Lfr:"\ud835\udd0f",lfr:"\ud835\udd29",lg:"\u2276",lgE:"\u2a91",lHar:"\u2962",lhard:"\u21bd",lharu:"\u21bc",lharul:"\u296a",lhblk:"\u2584",LJcy:"\u0409",ljcy:"\u0459",llarr:"\u21c7",ll:"\u226a",Ll:"\u22d8",llcorner:"\u231e",Lleftarrow:"\u21da",llhard:"\u296b",lltri:"\u25fa",Lmidot:"\u013f",lmidot:"\u0140",lmoustache:"\u23b0",lmoust:"\u23b0",lnap:"\u2a89",lnapprox:"\u2a89",lne:"\u2a87",lnE:"\u2268",lneq:"\u2a87",lneqq:"\u2268",lnsim:"\u22e6",loang:"\u27ec",loarr:"\u21fd",lobrk:"\u27e6",longleftarrow:"\u27f5",LongLeftArrow:"\u27f5",Longleftarrow:"\u27f8",longleftrightarrow:"\u27f7",LongLeftRightArrow:"\u27f7",Longleftrightarrow:"\u27fa",longmapsto:"\u27fc",longrightarrow:"\u27f6",LongRightArrow:"\u27f6",Longrightarrow:"\u27f9",looparrowleft:"\u21ab",looparrowright:"\u21ac",lopar:"\u2985",Lopf:"\ud835\udd43",lopf:"\ud835\udd5d",loplus:"\u2a2d",lotimes:"\u2a34",lowast:"\u2217",lowbar:"_",LowerLeftArrow:"\u2199",LowerRightArrow:"\u2198",loz:"\u25ca",lozenge:"\u25ca",lozf:"\u29eb",lpar:"(",lparlt:"\u2993",lrarr:"\u21c6",lrcorner:"\u231f",lrhar:"\u21cb",lrhard:"\u296d",lrm:"\u200e",lrtri:"\u22bf",lsaquo:"\u2039",lscr:"\ud835\udcc1",Lscr:"\u2112",lsh:"\u21b0",Lsh:"\u21b0",lsim:"\u2272",lsime:"\u2a8d",lsimg:"\u2a8f",lsqb:"[",lsquo:"\u2018",lsquor:"\u201a",Lstrok:"\u0141",lstrok:"\u0142",ltcc:"\u2aa6",ltcir:"\u2a79",lt:"<",LT:"<",Lt:"\u226a",ltdot:"\u22d6",lthree:"\u22cb",ltimes:"\u22c9",ltlarr:"\u2976",ltquest:"\u2a7b",ltri:"\u25c3",ltrie:"\u22b4",ltrif:"\u25c2",ltrPar:"\u2996",lurdshar:"\u294a",luruhar:"\u2966",lvertneqq:"\u2268\ufe00",lvnE:"\u2268\ufe00",macr:"\xaf",male:"\u2642",malt:"\u2720",maltese:"\u2720",Map:"\u2905",map:"\u21a6",mapsto:"\u21a6",mapstodown:"\u21a7",mapstoleft:"\u21a4",mapstoup:"\u21a5",marker:"\u25ae",mcomma:"\u2a29",Mcy:"\u041c",mcy:"\u043c",mdash:"\u2014",mDDot:"\u223a",measuredangle:"\u2221",MediumSpace:"\u205f",Mellintrf:"\u2133",Mfr:"\ud835\udd10",mfr:"\ud835\udd2a",mho:"\u2127",micro:"\xb5",midast:"*",midcir:"\u2af0",mid:"\u2223",middot:"\xb7",minusb:"\u229f",minus:"\u2212",minusd:"\u2238",minusdu:"\u2a2a",MinusPlus:"\u2213",mlcp:"\u2adb",mldr:"\u2026",mnplus:"\u2213",models:"\u22a7",Mopf:"\ud835\udd44",mopf:"\ud835\udd5e",mp:"\u2213",mscr:"\ud835\udcc2",Mscr:"\u2133",mstpos:"\u223e",Mu:"\u039c",mu:"\u03bc",multimap:"\u22b8",mumap:"\u22b8",nabla:"\u2207",Nacute:"\u0143",nacute:"\u0144",nang:"\u2220\u20d2",nap:"\u2249",napE:"\u2a70\u0338",napid:"\u224b\u0338",napos:"\u0149",napprox:"\u2249",natural:"\u266e",naturals:"\u2115",natur:"\u266e",nbsp:"\xa0",nbump:"\u224e\u0338",nbumpe:"\u224f\u0338",ncap:"\u2a43",Ncaron:"\u0147",ncaron:"\u0148",Ncedil:"\u0145",ncedil:"\u0146",ncong:"\u2247",ncongdot:"\u2a6d\u0338",ncup:"\u2a42",Ncy:"\u041d",ncy:"\u043d",ndash:"\u2013",nearhk:"\u2924",nearr:"\u2197",neArr:"\u21d7",nearrow:"\u2197",ne:"\u2260",nedot:"\u2250\u0338",NegativeMediumSpace:"\u200b",NegativeThickSpace:"\u200b",NegativeThinSpace:"\u200b",NegativeVeryThinSpace:"\u200b",nequiv:"\u2262",nesear:"\u2928",nesim:"\u2242\u0338",NestedGreaterGreater:"\u226b",NestedLessLess:"\u226a",NewLine:"\n",nexist:"\u2204",nexists:"\u2204",Nfr:"\ud835\udd11",nfr:"\ud835\udd2b",ngE:"\u2267\u0338",nge:"\u2271",ngeq:"\u2271",ngeqq:"\u2267\u0338",ngeqslant:"\u2a7e\u0338",nges:"\u2a7e\u0338",nGg:"\u22d9\u0338",ngsim:"\u2275",nGt:"\u226b\u20d2",ngt:"\u226f",ngtr:"\u226f",nGtv:"\u226b\u0338",nharr:"\u21ae",nhArr:"\u21ce",nhpar:"\u2af2",ni:"\u220b",nis:"\u22fc",nisd:"\u22fa",niv:"\u220b",NJcy:"\u040a",njcy:"\u045a",nlarr:"\u219a",nlArr:"\u21cd",nldr:"\u2025",nlE:"\u2266\u0338",nle:"\u2270",nleftarrow:"\u219a",nLeftarrow:"\u21cd",nleftrightarrow:"\u21ae",nLeftrightarrow:"\u21ce",nleq:"\u2270",nleqq:"\u2266\u0338",nleqslant:"\u2a7d\u0338",nles:"\u2a7d\u0338",nless:"\u226e",nLl:"\u22d8\u0338",nlsim:"\u2274",nLt:"\u226a\u20d2",nlt:"\u226e",nltri:"\u22ea",nltrie:"\u22ec",nLtv:"\u226a\u0338",nmid:"\u2224",NoBreak:"\u2060",NonBreakingSpace:"\xa0",nopf:"\ud835\udd5f",Nopf:"\u2115",Not:"\u2aec",not:"\xac",NotCongruent:"\u2262",NotCupCap:"\u226d",NotDoubleVerticalBar:"\u2226",NotElement:"\u2209",NotEqual:"\u2260",NotEqualTilde:"\u2242\u0338",NotExists:"\u2204",NotGreater:"\u226f",NotGreaterEqual:"\u2271",NotGreaterFullEqual:"\u2267\u0338",NotGreaterGreater:"\u226b\u0338",NotGreaterLess:"\u2279",NotGreaterSlantEqual:"\u2a7e\u0338",NotGreaterTilde:"\u2275",NotHumpDownHump:"\u224e\u0338",NotHumpEqual:"\u224f\u0338",notin:"\u2209",notindot:"\u22f5\u0338",notinE:"\u22f9\u0338",notinva:"\u2209",notinvb:"\u22f7",notinvc:"\u22f6",NotLeftTriangleBar:"\u29cf\u0338",NotLeftTriangle:"\u22ea",NotLeftTriangleEqual:"\u22ec",NotLess:"\u226e",NotLessEqual:"\u2270",NotLessGreater:"\u2278",NotLessLess:"\u226a\u0338",NotLessSlantEqual:"\u2a7d\u0338",NotLessTilde:"\u2274",NotNestedGreaterGreater:"\u2aa2\u0338",NotNestedLessLess:"\u2aa1\u0338",notni:"\u220c",notniva:"\u220c",notnivb:"\u22fe",notnivc:"\u22fd",NotPrecedes:"\u2280",NotPrecedesEqual:"\u2aaf\u0338",NotPrecedesSlantEqual:"\u22e0",NotReverseElement:"\u220c",NotRightTriangleBar:"\u29d0\u0338",NotRightTriangle:"\u22eb",NotRightTriangleEqual:"\u22ed",NotSquareSubset:"\u228f\u0338",NotSquareSubsetEqual:"\u22e2",NotSquareSuperset:"\u2290\u0338",NotSquareSupersetEqual:"\u22e3",NotSubset:"\u2282\u20d2",NotSubsetEqual:"\u2288",NotSucceeds:"\u2281",NotSucceedsEqual:"\u2ab0\u0338",NotSucceedsSlantEqual:"\u22e1",NotSucceedsTilde:"\u227f\u0338",NotSuperset:"\u2283\u20d2",NotSupersetEqual:"\u2289",NotTilde:"\u2241",NotTildeEqual:"\u2244",NotTildeFullEqual:"\u2247",NotTildeTilde:"\u2249",NotVerticalBar:"\u2224",nparallel:"\u2226",npar:"\u2226",nparsl:"\u2afd\u20e5",npart:"\u2202\u0338",npolint:"\u2a14",npr:"\u2280",nprcue:"\u22e0",nprec:"\u2280",npreceq:"\u2aaf\u0338",npre:"\u2aaf\u0338",nrarrc:"\u2933\u0338",nrarr:"\u219b",nrArr:"\u21cf",nrarrw:"\u219d\u0338",nrightarrow:"\u219b",nRightarrow:"\u21cf",nrtri:"\u22eb",nrtrie:"\u22ed",nsc:"\u2281",nsccue:"\u22e1",nsce:"\u2ab0\u0338",Nscr:"\ud835\udca9",nscr:"\ud835\udcc3",nshortmid:"\u2224",nshortparallel:"\u2226",nsim:"\u2241",nsime:"\u2244",nsimeq:"\u2244",nsmid:"\u2224",nspar:"\u2226",nsqsube:"\u22e2",nsqsupe:"\u22e3",nsub:"\u2284",nsubE:"\u2ac5\u0338",nsube:"\u2288",nsubset:"\u2282\u20d2",nsubseteq:"\u2288",nsubseteqq:"\u2ac5\u0338",nsucc:"\u2281",nsucceq:"\u2ab0\u0338",nsup:"\u2285",nsupE:"\u2ac6\u0338",nsupe:"\u2289",nsupset:"\u2283\u20d2",nsupseteq:"\u2289",nsupseteqq:"\u2ac6\u0338",ntgl:"\u2279",Ntilde:"\xd1",ntilde:"\xf1",ntlg:"\u2278",ntriangleleft:"\u22ea",ntrianglelefteq:"\u22ec",ntriangleright:"\u22eb",ntrianglerighteq:"\u22ed",Nu:"\u039d",nu:"\u03bd",num:"#",numero:"\u2116",numsp:"\u2007",nvap:"\u224d\u20d2",nvdash:"\u22ac",nvDash:"\u22ad",nVdash:"\u22ae",nVDash:"\u22af",nvge:"\u2265\u20d2",nvgt:">\u20d2",nvHarr:"\u2904",nvinfin:"\u29de",nvlArr:"\u2902",nvle:"\u2264\u20d2",nvlt:"<\u20d2",nvltrie:"\u22b4\u20d2",nvrArr:"\u2903",nvrtrie:"\u22b5\u20d2",nvsim:"\u223c\u20d2",nwarhk:"\u2923",nwarr:"\u2196",nwArr:"\u21d6",nwarrow:"\u2196",nwnear:"\u2927",Oacute:"\xd3",oacute:"\xf3",oast:"\u229b",Ocirc:"\xd4",ocirc:"\xf4",ocir:"\u229a",Ocy:"\u041e",ocy:"\u043e",odash:"\u229d",Odblac:"\u0150",odblac:"\u0151",odiv:"\u2a38",odot:"\u2299",odsold:"\u29bc",OElig:"\u0152",oelig:"\u0153",ofcir:"\u29bf",Ofr:"\ud835\udd12",ofr:"\ud835\udd2c",ogon:"\u02db",Ograve:"\xd2",ograve:"\xf2",ogt:"\u29c1",ohbar:"\u29b5",ohm:"\u03a9",oint:"\u222e",olarr:"\u21ba",olcir:"\u29be",olcross:"\u29bb",oline:"\u203e",olt:"\u29c0",Omacr:"\u014c",omacr:"\u014d",Omega:"\u03a9",omega:"\u03c9",Omicron:"\u039f",omicron:"\u03bf",omid:"\u29b6",ominus:"\u2296",Oopf:"\ud835\udd46",oopf:"\ud835\udd60",opar:"\u29b7",OpenCurlyDoubleQuote:"\u201c",OpenCurlyQuote:"\u2018",operp:"\u29b9",oplus:"\u2295",orarr:"\u21bb",Or:"\u2a54",or:"\u2228",ord:"\u2a5d",order:"\u2134",orderof:"\u2134",ordf:"\xaa",ordm:"\xba",origof:"\u22b6",oror:"\u2a56",orslope:"\u2a57",orv:"\u2a5b",oS:"\u24c8",Oscr:"\ud835\udcaa",oscr:"\u2134",Oslash:"\xd8",oslash:"\xf8",osol:"\u2298",Otilde:"\xd5",otilde:"\xf5",otimesas:"\u2a36",Otimes:"\u2a37",otimes:"\u2297",Ouml:"\xd6",ouml:"\xf6",ovbar:"\u233d",OverBar:"\u203e",OverBrace:"\u23de",OverBracket:"\u23b4",OverParenthesis:"\u23dc",para:"\xb6",parallel:"\u2225",par:"\u2225",parsim:"\u2af3",parsl:"\u2afd",part:"\u2202",PartialD:"\u2202",Pcy:"\u041f",pcy:"\u043f",percnt:"%",period:".",permil:"\u2030",perp:"\u22a5",pertenk:"\u2031",Pfr:"\ud835\udd13",pfr:"\ud835\udd2d",Phi:"\u03a6",phi:"\u03c6",phiv:"\u03d5",phmmat:"\u2133",phone:"\u260e",Pi:"\u03a0",pi:"\u03c0",pitchfork:"\u22d4",piv:"\u03d6",planck:"\u210f",planckh:"\u210e",plankv:"\u210f",plusacir:"\u2a23",plusb:"\u229e",pluscir:"\u2a22",plus:"+",plusdo:"\u2214",plusdu:"\u2a25",pluse:"\u2a72",PlusMinus:"\xb1",plusmn:"\xb1",plussim:"\u2a26",plustwo:"\u2a27",pm:"\xb1",Poincareplane:"\u210c",pointint:"\u2a15",popf:"\ud835\udd61",Popf:"\u2119",pound:"\xa3",prap:"\u2ab7",Pr:"\u2abb",pr:"\u227a",prcue:"\u227c",precapprox:"\u2ab7",prec:"\u227a",preccurlyeq:"\u227c",Precedes:"\u227a",PrecedesEqual:"\u2aaf",PrecedesSlantEqual:"\u227c",PrecedesTilde:"\u227e",preceq:"\u2aaf",precnapprox:"\u2ab9",precneqq:"\u2ab5",precnsim:"\u22e8",pre:"\u2aaf",prE:"\u2ab3",precsim:"\u227e",prime:"\u2032",Prime:"\u2033",primes:"\u2119",prnap:"\u2ab9",prnE:"\u2ab5",prnsim:"\u22e8",prod:"\u220f",Product:"\u220f",profalar:"\u232e",profline:"\u2312",profsurf:"\u2313",prop:"\u221d",Proportional:"\u221d",Proportion:"\u2237",propto:"\u221d",prsim:"\u227e",prurel:"\u22b0",Pscr:"\ud835\udcab",pscr:"\ud835\udcc5",Psi:"\u03a8",psi:"\u03c8",puncsp:"\u2008",Qfr:"\ud835\udd14",qfr:"\ud835\udd2e",qint:"\u2a0c",qopf:"\ud835\udd62",Qopf:"\u211a",qprime:"\u2057",Qscr:"\ud835\udcac",qscr:"\ud835\udcc6",quaternions:"\u210d",quatint:"\u2a16",quest:"?",questeq:"\u225f",quot:'"',QUOT:'"',rAarr:"\u21db",race:"\u223d\u0331",Racute:"\u0154",racute:"\u0155",radic:"\u221a",raemptyv:"\u29b3",rang:"\u27e9",Rang:"\u27eb",rangd:"\u2992",range:"\u29a5",rangle:"\u27e9",raquo:"\xbb",rarrap:"\u2975",rarrb:"\u21e5",rarrbfs:"\u2920",rarrc:"\u2933",rarr:"\u2192",Rarr:"\u21a0",rArr:"\u21d2",rarrfs:"\u291e",rarrhk:"\u21aa",rarrlp:"\u21ac",rarrpl:"\u2945",rarrsim:"\u2974",Rarrtl:"\u2916",rarrtl:"\u21a3",rarrw:"\u219d",ratail:"\u291a",rAtail:"\u291c",ratio:"\u2236",rationals:"\u211a",rbarr:"\u290d",rBarr:"\u290f",RBarr:"\u2910",rbbrk:"\u2773",rbrace:"}",rbrack:"]",rbrke:"\u298c",rbrksld:"\u298e",rbrkslu:"\u2990",Rcaron:"\u0158",rcaron:"\u0159",Rcedil:"\u0156",rcedil:"\u0157",rceil:"\u2309",rcub:"}",Rcy:"\u0420",rcy:"\u0440",rdca:"\u2937",rdldhar:"\u2969",rdquo:"\u201d",rdquor:"\u201d",rdsh:"\u21b3",real:"\u211c",realine:"\u211b",realpart:"\u211c",reals:"\u211d",Re:"\u211c",rect:"\u25ad",reg:"\xae",REG:"\xae",ReverseElement:"\u220b",ReverseEquilibrium:"\u21cb",ReverseUpEquilibrium:"\u296f",rfisht:"\u297d",rfloor:"\u230b",rfr:"\ud835\udd2f",Rfr:"\u211c",rHar:"\u2964",rhard:"\u21c1",rharu:"\u21c0",rharul:"\u296c",Rho:"\u03a1",rho:"\u03c1",rhov:"\u03f1",RightAngleBracket:"\u27e9",RightArrowBar:"\u21e5",rightarrow:"\u2192",RightArrow:"\u2192",Rightarrow:"\u21d2",RightArrowLeftArrow:"\u21c4",rightarrowtail:"\u21a3",RightCeiling:"\u2309",RightDoubleBracket:"\u27e7",RightDownTeeVector:"\u295d",RightDownVectorBar:"\u2955",RightDownVector:"\u21c2",RightFloor:"\u230b",rightharpoondown:"\u21c1",rightharpoonup:"\u21c0",rightleftarrows:"\u21c4",rightleftharpoons:"\u21cc",rightrightarrows:"\u21c9",rightsquigarrow:"\u219d",RightTeeArrow:"\u21a6",RightTee:"\u22a2",RightTeeVector:"\u295b",rightthreetimes:"\u22cc",RightTriangleBar:"\u29d0",RightTriangle:"\u22b3",RightTriangleEqual:"\u22b5",RightUpDownVector:"\u294f",RightUpTeeVector:"\u295c",RightUpVectorBar:"\u2954",RightUpVector:"\u21be",RightVectorBar:"\u2953",RightVector:"\u21c0",ring:"\u02da",risingdotseq:"\u2253",rlarr:"\u21c4",rlhar:"\u21cc",rlm:"\u200f",rmoustache:"\u23b1",rmoust:"\u23b1",rnmid:"\u2aee",roang:"\u27ed",roarr:"\u21fe",robrk:"\u27e7",ropar:"\u2986",ropf:"\ud835\udd63",Ropf:"\u211d",roplus:"\u2a2e",rotimes:"\u2a35",RoundImplies:"\u2970",rpar:")",rpargt:"\u2994",rppolint:"\u2a12",rrarr:"\u21c9",Rrightarrow:"\u21db",rsaquo:"\u203a",rscr:"\ud835\udcc7",Rscr:"\u211b",rsh:"\u21b1",Rsh:"\u21b1",rsqb:"]",rsquo:"\u2019",rsquor:"\u2019",rthree:"\u22cc",rtimes:"\u22ca",rtri:"\u25b9",rtrie:"\u22b5",rtrif:"\u25b8",rtriltri:"\u29ce",RuleDelayed:"\u29f4",ruluhar:"\u2968",rx:"\u211e",Sacute:"\u015a",sacute:"\u015b",sbquo:"\u201a",scap:"\u2ab8",Scaron:"\u0160",scaron:"\u0161",Sc:"\u2abc",sc:"\u227b",sccue:"\u227d",sce:"\u2ab0",scE:"\u2ab4",Scedil:"\u015e",scedil:"\u015f",Scirc:"\u015c",scirc:"\u015d",scnap:"\u2aba",scnE:"\u2ab6",scnsim:"\u22e9",scpolint:"\u2a13",scsim:"\u227f",Scy:"\u0421",scy:"\u0441",sdotb:"\u22a1",sdot:"\u22c5",sdote:"\u2a66",searhk:"\u2925",searr:"\u2198",seArr:"\u21d8",searrow:"\u2198",sect:"\xa7",semi:";",seswar:"\u2929",setminus:"\u2216",setmn:"\u2216",sext:"\u2736",Sfr:"\ud835\udd16",sfr:"\ud835\udd30",sfrown:"\u2322",sharp:"\u266f",SHCHcy:"\u0429",shchcy:"\u0449",SHcy:"\u0428",shcy:"\u0448",ShortDownArrow:"\u2193",ShortLeftArrow:"\u2190",shortmid:"\u2223",shortparallel:"\u2225",ShortRightArrow:"\u2192",ShortUpArrow:"\u2191",shy:"\xad",Sigma:"\u03a3",sigma:"\u03c3",sigmaf:"\u03c2",sigmav:"\u03c2",sim:"\u223c",simdot:"\u2a6a",sime:"\u2243",simeq:"\u2243",simg:"\u2a9e",simgE:"\u2aa0",siml:"\u2a9d",simlE:"\u2a9f",simne:"\u2246",simplus:"\u2a24",simrarr:"\u2972",slarr:"\u2190",SmallCircle:"\u2218",smallsetminus:"\u2216",smashp:"\u2a33",smeparsl:"\u29e4",smid:"\u2223",smile:"\u2323",smt:"\u2aaa",smte:"\u2aac",smtes:"\u2aac\ufe00",SOFTcy:"\u042c",softcy:"\u044c",solbar:"\u233f",solb:"\u29c4",sol:"/",Sopf:"\ud835\udd4a",sopf:"\ud835\udd64",spades:"\u2660",spadesuit:"\u2660",spar:"\u2225",sqcap:"\u2293",sqcaps:"\u2293\ufe00",sqcup:"\u2294",sqcups:"\u2294\ufe00",Sqrt:"\u221a",sqsub:"\u228f",sqsube:"\u2291",sqsubset:"\u228f",sqsubseteq:"\u2291",sqsup:"\u2290",sqsupe:"\u2292",sqsupset:"\u2290",sqsupseteq:"\u2292",square:"\u25a1",Square:"\u25a1",SquareIntersection:"\u2293",SquareSubset:"\u228f",SquareSubsetEqual:"\u2291",SquareSuperset:"\u2290",SquareSupersetEqual:"\u2292",SquareUnion:"\u2294",squarf:"\u25aa",squ:"\u25a1",squf:"\u25aa",srarr:"\u2192",Sscr:"\ud835\udcae",sscr:"\ud835\udcc8",ssetmn:"\u2216",ssmile:"\u2323",sstarf:"\u22c6",Star:"\u22c6",star:"\u2606",starf:"\u2605",straightepsilon:"\u03f5",straightphi:"\u03d5",strns:"\xaf",sub:"\u2282",Sub:"\u22d0",subdot:"\u2abd",subE:"\u2ac5",sube:"\u2286",subedot:"\u2ac3",submult:"\u2ac1",subnE:"\u2acb",subne:"\u228a",subplus:"\u2abf",subrarr:"\u2979",subset:"\u2282",Subset:"\u22d0",subseteq:"\u2286",subseteqq:"\u2ac5",SubsetEqual:"\u2286",subsetneq:"\u228a",subsetneqq:"\u2acb",subsim:"\u2ac7",subsub:"\u2ad5",subsup:"\u2ad3",succapprox:"\u2ab8",succ:"\u227b",succcurlyeq:"\u227d",Succeeds:"\u227b",SucceedsEqual:"\u2ab0",SucceedsSlantEqual:"\u227d",SucceedsTilde:"\u227f",succeq:"\u2ab0",succnapprox:"\u2aba",succneqq:"\u2ab6",succnsim:"\u22e9",succsim:"\u227f",SuchThat:"\u220b",sum:"\u2211",Sum:"\u2211",sung:"\u266a",sup1:"\xb9",sup2:"\xb2",sup3:"\xb3",sup:"\u2283",Sup:"\u22d1",supdot:"\u2abe",supdsub:"\u2ad8",supE:"\u2ac6",supe:"\u2287",supedot:"\u2ac4",Superset:"\u2283",SupersetEqual:"\u2287",suphsol:"\u27c9",suphsub:"\u2ad7",suplarr:"\u297b",supmult:"\u2ac2",supnE:"\u2acc",supne:"\u228b",supplus:"\u2ac0",supset:"\u2283",Supset:"\u22d1",supseteq:"\u2287",supseteqq:"\u2ac6",supsetneq:"\u228b",supsetneqq:"\u2acc",supsim:"\u2ac8",supsub:"\u2ad4",supsup:"\u2ad6",swarhk:"\u2926",swarr:"\u2199",swArr:"\u21d9",swarrow:"\u2199",swnwar:"\u292a",szlig:"\xdf",Tab:"\t",target:"\u2316",Tau:"\u03a4",tau:"\u03c4",tbrk:"\u23b4",Tcaron:"\u0164",tcaron:"\u0165",Tcedil:"\u0162",tcedil:"\u0163",Tcy:"\u0422",tcy:"\u0442",tdot:"\u20db",telrec:"\u2315",Tfr:"\ud835\udd17",tfr:"\ud835\udd31",there4:"\u2234",therefore:"\u2234",Therefore:"\u2234",Theta:"\u0398",theta:"\u03b8",thetasym:"\u03d1",thetav:"\u03d1",thickapprox:"\u2248",thicksim:"\u223c",ThickSpace:"\u205f\u200a",ThinSpace:"\u2009",thinsp:"\u2009",thkap:"\u2248",thksim:"\u223c",THORN:"\xde",thorn:"\xfe",tilde:"\u02dc",Tilde:"\u223c",TildeEqual:"\u2243",TildeFullEqual:"\u2245",TildeTilde:"\u2248",timesbar:"\u2a31",timesb:"\u22a0",times:"\xd7",timesd:"\u2a30",tint:"\u222d",toea:"\u2928",topbot:"\u2336",topcir:"\u2af1",top:"\u22a4",Topf:"\ud835\udd4b",topf:"\ud835\udd65",topfork:"\u2ada",tosa:"\u2929",tprime:"\u2034",trade:"\u2122",TRADE:"\u2122",triangle:"\u25b5",triangledown:"\u25bf",triangleleft:"\u25c3",trianglelefteq:"\u22b4",triangleq:"\u225c",triangleright:"\u25b9",trianglerighteq:"\u22b5",tridot:"\u25ec",trie:"\u225c",triminus:"\u2a3a",TripleDot:"\u20db",triplus:"\u2a39",trisb:"\u29cd",tritime:"\u2a3b",trpezium:"\u23e2",Tscr:"\ud835\udcaf",tscr:"\ud835\udcc9",TScy:"\u0426",tscy:"\u0446",TSHcy:"\u040b",tshcy:"\u045b",Tstrok:"\u0166",tstrok:"\u0167",twixt:"\u226c",twoheadleftarrow:"\u219e",twoheadrightarrow:"\u21a0",Uacute:"\xda",uacute:"\xfa",uarr:"\u2191",Uarr:"\u219f",uArr:"\u21d1",Uarrocir:"\u2949",Ubrcy:"\u040e",ubrcy:"\u045e",Ubreve:"\u016c",ubreve:"\u016d",Ucirc:"\xdb",ucirc:"\xfb",Ucy:"\u0423",ucy:"\u0443",udarr:"\u21c5",Udblac:"\u0170",udblac:"\u0171",udhar:"\u296e",ufisht:"\u297e",Ufr:"\ud835\udd18",ufr:"\ud835\udd32",Ugrave:"\xd9",ugrave:"\xf9",uHar:"\u2963",uharl:"\u21bf",uharr:"\u21be",uhblk:"\u2580",ulcorn:"\u231c",ulcorner:"\u231c",ulcrop:"\u230f",ultri:"\u25f8",Umacr:"\u016a",umacr:"\u016b",uml:"\xa8",UnderBar:"_",UnderBrace:"\u23df",UnderBracket:"\u23b5",UnderParenthesis:"\u23dd",Union:"\u22c3",UnionPlus:"\u228e",Uogon:"\u0172",uogon:"\u0173",Uopf:"\ud835\udd4c",uopf:"\ud835\udd66",UpArrowBar:"\u2912",uparrow:"\u2191",UpArrow:"\u2191",Uparrow:"\u21d1",UpArrowDownArrow:"\u21c5",updownarrow:"\u2195",UpDownArrow:"\u2195",Updownarrow:"\u21d5",UpEquilibrium:"\u296e",upharpoonleft:"\u21bf",upharpoonright:"\u21be",uplus:"\u228e",UpperLeftArrow:"\u2196",UpperRightArrow:"\u2197",upsi:"\u03c5",Upsi:"\u03d2",upsih:"\u03d2",Upsilon:"\u03a5",upsilon:"\u03c5",UpTeeArrow:"\u21a5",UpTee:"\u22a5",upuparrows:"\u21c8",urcorn:"\u231d",urcorner:"\u231d",urcrop:"\u230e",Uring:"\u016e",uring:"\u016f",urtri:"\u25f9",Uscr:"\ud835\udcb0",uscr:"\ud835\udcca",utdot:"\u22f0",Utilde:"\u0168",utilde:"\u0169",utri:"\u25b5",utrif:"\u25b4",uuarr:"\u21c8",Uuml:"\xdc",uuml:"\xfc",uwangle:"\u29a7",vangrt:"\u299c",varepsilon:"\u03f5",varkappa:"\u03f0",varnothing:"\u2205",varphi:"\u03d5",varpi:"\u03d6",varpropto:"\u221d",varr:"\u2195",vArr:"\u21d5",varrho:"\u03f1",varsigma:"\u03c2",varsubsetneq:"\u228a\ufe00",varsubsetneqq:"\u2acb\ufe00",varsupsetneq:"\u228b\ufe00",varsupsetneqq:"\u2acc\ufe00",vartheta:"\u03d1",vartriangleleft:"\u22b2",vartriangleright:"\u22b3",vBar:"\u2ae8",Vbar:"\u2aeb",vBarv:"\u2ae9",Vcy:"\u0412",vcy:"\u0432",vdash:"\u22a2",vDash:"\u22a8",Vdash:"\u22a9",VDash:"\u22ab",Vdashl:"\u2ae6",veebar:"\u22bb",vee:"\u2228",Vee:"\u22c1",veeeq:"\u225a",vellip:"\u22ee",verbar:"|",Verbar:"\u2016",vert:"|",Vert:"\u2016",VerticalBar:"\u2223",VerticalLine:"|",VerticalSeparator:"\u2758",VerticalTilde:"\u2240",VeryThinSpace:"\u200a",Vfr:"\ud835\udd19",vfr:"\ud835\udd33",vltri:"\u22b2",vnsub:"\u2282\u20d2",vnsup:"\u2283\u20d2",Vopf:"\ud835\udd4d",vopf:"\ud835\udd67",vprop:"\u221d",vrtri:"\u22b3",Vscr:"\ud835\udcb1",vscr:"\ud835\udccb",vsubnE:"\u2acb\ufe00",vsubne:"\u228a\ufe00",vsupnE:"\u2acc\ufe00",vsupne:"\u228b\ufe00",Vvdash:"\u22aa",vzigzag:"\u299a",Wcirc:"\u0174",wcirc:"\u0175",wedbar:"\u2a5f",wedge:"\u2227",Wedge:"\u22c0",wedgeq:"\u2259",weierp:"\u2118",Wfr:"\ud835\udd1a",wfr:"\ud835\udd34",Wopf:"\ud835\udd4e",wopf:"\ud835\udd68",wp:"\u2118",wr:"\u2240",wreath:"\u2240",Wscr:"\ud835\udcb2",wscr:"\ud835\udccc",xcap:"\u22c2",xcirc:"\u25ef",xcup:"\u22c3",xdtri:"\u25bd",Xfr:"\ud835\udd1b",xfr:"\ud835\udd35",xharr:"\u27f7",xhArr:"\u27fa",Xi:"\u039e",xi:"\u03be",xlarr:"\u27f5",xlArr:"\u27f8",xmap:"\u27fc",xnis:"\u22fb",xodot:"\u2a00",Xopf:"\ud835\udd4f",xopf:"\ud835\udd69",xoplus:"\u2a01",xotime:"\u2a02",xrarr:"\u27f6",xrArr:"\u27f9",Xscr:"\ud835\udcb3",xscr:"\ud835\udccd",xsqcup:"\u2a06",xuplus:"\u2a04",xutri:"\u25b3",xvee:"\u22c1",xwedge:"\u22c0",Yacute:"\xdd",yacute:"\xfd",YAcy:"\u042f",yacy:"\u044f",Ycirc:"\u0176",ycirc:"\u0177",Ycy:"\u042b",ycy:"\u044b",yen:"\xa5",Yfr:"\ud835\udd1c",yfr:"\ud835\udd36",YIcy:"\u0407",yicy:"\u0457",Yopf:"\ud835\udd50",yopf:"\ud835\udd6a",Yscr:"\ud835\udcb4",yscr:"\ud835\udcce",YUcy:"\u042e",yucy:"\u044e",yuml:"\xff",Yuml:"\u0178",Zacute:"\u0179",zacute:"\u017a",Zcaron:"\u017d",zcaron:"\u017e",Zcy:"\u0417",zcy:"\u0437",Zdot:"\u017b",zdot:"\u017c",zeetrf:"\u2128",ZeroWidthSpace:"\u200b",Zeta:"\u0396",zeta:"\u03b6",zfr:"\ud835\udd37",Zfr:"\u2128",ZHcy:"\u0416",zhcy:"\u0436",zigrarr:"\u21dd",zopf:"\ud835\udd6b",Zopf:"\u2124",Zscr:"\ud835\udcb5",zscr:"\ud835\udccf",zwj:"\u200d",zwnj:"\u200c"},t=/[!-#%-\*,-\/:;\?@\[-\]_\{\}\xA1\xA7\xAB\xB6\xB7\xBB\xBF\u037E\u0387\u055A-\u055F\u0589\u058A\u05BE\u05C0\u05C3\u05C6\u05F3\u05F4\u0609\u060A\u060C\u060D\u061B\u061E\u061F\u066A-\u066D\u06D4\u0700-\u070D\u07F7-\u07F9\u0830-\u083E\u085E\u0964\u0965\u0970\u09FD\u0A76\u0AF0\u0C84\u0DF4\u0E4F\u0E5A\u0E5B\u0F04-\u0F12\u0F14\u0F3A-\u0F3D\u0F85\u0FD0-\u0FD4\u0FD9\u0FDA\u104A-\u104F\u10FB\u1360-\u1368\u1400\u166D\u166E\u169B\u169C\u16EB-\u16ED\u1735\u1736\u17D4-\u17D6\u17D8-\u17DA\u1800-\u180A\u1944\u1945\u1A1E\u1A1F\u1AA0-\u1AA6\u1AA8-\u1AAD\u1B5A-\u1B60\u1BFC-\u1BFF\u1C3B-\u1C3F\u1C7E\u1C7F\u1CC0-\u1CC7\u1CD3\u2010-\u2027\u2030-\u2043\u2045-\u2051\u2053-\u205E\u207D\u207E\u208D\u208E\u2308-\u230B\u2329\u232A\u2768-\u2775\u27C5\u27C6\u27E6-\u27EF\u2983-\u2998\u29D8-\u29DB\u29FC\u29FD\u2CF9-\u2CFC\u2CFE\u2CFF\u2D70\u2E00-\u2E2E\u2E30-\u2E4E\u3001-\u3003\u3008-\u3011\u3014-\u301F\u3030\u303D\u30A0\u30FB\uA4FE\uA4FF\uA60D-\uA60F\uA673\uA67E\uA6F2-\uA6F7\uA874-\uA877\uA8CE\uA8CF\uA8F8-\uA8FA\uA8FC\uA92E\uA92F\uA95F\uA9C1-\uA9CD\uA9DE\uA9DF\uAA5C-\uAA5F\uAADE\uAADF\uAAF0\uAAF1\uABEB\uFD3E\uFD3F\uFE10-\uFE19\uFE30-\uFE52\uFE54-\uFE61\uFE63\uFE68\uFE6A\uFE6B\uFF01-\uFF03\uFF05-\uFF0A\uFF0C-\uFF0F\uFF1A\uFF1B\uFF1F\uFF20\uFF3B-\uFF3D\uFF3F\uFF5B\uFF5D\uFF5F-\uFF65]|\uD800[\uDD00-\uDD02\uDF9F\uDFD0]|\uD801\uDD6F|\uD802[\uDC57\uDD1F\uDD3F\uDE50-\uDE58\uDE7F\uDEF0-\uDEF6\uDF39-\uDF3F\uDF99-\uDF9C]|\uD803[\uDF55-\uDF59]|\uD804[\uDC47-\uDC4D\uDCBB\uDCBC\uDCBE-\uDCC1\uDD40-\uDD43\uDD74\uDD75\uDDC5-\uDDC8\uDDCD\uDDDB\uDDDD-\uDDDF\uDE38-\uDE3D\uDEA9]|\uD805[\uDC4B-\uDC4F\uDC5B\uDC5D\uDCC6\uDDC1-\uDDD7\uDE41-\uDE43\uDE60-\uDE6C\uDF3C-\uDF3E]|\uD806[\uDC3B\uDE3F-\uDE46\uDE9A-\uDE9C\uDE9E-\uDEA2]|\uD807[\uDC41-\uDC45\uDC70\uDC71\uDEF7\uDEF8]|\uD809[\uDC70-\uDC74]|\uD81A[\uDE6E\uDE6F\uDEF5\uDF37-\uDF3B\uDF44]|\uD81B[\uDE97-\uDE9A]|\uD82F\uDC9F|\uD836[\uDE87-\uDE8B]|\uD83A[\uDD5E\uDD5F]/,n={};function s(e,r,t){var o,i,a,c,l,u="";for("string"!=typeof r&&(t=r,r=s.defaultChars),void 0===t&&(t=!0),l=function(e){var r,t,s=n[e];if(s)return s;for(s=n[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),/^[0-9a-z]$/i.test(t)?s.push(t):s.push("%"+("0"+r.toString(16).toUpperCase()).slice(-2));for(r=0;r<e.length;r++)s[e.charCodeAt(r)]=e[r];return s}(r),o=0,i=e.length;o<i;o++)if(a=e.charCodeAt(o),t&&37===a&&o+2<i&&/^[0-9a-f]{2}$/i.test(e.slice(o+1,o+3)))u+=e.slice(o,o+3),o+=2;else if(a<128)u+=l[a];else if(a>=55296&&a<=57343){if(a>=55296&&a<=56319&&o+1<i&&(c=e.charCodeAt(o+1))>=56320&&c<=57343){u+=encodeURIComponent(e[o]+e[o+1]),o++;continue}u+="%EF%BF%BD"}else u+=encodeURIComponent(e[o]);return u}s.defaultChars=";/?:@&=+$,-_.!~*'()#",s.componentChars="-_.!~*'()";var o=s,i={};function a(e,r){var t;return"string"!=typeof r&&(r=a.defaultChars),t=function(e){var r,t,n=i[e];if(n)return n;for(n=i[e]=[],r=0;r<128;r++)t=String.fromCharCode(r),n.push(t);for(r=0;r<e.length;r++)n[t=e.charCodeAt(r)]="%"+("0"+t.toString(16).toUpperCase()).slice(-2);return n}(r),e.replace(/(%[a-f0-9]{2})+/gi,(function(e){var r,n,s,o,i,a,c,l="";for(r=0,n=e.length;r<n;r+=3)(s=parseInt(e.slice(r+1,r+3),16))<128?l+=t[s]:192==(224&s)&&r+3<n&&128==(192&(o=parseInt(e.slice(r+4,r+6),16)))?(l+=(c=s<<6&1984|63&o)<128?"\ufffd\ufffd":String.fromCharCode(c),r+=3):224==(240&s)&&r+6<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),128==(192&o)&&128==(192&i))?(l+=(c=s<<12&61440|o<<6&4032|63&i)<2048||c>=55296&&c<=57343?"\ufffd\ufffd\ufffd":String.fromCharCode(c),r+=6):240==(248&s)&&r+9<n&&(o=parseInt(e.slice(r+4,r+6),16),i=parseInt(e.slice(r+7,r+9),16),a=parseInt(e.slice(r+10,r+12),16),128==(192&o)&&128==(192&i)&&128==(192&a))?((c=s<<18&1835008|o<<12&258048|i<<6&4032|63&a)<65536||c>1114111?l+="\ufffd\ufffd\ufffd\ufffd":(c-=65536,l+=String.fromCharCode(55296+(c>>10),56320+(1023&c))),r+=9):l+="\ufffd";return l}))}a.defaultChars=";/?:@&=+$,#",a.componentChars="";var c=a;function l(){this.protocol=null,this.slashes=null,this.auth=null,this.port=null,this.hostname=null,this.hash=null,this.search=null,this.pathname=null}var u=/^([a-z0-9.+-]+:)/i,p=/:[0-9]*$/,h=/^(\/\/?(?!\/)[^\?\s]*)(\?[^\s]*)?$/,f=["{","}","|","\\","^","`"].concat(["<",">",'"',"`"," ","\r","\n","\t"]),d=["'"].concat(f),m=["%","/","?",";","#"].concat(d),g=["/","?","#"],_=/^[+a-z0-9A-Z_-]{0,63}$/,b=/^([+a-z0-9A-Z_-]{0,63})(.*)$/,k={javascript:!0,"javascript:":!0},v={http:!0,https:!0,ftp:!0,gopher:!0,file:!0,"http:":!0,"https:":!0,"ftp:":!0,"gopher:":!0,"file:":!0};l.prototype.parse=function(e,r){var t,n,s,o,i,a=e;if(a=a.trim(),!r&&1===e.split("#").length){var c=h.exec(a);if(c)return this.pathname=c[1],c[2]&&(this.search=c[2]),this}var l=u.exec(a);if(l&&(s=(l=l[0]).toLowerCase(),this.protocol=l,a=a.substr(l.length)),(r||l||a.match(/^\/\/[^@\/]+@[^@\/]+/))&&(!(i="//"===a.substr(0,2))||l&&k[l]||(a=a.substr(2),this.slashes=!0)),!k[l]&&(i||l&&!v[l])){var p,f,d=-1;for(t=0;t<g.length;t++)-1!==(o=a.indexOf(g[t]))&&(-1===d||o<d)&&(d=o);for(-1!==(f=-1===d?a.lastIndexOf("@"):a.lastIndexOf("@",d))&&(p=a.slice(0,f),a=a.slice(f+1),this.auth=p),d=-1,t=0;t<m.length;t++)-1!==(o=a.indexOf(m[t]))&&(-1===d||o<d)&&(d=o);-1===d&&(d=a.length),":"===a[d-1]&&d--;var C=a.slice(0,d);a=a.slice(d),this.parseHost(C),this.hostname=this.hostname||"";var y="["===this.hostname[0]&&"]"===this.hostname[this.hostname.length-1];if(!y){var A=this.hostname.split(/\./);for(t=0,n=A.length;t<n;t++){var x=A[t];if(x&&!x.match(_)){for(var D="",w=0,E=x.length;w<E;w++)x.charCodeAt(w)>127?D+="x":D+=x[w];if(!D.match(_)){var q=A.slice(0,t),S=A.slice(t+1),F=x.match(b);F&&(q.push(F[1]),S.unshift(F[2])),S.length&&(a=S.join(".")+a),this.hostname=q.join(".");break}}}}this.hostname.length>255&&(this.hostname=""),y&&(this.hostname=this.hostname.substr(1,this.hostname.length-2))}var L=a.indexOf("#");-1!==L&&(this.hash=a.substr(L),a=a.slice(0,L));var z=a.indexOf("?");return-1!==z&&(this.search=a.substr(z),a=a.slice(0,z)),a&&(this.pathname=a),v[s]&&this.hostname&&!this.pathname&&(this.pathname=""),this},l.prototype.parseHost=function(e){var r=p.exec(e);r&&(":"!==(r=r[0])&&(this.port=r.substr(1)),e=e.substr(0,e.length-r.length)),e&&(this.hostname=e)};var C={encode:o,decode:c,format:function(e){var r="";return r+=e.protocol||"",r+=e.slashes?"//":"",r+=e.auth?e.auth+"@":"",e.hostname&&-1!==e.hostname.indexOf(":")?r+="["+e.hostname+"]":r+=e.hostname||"",r+=e.port?":"+e.port:"",r+=e.pathname||"",r+=e.search||"",r+=e.hash||""},parse:function(e,r){if(e&&e instanceof l)return e;var t=new l;return t.parse(e,r),t}},y=/[\0-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]/,A=/[\0-\x1F\x7F-\x9F]/,x=/[ \xA0\u1680\u2000-\u200A\u2028\u2029\u202F\u205F\u3000]/,D={Any:y,Cc:A,Cf:/[\xAD\u0600-\u0605\u061C\u06DD\u070F\u08E2\u180E\u200B-\u200F\u202A-\u202E\u2060-\u2064\u2066-\u206F\uFEFF\uFFF9-\uFFFB]|\uD804[\uDCBD\uDCCD]|\uD82F[\uDCA0-\uDCA3]|\uD834[\uDD73-\uDD7A]|\uDB40[\uDC01\uDC20-\uDC7F]/,P:t,Z:x},w=function(e,r,t){return e(t={path:r,exports:{},require:function(e,r){return function(){throw new Error("Dynamic requires are not currently supported by @rollup/plugin-commonjs")}(null==r&&t.path)}},t.exports),t.exports}((function(e,n){var s=Object.prototype.hasOwnProperty;function o(e,r){return s.call(e,r)}function i(e){return!(e>=55296&&e<=57343)&&(!(e>=64976&&e<=65007)&&(65535!=(65535&e)&&65534!=(65535&e)&&(!(e>=0&&e<=8)&&(11!==e&&(!(e>=14&&e<=31)&&(!(e>=127&&e<=159)&&!(e>1114111)))))))}function a(e){if(e>65535){var r=55296+((e-=65536)>>10),t=56320+(1023&e);return String.fromCharCode(r,t)}return String.fromCharCode(e)}var c=/\\([!"#$%&'()*+,\-.\/:;<=>?@[\\\]^_`{|}~])/g,l=new RegExp(c.source+"|"+/&([a-z#][a-z0-9]{1,31});/gi.source,"gi"),u=/^#((?:x[a-f0-9]{1,8}|[0-9]{1,8}))/i;var p=/[&<>"]/,h=/[&<>"]/g,f={"&":"&","<":"<",">":">",'"':"""};function d(e){return f[e]}var m=/[.?*+^$[\]\\(){}|-]/g;n.lib={},n.lib.mdurl=C,n.lib.ucmicro=D,n.assign=function(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){if(r){if("object"!=typeof r)throw new TypeError(r+"must be object");Object.keys(r).forEach((function(t){e[t]=r[t]}))}})),e},n.isString=function(e){return"[object String]"===function(e){return Object.prototype.toString.call(e)}(e)},n.has=o,n.unescapeMd=function(e){return e.indexOf("\\")<0?e:e.replace(c,"$1")},n.unescapeAll=function(e){return e.indexOf("\\")<0&&e.indexOf("&")<0?e:e.replace(l,(function(e,t,n){return t||function(e,t){var n=0;return o(r,t)?r[t]:35===t.charCodeAt(0)&&u.test(t)&&i(n="x"===t[1].toLowerCase()?parseInt(t.slice(2),16):parseInt(t.slice(1),10))?a(n):e}(e,n)}))},n.isValidEntityCode=i,n.fromCodePoint=a,n.escapeHtml=function(e){return p.test(e)?e.replace(h,d):e},n.arrayReplaceAt=function(e,r,t){return[].concat(e.slice(0,r),t,e.slice(r+1))},n.isSpace=function(e){switch(e){case 9:case 32:return!0}return!1},n.isWhiteSpace=function(e){if(e>=8192&&e<=8202)return!0;switch(e){case 9:case 10:case 11:case 12:case 13:case 32:case 160:case 5760:case 8239:case 8287:case 12288:return!0}return!1},n.isMdAsciiPunct=function(e){switch(e){case 33:case 34:case 35:case 36:case 37:case 38:case 39:case 40:case 41:case 42:case 43:case 44:case 45:case 46:case 47:case 58:case 59:case 60:case 61:case 62:case 63:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 124:case 125:case 126:return!0;default:return!1}},n.isPunctChar=function(e){return t.test(e)},n.escapeRE=function(e){return e.replace(m,"\\$&")},n.normalizeReference=function(e){return e=e.trim().replace(/\s+/g," "),"\u1e7e"==="\u1e9e".toLowerCase()&&(e=e.replace(/\u1e9e/g,"\xdf")),e.toLowerCase().toUpperCase()}})),E=w.unescapeAll,q=w.unescapeAll,S={parseLinkLabel:function(e,r,t){var n,s,o,i,a=-1,c=e.posMax,l=e.pos;for(e.pos=r+1,n=1;e.pos<c;){if(93===(o=e.src.charCodeAt(e.pos))&&0===--n){s=!0;break}if(i=e.pos,e.md.inline.skipToken(e),91===o)if(i===e.pos-1)n++;else if(t)return e.pos=l,-1}return s&&(a=e.pos),e.pos=l,a},parseLinkDestination:function(e,r,t){var n,s,o=r,i={ok:!1,pos:0,lines:0,str:""};if(60===e.charCodeAt(r)){for(r++;r<t;){if(10===(n=e.charCodeAt(r)))return i;if(60===n)return i;if(62===n)return i.pos=r+1,i.str=E(e.slice(o+1,r)),i.ok=!0,i;92===n&&r+1<t?r+=2:r++}return i}for(s=0;r<t&&32!==(n=e.charCodeAt(r))&&!(n<32||127===n);)if(92===n&&r+1<t){if(32===e.charCodeAt(r+1))break;r+=2}else{if(40===n&&++s>32)return i;if(41===n){if(0===s)break;s--}r++}return o===r||0!==s||(i.str=E(e.slice(o,r)),i.lines=0,i.pos=r,i.ok=!0),i},parseLinkTitle:function(e,r,t){var n,s,o=0,i=r,a={ok:!1,pos:0,lines:0,str:""};if(r>=t)return a;if(34!==(s=e.charCodeAt(r))&&39!==s&&40!==s)return a;for(r++,40===s&&(s=41);r<t;){if((n=e.charCodeAt(r))===s)return a.pos=r+1,a.lines=o,a.str=q(e.slice(i+1,r)),a.ok=!0,a;if(40===n&&41===s)return a;10===n?o++:92===n&&r+1<t&&(r++,10===e.charCodeAt(r)&&o++),r++}return a}},F=w.assign,L=w.unescapeAll,z=w.escapeHtml,T={};function I(){this.rules=F({},T)}T.code_inline=function(e,r,t,n,s){var o=e[r];return"<code"+s.renderAttrs(o)+">"+z(e[r].content)+"</code>"},T.code_block=function(e,r,t,n,s){var o=e[r];return"<pre"+s.renderAttrs(o)+"><code>"+z(e[r].content)+"</code></pre>\n"},T.fence=function(e,r,t,n,s){var o,i,a,c,l,u=e[r],p=u.info?L(u.info).trim():"",h="",f="";return p&&(h=(a=p.split(/(\s+)/g))[0],f=a.slice(2).join("")),0===(o=t.highlight&&t.highlight(u.content,h,f)||z(u.content)).indexOf("<pre")?o+"\n":p?(i=u.attrIndex("class"),c=u.attrs?u.attrs.slice():[],i<0?c.push(["class",t.langPrefix+h]):(c[i]=c[i].slice(),c[i][1]+=" "+t.langPrefix+h),l={attrs:c},"<pre><code"+s.renderAttrs(l)+">"+o+"</code></pre>\n"):"<pre><code"+s.renderAttrs(u)+">"+o+"</code></pre>\n"},T.image=function(e,r,t,n,s){var o=e[r];return o.attrs[o.attrIndex("alt")][1]=s.renderInlineAsText(o.children,t,n),s.renderToken(e,r,t)},T.hardbreak=function(e,r,t){return t.xhtmlOut?"<br />\n":"<br>\n"},T.softbreak=function(e,r,t){return t.breaks?t.xhtmlOut?"<br />\n":"<br>\n":"\n"},T.text=function(e,r){return z(e[r].content)},T.html_block=function(e,r){return e[r].content},T.html_inline=function(e,r){return e[r].content},I.prototype.renderAttrs=function(e){var r,t,n;if(!e.attrs)return"";for(n="",r=0,t=e.attrs.length;r<t;r++)n+=" "+z(e.attrs[r][0])+'="'+z(e.attrs[r][1])+'"';return n},I.prototype.renderToken=function(e,r,t){var n,s="",o=!1,i=e[r];return i.hidden?"":(i.block&&-1!==i.nesting&&r&&e[r-1].hidden&&(s+="\n"),s+=(-1===i.nesting?"</":"<")+i.tag,s+=this.renderAttrs(i),0===i.nesting&&t.xhtmlOut&&(s+=" /"),i.block&&(o=!0,1===i.nesting&&r+1<e.length&&("inline"===(n=e[r+1]).type||n.hidden||-1===n.nesting&&n.tag===i.tag)&&(o=!1)),s+=o?">\n":">")},I.prototype.renderInline=function(e,r,t){for(var n,s="",o=this.rules,i=0,a=e.length;i<a;i++)void 0!==o[n=e[i].type]?s+=o[n](e,i,r,t,this):s+=this.renderToken(e,i,r);return s},I.prototype.renderInlineAsText=function(e,r,t){for(var n="",s=0,o=e.length;s<o;s++)"text"===e[s].type?n+=e[s].content:"image"===e[s].type?n+=this.renderInlineAsText(e[s].children,r,t):"softbreak"===e[s].type&&(n+="\n");return n},I.prototype.render=function(e,r,t){var n,s,o,i="",a=this.rules;for(n=0,s=e.length;n<s;n++)"inline"===(o=e[n].type)?i+=this.renderInline(e[n].children,r,t):void 0!==a[o]?i+=a[e[n].type](e,n,r,t,this):i+=this.renderToken(e,n,r,t);return i};var M=I;function R(){this.__rules__=[],this.__cache__=null}R.prototype.__find__=function(e){for(var r=0;r<this.__rules__.length;r++)if(this.__rules__[r].name===e)return r;return-1},R.prototype.__compile__=function(){var e=this,r=[""];e.__rules__.forEach((function(e){e.enabled&&e.alt.forEach((function(e){r.indexOf(e)<0&&r.push(e)}))})),e.__cache__={},r.forEach((function(r){e.__cache__[r]=[],e.__rules__.forEach((function(t){t.enabled&&(r&&t.alt.indexOf(r)<0||e.__cache__[r].push(t.fn))}))}))},R.prototype.at=function(e,r,t){var n=this.__find__(e),s=t||{};if(-1===n)throw new Error("Parser rule not found: "+e);this.__rules__[n].fn=r,this.__rules__[n].alt=s.alt||[],this.__cache__=null},R.prototype.before=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},R.prototype.after=function(e,r,t,n){var s=this.__find__(e),o=n||{};if(-1===s)throw new Error("Parser rule not found: "+e);this.__rules__.splice(s+1,0,{name:r,enabled:!0,fn:t,alt:o.alt||[]}),this.__cache__=null},R.prototype.push=function(e,r,t){var n=t||{};this.__rules__.push({name:e,enabled:!0,fn:r,alt:n.alt||[]}),this.__cache__=null},R.prototype.enable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!0,t.push(e)}),this),this.__cache__=null,t},R.prototype.enableOnly=function(e,r){Array.isArray(e)||(e=[e]),this.__rules__.forEach((function(e){e.enabled=!1})),this.enable(e,r)},R.prototype.disable=function(e,r){Array.isArray(e)||(e=[e]);var t=[];return e.forEach((function(e){var n=this.__find__(e);if(n<0){if(r)return;throw new Error("Rules manager: invalid rule name "+e)}this.__rules__[n].enabled=!1,t.push(e)}),this),this.__cache__=null,t},R.prototype.getRules=function(e){return null===this.__cache__&&this.__compile__(),this.__cache__[e]||[]};var B=R,N=/\r\n?|\n/g,O=/\0/g,P=w.arrayReplaceAt;function j(e){return/^<\/a\s*>/i.test(e)}var U=/\+-|\.\.|\?\?\?\?|!!!!|,,|--/,V=/\((c|tm|r|p)\)/i,Z=/\((c|tm|r|p)\)/gi,G={c:"\xa9",r:"\xae",p:"\xa7",tm:"\u2122"};function $(e,r){return G[r.toLowerCase()]}function H(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||(t.content=t.content.replace(Z,$)),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}function J(e){var r,t,n=0;for(r=e.length-1;r>=0;r--)"text"!==(t=e[r]).type||n||U.test(t.content)&&(t.content=t.content.replace(/\+-/g,"\xb1").replace(/\.{2,}/g,"\u2026").replace(/([?!])\u2026/g,"$1..").replace(/([?!]){4,}/g,"$1$1$1").replace(/,{2,}/g,",").replace(/(^|[^-])---(?=[^-]|$)/gm,"$1\u2014").replace(/(^|\s)--(?=\s|$)/gm,"$1\u2013").replace(/(^|[^-\s])--(?=[^-\s]|$)/gm,"$1\u2013")),"link_open"===t.type&&"auto"===t.info&&n--,"link_close"===t.type&&"auto"===t.info&&n++}var W=w.isWhiteSpace,Y=w.isPunctChar,K=w.isMdAsciiPunct,Q=/['"]/,X=/['"]/g;function ee(e,r,t){return e.substr(0,r)+t+e.substr(r+1)}function re(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y;for(v=[],t=0;t<e.length;t++){for(n=e[t],c=e[t].level,b=v.length-1;b>=0&&!(v[b].level<=c);b--);if(v.length=b+1,"text"===n.type){i=0,a=(s=n.content).length;e:for(;i<a&&(X.lastIndex=i,o=X.exec(s));){if(g=_=!0,i=o.index+1,k="'"===o[0],u=32,o.index-1>=0)u=s.charCodeAt(o.index-1);else for(b=t-1;b>=0&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b--)if(e[b].content){u=e[b].content.charCodeAt(e[b].content.length-1);break}if(p=32,i<a)p=s.charCodeAt(i);else for(b=t+1;b<e.length&&("softbreak"!==e[b].type&&"hardbreak"!==e[b].type);b++)if(e[b].content){p=e[b].content.charCodeAt(0);break}if(h=K(u)||Y(String.fromCharCode(u)),f=K(p)||Y(String.fromCharCode(p)),d=W(u),(m=W(p))?g=!1:f&&(d||h||(g=!1)),d?_=!1:h&&(m||f||(_=!1)),34===p&&'"'===o[0]&&u>=48&&u<=57&&(_=g=!1),g&&_&&(g=h,_=f),g||_){if(_)for(b=v.length-1;b>=0&&(l=v[b],!(v[b].level<c));b--)if(l.single===k&&v[b].level===c){l=v[b],k?(C=r.md.options.quotes[2],y=r.md.options.quotes[3]):(C=r.md.options.quotes[0],y=r.md.options.quotes[1]),n.content=ee(n.content,o.index,y),e[l.token].content=ee(e[l.token].content,l.pos,C),i+=y.length-1,l.token===t&&(i+=C.length-1),a=(s=n.content).length,v.length=b;continue e}g?v.push({token:t,pos:o.index,single:k,level:c}):_&&k&&(n.content=ee(n.content,o.index,"\u2019"))}else k&&(n.content=ee(n.content,o.index,"\u2019"))}}}}function te(e,r,t){this.type=e,this.tag=r,this.attrs=null,this.map=null,this.nesting=t,this.level=0,this.children=null,this.content="",this.markup="",this.info="",this.meta=null,this.block=!1,this.hidden=!1}te.prototype.attrIndex=function(e){var r,t,n;if(!this.attrs)return-1;for(t=0,n=(r=this.attrs).length;t<n;t++)if(r[t][0]===e)return t;return-1},te.prototype.attrPush=function(e){this.attrs?this.attrs.push(e):this.attrs=[e]},te.prototype.attrSet=function(e,r){var t=this.attrIndex(e),n=[e,r];t<0?this.attrPush(n):this.attrs[t]=n},te.prototype.attrGet=function(e){var r=this.attrIndex(e),t=null;return r>=0&&(t=this.attrs[r][1]),t},te.prototype.attrJoin=function(e,r){var t=this.attrIndex(e);t<0?this.attrPush([e,r]):this.attrs[t][1]=this.attrs[t][1]+" "+r};var ne=te;function se(e,r,t){this.src=e,this.env=t,this.tokens=[],this.inlineMode=!1,this.md=r}se.prototype.Token=ne;var oe=se,ie=[["normalize",function(e){var r;r=(r=e.src.replace(N,"\n")).replace(O,"\ufffd"),e.src=r}],["block",function(e){var r;e.inlineMode?((r=new e.Token("inline","",0)).content=e.src,r.map=[0,1],r.children=[],e.tokens.push(r)):e.md.block.parse(e.src,e.md,e.env,e.tokens)}],["inline",function(e){var r,t,n,s=e.tokens;for(t=0,n=s.length;t<n;t++)"inline"===(r=s[t]).type&&e.md.inline.parse(r.content,e.md,e.env,r.children)}],["linkify",function(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k=e.tokens;if(e.md.options.linkify)for(t=0,n=k.length;t<n;t++)if("inline"===k[t].type&&e.md.linkify.pretest(k[t].content))for(f=0,r=(s=k[t].children).length-1;r>=0;r--)if("link_close"!==(i=s[r]).type){if("html_inline"===i.type&&(b=i.content,/^<a[>\s]/i.test(b)&&f>0&&f--,j(i.content)&&f++),!(f>0)&&"text"===i.type&&e.md.linkify.test(i.content)){for(l=i.content,_=e.md.linkify.match(l),a=[],h=i.level,p=0,c=0;c<_.length;c++)d=_[c].url,m=e.md.normalizeLink(d),e.md.validateLink(m)&&(g=_[c].text,g=_[c].schema?"mailto:"!==_[c].schema||/^mailto:/i.test(g)?e.md.normalizeLinkText(g):e.md.normalizeLinkText("mailto:"+g).replace(/^mailto:/,""):e.md.normalizeLinkText("http://"+g).replace(/^http:\/\//,""),(u=_[c].index)>p&&((o=new e.Token("text","",0)).content=l.slice(p,u),o.level=h,a.push(o)),(o=new e.Token("link_open","a",1)).attrs=[["href",m]],o.level=h++,o.markup="linkify",o.info="auto",a.push(o),(o=new e.Token("text","",0)).content=g,o.level=h,a.push(o),(o=new e.Token("link_close","a",-1)).level=--h,o.markup="linkify",o.info="auto",a.push(o),p=_[c].lastIndex);p<l.length&&((o=new e.Token("text","",0)).content=l.slice(p),o.level=h,a.push(o)),k[t].children=s=P(s,r,a)}}else for(r--;s[r].level!==i.level&&"link_open"!==s[r].type;)r--}],["replacements",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&(V.test(e.tokens[r].content)&&H(e.tokens[r].children),U.test(e.tokens[r].content)&&J(e.tokens[r].children))}],["smartquotes",function(e){var r;if(e.md.options.typographer)for(r=e.tokens.length-1;r>=0;r--)"inline"===e.tokens[r].type&&Q.test(e.tokens[r].content)&&re(e.tokens[r].children,e)}]];function ae(){this.ruler=new B;for(var e=0;e<ie.length;e++)this.ruler.push(ie[e][0],ie[e][1])}ae.prototype.process=function(e){var r,t,n;for(r=0,t=(n=this.ruler.getRules("")).length;r<t;r++)n[r](e)},ae.prototype.State=oe;var ce=ae,le=w.isSpace;function ue(e,r){var t=e.bMarks[r]+e.tShift[r],n=e.eMarks[r];return e.src.substr(t,n-t)}function pe(e){var r,t=[],n=0,s=e.length,o=!1,i=0,a="";for(r=e.charCodeAt(n);n<s;)124===r&&(o?(a+=e.substring(i,n-1),i=n):(t.push(a+e.substring(i,n)),a="",i=n+1)),o=92===r,n++,r=e.charCodeAt(n);return t.push(a+e.substring(i)),t}var he=w.isSpace,fe=w.isSpace,de=w.isSpace;function me(e,r){var t,n,s,o;return n=e.bMarks[r]+e.tShift[r],s=e.eMarks[r],42!==(t=e.src.charCodeAt(n++))&&45!==t&&43!==t||n<s&&(o=e.src.charCodeAt(n),!de(o))?-1:n}function ge(e,r){var t,n=e.bMarks[r]+e.tShift[r],s=n,o=e.eMarks[r];if(s+1>=o)return-1;if((t=e.src.charCodeAt(s++))<48||t>57)return-1;for(;;){if(s>=o)return-1;if(!((t=e.src.charCodeAt(s++))>=48&&t<=57)){if(41===t||46===t)break;return-1}if(s-n>=10)return-1}return s<o&&(t=e.src.charCodeAt(s),!de(t))?-1:s}var _e=w.normalizeReference,be=w.isSpace,ke="<[A-Za-z][A-Za-z0-9\\-]*(?:\\s+[a-zA-Z_:][a-zA-Z0-9:._-]*(?:\\s*=\\s*(?:[^\"'=<>`\\x00-\\x20]+|'[^']*'|\"[^\"]*\"))?)*\\s*\\/?>",ve="<\\/[A-Za-z][A-Za-z0-9\\-]*\\s*>",Ce={HTML_TAG_RE:new RegExp("^(?:"+ke+"|"+ve+"|\x3c!----\x3e|\x3c!--(?:-?[^>-])(?:-?[^-])*--\x3e|<[?][\\s\\S]*?[?]>|<![A-Z]+\\s+[^>]*>|<!\\[CDATA\\[[\\s\\S]*?\\]\\]>)"),HTML_OPEN_CLOSE_TAG_RE:new RegExp("^(?:"+ke+"|"+ve+")")},ye=Ce.HTML_OPEN_CLOSE_TAG_RE,Ae=[[/^<(script|pre|style|textarea)(?=(\s|>|$))/i,/<\/(script|pre|style|textarea)>/i,!0],[/^<!--/,/-->/,!0],[/^<\?/,/\?>/,!0],[/^<![A-Z]/,/>/,!0],[/^<!\[CDATA\[/,/\]\]>/,!0],[new RegExp("^</?("+["address","article","aside","base","basefont","blockquote","body","caption","center","col","colgroup","dd","details","dialog","dir","div","dl","dt","fieldset","figcaption","figure","footer","form","frame","frameset","h1","h2","h3","h4","h5","h6","head","header","hr","html","iframe","legend","li","link","main","menu","menuitem","nav","noframes","ol","optgroup","option","p","param","section","source","summary","table","tbody","td","tfoot","th","thead","title","tr","track","ul"].join("|")+")(?=(\\s|/?>|$))","i"),/^$/,!0],[new RegExp(ye.source+"\\s*$"),/^$/,!1]],xe=w.isSpace,De=w.isSpace;function we(e,r,t,n){var s,o,i,a,c,l,u,p;for(this.src=e,this.md=r,this.env=t,this.tokens=n,this.bMarks=[],this.eMarks=[],this.tShift=[],this.sCount=[],this.bsCount=[],this.blkIndent=0,this.line=0,this.lineMax=0,this.tight=!1,this.ddIndent=-1,this.listIndent=-1,this.parentType="root",this.level=0,this.result="",p=!1,i=a=l=u=0,c=(o=this.src).length;a<c;a++){if(s=o.charCodeAt(a),!p){if(De(s)){l++,9===s?u+=4-u%4:u++;continue}p=!0}10!==s&&a!==c-1||(10!==s&&a++,this.bMarks.push(i),this.eMarks.push(a),this.tShift.push(l),this.sCount.push(u),this.bsCount.push(0),p=!1,l=0,u=0,i=a+1)}this.bMarks.push(o.length),this.eMarks.push(o.length),this.tShift.push(0),this.sCount.push(0),this.bsCount.push(0),this.lineMax=this.bMarks.length-1}we.prototype.push=function(e,r,t){var n=new ne(e,r,t);return n.block=!0,t<0&&this.level--,n.level=this.level,t>0&&this.level++,this.tokens.push(n),n},we.prototype.isEmpty=function(e){return this.bMarks[e]+this.tShift[e]>=this.eMarks[e]},we.prototype.skipEmptyLines=function(e){for(var r=this.lineMax;e<r&&!(this.bMarks[e]+this.tShift[e]<this.eMarks[e]);e++);return e},we.prototype.skipSpaces=function(e){for(var r,t=this.src.length;e<t&&(r=this.src.charCodeAt(e),De(r));e++);return e},we.prototype.skipSpacesBack=function(e,r){if(e<=r)return e;for(;e>r;)if(!De(this.src.charCodeAt(--e)))return e+1;return e},we.prototype.skipChars=function(e,r){for(var t=this.src.length;e<t&&this.src.charCodeAt(e)===r;e++);return e},we.prototype.skipCharsBack=function(e,r,t){if(e<=t)return e;for(;e>t;)if(r!==this.src.charCodeAt(--e))return e+1;return e},we.prototype.getLines=function(e,r,t,n){var s,o,i,a,c,l,u,p=e;if(e>=r)return"";for(l=new Array(r-e),s=0;p<r;p++,s++){for(o=0,u=a=this.bMarks[p],c=p+1<r||n?this.eMarks[p]+1:this.eMarks[p];a<c&&o<t;){if(i=this.src.charCodeAt(a),De(i))9===i?o+=4-(o+this.bsCount[p])%4:o++;else{if(!(a-u<this.tShift[p]))break;o++}a++}l[s]=o>t?new Array(o-t+1).join(" ")+this.src.slice(a,c):this.src.slice(a,c)}return l.join("")},we.prototype.Token=ne;var Ee=we,qe=[["table",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C;if(r+2>t)return!1;if(l=r+1,e.sCount[l]<e.blkIndent)return!1;if(e.sCount[l]-e.blkIndent>=4)return!1;if((i=e.bMarks[l]+e.tShift[l])>=e.eMarks[l])return!1;if(124!==(v=e.src.charCodeAt(i++))&&45!==v&&58!==v)return!1;if(i>=e.eMarks[l])return!1;if(124!==(C=e.src.charCodeAt(i++))&&45!==C&&58!==C&&!le(C))return!1;if(45===v&&le(C))return!1;for(;i<e.eMarks[l];){if(124!==(s=e.src.charCodeAt(i))&&45!==s&&58!==s&&!le(s))return!1;i++}for(u=(o=ue(e,r+1)).split("|"),f=[],a=0;a<u.length;a++){if(!(d=u[a].trim())){if(0===a||a===u.length-1)continue;return!1}if(!/^:?-+:?$/.test(d))return!1;58===d.charCodeAt(d.length-1)?f.push(58===d.charCodeAt(0)?"center":"right"):58===d.charCodeAt(0)?f.push("left"):f.push("")}if(-1===(o=ue(e,r).trim()).indexOf("|"))return!1;if(e.sCount[r]-e.blkIndent>=4)return!1;if((u=pe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),0===(p=u.length)||p!==f.length)return!1;if(n)return!0;for(_=e.parentType,e.parentType="table",k=e.md.block.ruler.getRules("blockquote"),(h=e.push("table_open","table",1)).map=m=[r,0],(h=e.push("thead_open","thead",1)).map=[r,r+1],(h=e.push("tr_open","tr",1)).map=[r,r+1],a=0;a<u.length;a++)h=e.push("th_open","th",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a].trim(),h.children=[],h=e.push("th_close","th",-1);for(h=e.push("tr_close","tr",-1),h=e.push("thead_close","thead",-1),l=r+2;l<t&&!(e.sCount[l]<e.blkIndent);l++){for(b=!1,a=0,c=k.length;a<c;a++)if(k[a](e,l,t,!0)){b=!0;break}if(b)break;if(!(o=ue(e,l).trim()))break;if(e.sCount[l]-e.blkIndent>=4)break;for((u=pe(o)).length&&""===u[0]&&u.shift(),u.length&&""===u[u.length-1]&&u.pop(),l===r+2&&((h=e.push("tbody_open","tbody",1)).map=g=[r+2,0]),(h=e.push("tr_open","tr",1)).map=[l,l+1],a=0;a<p;a++)h=e.push("td_open","td",1),f[a]&&(h.attrs=[["style","text-align:"+f[a]]]),(h=e.push("inline","",0)).content=u[a]?u[a].trim():"",h.children=[],h=e.push("td_close","td",-1);h=e.push("tr_close","tr",-1)}return g&&(h=e.push("tbody_close","tbody",-1),g[1]=l),h=e.push("table_close","table",-1),m[1]=l,e.parentType=_,e.line=l,!0},["paragraph","reference"]],["code",function(e,r,t){var n,s,o;if(e.sCount[r]-e.blkIndent<4)return!1;for(s=n=r+1;n<t;)if(e.isEmpty(n))n++;else{if(!(e.sCount[n]-e.blkIndent>=4))break;s=++n}return e.line=s,(o=e.push("code_block","code",0)).content=e.getLines(r,s,4+e.blkIndent,!1)+"\n",o.map=[r,e.line],!0}],["fence",function(e,r,t,n){var s,o,i,a,c,l,u,p=!1,h=e.bMarks[r]+e.tShift[r],f=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(h+3>f)return!1;if(126!==(s=e.src.charCodeAt(h))&&96!==s)return!1;if(c=h,(o=(h=e.skipChars(h,s))-c)<3)return!1;if(u=e.src.slice(c,h),i=e.src.slice(h,f),96===s&&i.indexOf(String.fromCharCode(s))>=0)return!1;if(n)return!0;for(a=r;!(++a>=t)&&!((h=c=e.bMarks[a]+e.tShift[a])<(f=e.eMarks[a])&&e.sCount[a]<e.blkIndent);)if(e.src.charCodeAt(h)===s&&!(e.sCount[a]-e.blkIndent>=4||(h=e.skipChars(h,s))-c<o||(h=e.skipSpaces(h))<f)){p=!0;break}return o=e.sCount[r],e.line=a+(p?1:0),(l=e.push("fence","code",0)).info=i,l.content=e.getLines(r+1,a,o,!0),l.markup=u,l.map=[r,e.line],!0},["paragraph","reference","blockquote","list"]],["blockquote",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y,A,x=e.lineMax,D=e.bMarks[r]+e.tShift[r],w=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(62!==e.src.charCodeAt(D++))return!1;if(n)return!0;for(a=h=e.sCount[r]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,k=!0):9===e.src.charCodeAt(D)?(k=!0,(e.bsCount[r]+h)%4==3?(D++,a++,h++,s=!1):s=!0):k=!1,f=[e.bMarks[r]],e.bMarks[r]=D;D<w&&(o=e.src.charCodeAt(D),he(o));)9===o?h+=4-(h+e.bsCount[r]+(s?1:0))%4:h++,D++;for(d=[e.bsCount[r]],e.bsCount[r]=e.sCount[r]+1+(k?1:0),l=D>=w,_=[e.sCount[r]],e.sCount[r]=h-a,b=[e.tShift[r]],e.tShift[r]=D-e.bMarks[r],C=e.md.block.ruler.getRules("blockquote"),g=e.parentType,e.parentType="blockquote",p=r+1;p<t&&(A=e.sCount[p]<e.blkIndent,!((D=e.bMarks[p]+e.tShift[p])>=(w=e.eMarks[p])));p++)if(62!==e.src.charCodeAt(D++)||A){if(l)break;for(v=!1,i=0,c=C.length;i<c;i++)if(C[i](e,p,t,!0)){v=!0;break}if(v){e.lineMax=p,0!==e.blkIndent&&(f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]-=e.blkIndent);break}f.push(e.bMarks[p]),d.push(e.bsCount[p]),b.push(e.tShift[p]),_.push(e.sCount[p]),e.sCount[p]=-1}else{for(a=h=e.sCount[p]+1,32===e.src.charCodeAt(D)?(D++,a++,h++,s=!1,k=!0):9===e.src.charCodeAt(D)?(k=!0,(e.bsCount[p]+h)%4==3?(D++,a++,h++,s=!1):s=!0):k=!1,f.push(e.bMarks[p]),e.bMarks[p]=D;D<w&&(o=e.src.charCodeAt(D),he(o));)9===o?h+=4-(h+e.bsCount[p]+(s?1:0))%4:h++,D++;l=D>=w,d.push(e.bsCount[p]),e.bsCount[p]=e.sCount[p]+1+(k?1:0),_.push(e.sCount[p]),e.sCount[p]=h-a,b.push(e.tShift[p]),e.tShift[p]=D-e.bMarks[p]}for(m=e.blkIndent,e.blkIndent=0,(y=e.push("blockquote_open","blockquote",1)).markup=">",y.map=u=[r,0],e.md.block.tokenize(e,r,p),(y=e.push("blockquote_close","blockquote",-1)).markup=">",e.lineMax=x,e.parentType=g,u[1]=e.line,i=0;i<b.length;i++)e.bMarks[i+r]=f[i],e.tShift[i+r]=b[i],e.sCount[i+r]=_[i],e.bsCount[i+r]=d[i];return e.blkIndent=m,!0},["paragraph","reference","blockquote","list"]],["hr",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(42!==(s=e.src.charCodeAt(c++))&&45!==s&&95!==s)return!1;for(o=1;c<l;){if((i=e.src.charCodeAt(c++))!==s&&!fe(i))return!1;i===s&&o++}return!(o<3)&&(n||(e.line=r+1,(a=e.push("hr","hr",0)).map=[r,e.line],a.markup=Array(o+1).join(String.fromCharCode(s))),!0)},["paragraph","reference","blockquote","list"]],["list",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v,C,y,A,x,D,w,E,q,S,F,L,z=!1,T=!0;if(e.sCount[r]-e.blkIndent>=4)return!1;if(e.listIndent>=0&&e.sCount[r]-e.listIndent>=4&&e.sCount[r]<e.blkIndent)return!1;if(n&&"paragraph"===e.parentType&&e.tShift[r]>=e.blkIndent&&(z=!0),(w=ge(e,r))>=0){if(u=!0,q=e.bMarks[r]+e.tShift[r],g=Number(e.src.slice(q,w-1)),z&&1!==g)return!1}else{if(!((w=me(e,r))>=0))return!1;u=!1}if(z&&e.skipSpaces(w)>=e.eMarks[r])return!1;if(m=e.src.charCodeAt(w-1),n)return!0;for(d=e.tokens.length,u?(L=e.push("ordered_list_open","ol",1),1!==g&&(L.attrs=[["start",g]])):L=e.push("bullet_list_open","ul",1),L.map=f=[r,0],L.markup=String.fromCharCode(m),b=r,E=!1,F=e.md.block.ruler.getRules("list"),C=e.parentType,e.parentType="list";b<t;){for(D=w,_=e.eMarks[b],l=k=e.sCount[b]+w-(e.bMarks[r]+e.tShift[r]);D<_;){if(9===(s=e.src.charCodeAt(D)))k+=4-(k+e.bsCount[b])%4;else{if(32!==s)break;k++}D++}if((c=(o=D)>=_?1:k-l)>4&&(c=1),a=l+c,(L=e.push("list_item_open","li",1)).markup=String.fromCharCode(m),L.map=p=[r,0],u&&(L.info=e.src.slice(q,w-1)),x=e.tight,A=e.tShift[r],y=e.sCount[r],v=e.listIndent,e.listIndent=e.blkIndent,e.blkIndent=a,e.tight=!0,e.tShift[r]=o-e.bMarks[r],e.sCount[r]=k,o>=_&&e.isEmpty(r+1)?e.line=Math.min(e.line+2,t):e.md.block.tokenize(e,r,t,!0),e.tight&&!E||(T=!1),E=e.line-r>1&&e.isEmpty(e.line-1),e.blkIndent=e.listIndent,e.listIndent=v,e.tShift[r]=A,e.sCount[r]=y,e.tight=x,(L=e.push("list_item_close","li",-1)).markup=String.fromCharCode(m),b=r=e.line,p[1]=b,o=e.bMarks[r],b>=t)break;if(e.sCount[b]<e.blkIndent)break;if(e.sCount[r]-e.blkIndent>=4)break;for(S=!1,i=0,h=F.length;i<h;i++)if(F[i](e,b,t,!0)){S=!0;break}if(S)break;if(u){if((w=ge(e,b))<0)break;q=e.bMarks[b]+e.tShift[b]}else if((w=me(e,b))<0)break;if(m!==e.src.charCodeAt(w-1))break}return(L=u?e.push("ordered_list_close","ol",-1):e.push("bullet_list_close","ul",-1)).markup=String.fromCharCode(m),f[1]=b,e.line=b,e.parentType=C,T&&function(e,r){var t,n,s=e.level+2;for(t=r+2,n=e.tokens.length-2;t<n;t++)e.tokens[t].level===s&&"paragraph_open"===e.tokens[t].type&&(e.tokens[t+2].hidden=!0,e.tokens[t].hidden=!0,t+=2)}(e,d),!0},["paragraph","reference","blockquote"]],["reference",function(e,r,t,n){var s,o,i,a,c,l,u,p,h,f,d,m,g,_,b,k,v=0,C=e.bMarks[r]+e.tShift[r],y=e.eMarks[r],A=r+1;if(e.sCount[r]-e.blkIndent>=4)return!1;if(91!==e.src.charCodeAt(C))return!1;for(;++C<y;)if(93===e.src.charCodeAt(C)&&92!==e.src.charCodeAt(C-1)){if(C+1===y)return!1;if(58!==e.src.charCodeAt(C+1))return!1;break}for(a=e.lineMax,b=e.md.block.ruler.getRules("reference"),f=e.parentType,e.parentType="reference";A<a&&!e.isEmpty(A);A++)if(!(e.sCount[A]-e.blkIndent>3||e.sCount[A]<0)){for(_=!1,l=0,u=b.length;l<u;l++)if(b[l](e,A,a,!0)){_=!0;break}if(_)break}for(y=(g=e.getLines(r,A,e.blkIndent,!1).trim()).length,C=1;C<y;C++){if(91===(s=g.charCodeAt(C)))return!1;if(93===s){h=C;break}(10===s||92===s&&++C<y&&10===g.charCodeAt(C))&&v++}if(h<0||58!==g.charCodeAt(h+1))return!1;for(C=h+2;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!be(s))break;if(!(d=e.md.helpers.parseLinkDestination(g,C,y)).ok)return!1;if(c=e.md.normalizeLink(d.str),!e.md.validateLink(c))return!1;for(o=C=d.pos,i=v+=d.lines,m=C;C<y;C++)if(10===(s=g.charCodeAt(C)))v++;else if(!be(s))break;for(d=e.md.helpers.parseLinkTitle(g,C,y),C<y&&m!==C&&d.ok?(k=d.str,C=d.pos,v+=d.lines):(k="",C=o,v=i);C<y&&(s=g.charCodeAt(C),be(s));)C++;if(C<y&&10!==g.charCodeAt(C)&&k)for(k="",C=o,v=i;C<y&&(s=g.charCodeAt(C),be(s));)C++;return!(C<y&&10!==g.charCodeAt(C))&&(!!(p=_e(g.slice(1,h)))&&(n||(void 0===e.env.references&&(e.env.references={}),void 0===e.env.references[p]&&(e.env.references[p]={title:k,href:c}),e.parentType=f,e.line=r+v+1),!0))}],["html_block",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(!e.md.options.html)return!1;if(60!==e.src.charCodeAt(c))return!1;for(a=e.src.slice(c,l),s=0;s<Ae.length&&!Ae[s][0].test(a);s++);if(s===Ae.length)return!1;if(n)return Ae[s][2];if(o=r+1,!Ae[s][1].test(a))for(;o<t&&!(e.sCount[o]<e.blkIndent);o++)if(c=e.bMarks[o]+e.tShift[o],l=e.eMarks[o],a=e.src.slice(c,l),Ae[s][1].test(a)){0!==a.length&&o++;break}return e.line=o,(i=e.push("html_block","",0)).map=[r,o],i.content=e.getLines(r,o,e.blkIndent,!0),!0},["paragraph","reference","blockquote"]],["heading",function(e,r,t,n){var s,o,i,a,c=e.bMarks[r]+e.tShift[r],l=e.eMarks[r];if(e.sCount[r]-e.blkIndent>=4)return!1;if(35!==(s=e.src.charCodeAt(c))||c>=l)return!1;for(o=1,s=e.src.charCodeAt(++c);35===s&&c<l&&o<=6;)o++,s=e.src.charCodeAt(++c);return!(o>6||c<l&&!xe(s))&&(n||(l=e.skipSpacesBack(l,c),(i=e.skipCharsBack(l,35,c))>c&&xe(e.src.charCodeAt(i-1))&&(l=i),e.line=r+1,(a=e.push("heading_open","h"+String(o),1)).markup="########".slice(0,o),a.map=[r,e.line],(a=e.push("inline","",0)).content=e.src.slice(c,l).trim(),a.map=[r,e.line],a.children=[],(a=e.push("heading_close","h"+String(o),-1)).markup="########".slice(0,o)),!0)},["paragraph","reference","blockquote"]],["lheading",function(e,r,t){var n,s,o,i,a,c,l,u,p,h,f=r+1,d=e.md.block.ruler.getRules("paragraph");if(e.sCount[r]-e.blkIndent>=4)return!1;for(h=e.parentType,e.parentType="paragraph";f<t&&!e.isEmpty(f);f++)if(!(e.sCount[f]-e.blkIndent>3)){if(e.sCount[f]>=e.blkIndent&&(c=e.bMarks[f]+e.tShift[f])<(l=e.eMarks[f])&&(45===(p=e.src.charCodeAt(c))||61===p)&&(c=e.skipChars(c,p),(c=e.skipSpaces(c))>=l)){u=61===p?1:2;break}if(!(e.sCount[f]<0)){for(s=!1,o=0,i=d.length;o<i;o++)if(d[o](e,f,t,!0)){s=!0;break}if(s)break}}return!!u&&(n=e.getLines(r,f,e.blkIndent,!1).trim(),e.line=f+1,(a=e.push("heading_open","h"+String(u),1)).markup=String.fromCharCode(p),a.map=[r,e.line],(a=e.push("inline","",0)).content=n,a.map=[r,e.line-1],a.children=[],(a=e.push("heading_close","h"+String(u),-1)).markup=String.fromCharCode(p),e.parentType=h,!0)}],["paragraph",function(e,r){var t,n,s,o,i,a,c=r+1,l=e.md.block.ruler.getRules("paragraph"),u=e.lineMax;for(a=e.parentType,e.parentType="paragraph";c<u&&!e.isEmpty(c);c++)if(!(e.sCount[c]-e.blkIndent>3||e.sCount[c]<0)){for(n=!1,s=0,o=l.length;s<o;s++)if(l[s](e,c,u,!0)){n=!0;break}if(n)break}return t=e.getLines(r,c,e.blkIndent,!1).trim(),e.line=c,(i=e.push("paragraph_open","p",1)).map=[r,e.line],(i=e.push("inline","",0)).content=t,i.map=[r,e.line],i.children=[],i=e.push("paragraph_close","p",-1),e.parentType=a,!0}]];function Se(){this.ruler=new B;for(var e=0;e<qe.length;e++)this.ruler.push(qe[e][0],qe[e][1],{alt:(qe[e][2]||[]).slice()})}Se.prototype.tokenize=function(e,r,t){for(var n,s=this.ruler.getRules(""),o=s.length,i=r,a=!1,c=e.md.options.maxNesting;i<t&&(e.line=i=e.skipEmptyLines(i),!(i>=t))&&!(e.sCount[i]<e.blkIndent);){if(e.level>=c){e.line=t;break}for(n=0;n<o&&!s[n](e,i,t,!1);n++);e.tight=!a,e.isEmpty(e.line-1)&&(a=!0),(i=e.line)<t&&e.isEmpty(i)&&(a=!0,i++,e.line=i)}},Se.prototype.parse=function(e,r,t,n){var s;e&&(s=new this.State(e,r,t,n),this.tokenize(s,s.line,s.lineMax))},Se.prototype.State=Ee;var Fe=Se;function Le(e){switch(e){case 10:case 33:case 35:case 36:case 37:case 38:case 42:case 43:case 45:case 58:case 60:case 61:case 62:case 64:case 91:case 92:case 93:case 94:case 95:case 96:case 123:case 125:case 126:return!0;default:return!1}}for(var ze=w.isSpace,Te=w.isSpace,Ie=[],Me=0;Me<256;Me++)Ie.push(0);"\\!\"#$%&'()*+,./:;<=>?@[]^_`{|}~-".split("").forEach((function(e){Ie[e.charCodeAt(0)]=1}));function Re(e,r){var t,n,s,o,i,a=[],c=r.length;for(t=0;t<c;t++)126===(s=r[t]).marker&&-1!==s.end&&(o=r[s.end],(i=e.tokens[s.token]).type="s_open",i.tag="s",i.nesting=1,i.markup="~~",i.content="",(i=e.tokens[o.token]).type="s_close",i.tag="s",i.nesting=-1,i.markup="~~",i.content="","text"===e.tokens[o.token-1].type&&"~"===e.tokens[o.token-1].content&&a.push(o.token-1));for(;a.length;){for(n=(t=a.pop())+1;n<e.tokens.length&&"s_close"===e.tokens[n].type;)n++;t!==--n&&(i=e.tokens[n],e.tokens[n]=e.tokens[t],e.tokens[t]=i)}}var Be={tokenize:function(e,r){var t,n,s,o,i=e.pos,a=e.src.charCodeAt(i);if(r)return!1;if(126!==a)return!1;if(s=(n=e.scanDelims(e.pos,!0)).length,o=String.fromCharCode(a),s<2)return!1;for(s%2&&(e.push("text","",0).content=o,s--),t=0;t<s;t+=2)e.push("text","",0).content=o+o,e.delimiters.push({marker:a,length:0,jump:t/2,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Re(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Re(e,t[r].delimiters)}};function Ne(e,r){var t,n,s,o,i,a;for(t=r.length-1;t>=0;t--)95!==(n=r[t]).marker&&42!==n.marker||-1!==n.end&&(s=r[n.end],a=t>0&&r[t-1].end===n.end+1&&r[t-1].token===n.token-1&&r[n.end+1].token===s.token+1&&r[t-1].marker===n.marker,i=String.fromCharCode(n.marker),(o=e.tokens[n.token]).type=a?"strong_open":"em_open",o.tag=a?"strong":"em",o.nesting=1,o.markup=a?i+i:i,o.content="",(o=e.tokens[s.token]).type=a?"strong_close":"em_close",o.tag=a?"strong":"em",o.nesting=-1,o.markup=a?i+i:i,o.content="",a&&(e.tokens[r[t-1].token].content="",e.tokens[r[n.end+1].token].content="",t--))}var Oe={tokenize:function(e,r){var t,n,s=e.pos,o=e.src.charCodeAt(s);if(r)return!1;if(95!==o&&42!==o)return!1;for(n=e.scanDelims(e.pos,42===o),t=0;t<n.length;t++)e.push("text","",0).content=String.fromCharCode(o),e.delimiters.push({marker:o,length:n.length,jump:t,token:e.tokens.length-1,end:-1,open:n.can_open,close:n.can_close});return e.pos+=n.length,!0},postProcess:function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Ne(e,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Ne(e,t[r].delimiters)}},Pe=w.normalizeReference,je=w.isSpace,Ue=w.normalizeReference,Ve=w.isSpace,Ze=/^([a-zA-Z0-9.!#$%&'*+\/=?^_`{|}~-]+@[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?(?:\.[a-zA-Z0-9](?:[a-zA-Z0-9-]{0,61}[a-zA-Z0-9])?)*)$/,Ge=/^([a-zA-Z][a-zA-Z0-9+.\-]{1,31}):([^<>\x00-\x20]*)$/,$e=Ce.HTML_TAG_RE;var He=w.has,Je=w.isValidEntityCode,We=w.fromCodePoint,Ye=/^&#((?:x[a-f0-9]{1,6}|[0-9]{1,7}));/i,Ke=/^&([a-z][a-z0-9]{1,31});/i;function Qe(e,r){var t,n,s,o,i,a,c,l,u={},p=r.length;for(t=0;t<p;t++)if((s=r[t]).length=s.length||0,s.close){for(u.hasOwnProperty(s.marker)||(u[s.marker]=[-1,-1,-1,-1,-1,-1]),i=u[s.marker][(s.open?3:0)+s.length%3],(n=t-s.jump-1)<-1&&(n=-1),a=n;n>i;n-=o.jump+1)if((o=r[n]).marker===s.marker&&o.open&&o.end<0&&(c=!1,(o.close||s.open)&&(o.length+s.length)%3==0&&(o.length%3==0&&s.length%3==0||(c=!0)),!c)){l=n>0&&!r[n-1].open?r[n-1].jump+1:0,s.jump=t-n+l,s.open=!1,o.end=t,o.jump=l,o.close=!1,a=-1;break}-1!==a&&(u[s.marker][(s.open?3:0)+(s.length||0)%3]=a)}}var Xe=w.isWhiteSpace,er=w.isPunctChar,rr=w.isMdAsciiPunct;function tr(e,r,t,n){this.src=e,this.env=t,this.md=r,this.tokens=n,this.tokens_meta=Array(n.length),this.pos=0,this.posMax=this.src.length,this.level=0,this.pending="",this.pendingLevel=0,this.cache={},this.delimiters=[],this._prev_delimiters=[],this.backticks={},this.backticksScanned=!1}tr.prototype.pushPending=function(){var e=new ne("text","",0);return e.content=this.pending,e.level=this.pendingLevel,this.tokens.push(e),this.pending="",e},tr.prototype.push=function(e,r,t){this.pending&&this.pushPending();var n=new ne(e,r,t),s=null;return t<0&&(this.level--,this.delimiters=this._prev_delimiters.pop()),n.level=this.level,t>0&&(this.level++,this._prev_delimiters.push(this.delimiters),this.delimiters=[],s={delimiters:this.delimiters}),this.pendingLevel=this.level,this.tokens.push(n),this.tokens_meta.push(s),n},tr.prototype.scanDelims=function(e,r){var t,n,s,o,i,a,c,l,u,p=e,h=!0,f=!0,d=this.posMax,m=this.src.charCodeAt(e);for(t=e>0?this.src.charCodeAt(e-1):32;p<d&&this.src.charCodeAt(p)===m;)p++;return s=p-e,n=p<d?this.src.charCodeAt(p):32,c=rr(t)||er(String.fromCharCode(t)),u=rr(n)||er(String.fromCharCode(n)),a=Xe(t),(l=Xe(n))?h=!1:u&&(a||c||(h=!1)),a?f=!1:c&&(l||u||(f=!1)),r?(o=h,i=f):(o=h&&(!f||c),i=f&&(!h||u)),{can_open:o,can_close:i,length:s}},tr.prototype.Token=ne;var nr=tr,sr=[["text",function(e,r){for(var t=e.pos;t<e.posMax&&!Le(e.src.charCodeAt(t));)t++;return t!==e.pos&&(r||(e.pending+=e.src.slice(e.pos,t)),e.pos=t,!0)}],["newline",function(e,r){var t,n,s=e.pos;if(10!==e.src.charCodeAt(s))return!1;for(t=e.pending.length-1,n=e.posMax,r||(t>=0&&32===e.pending.charCodeAt(t)?t>=1&&32===e.pending.charCodeAt(t-1)?(e.pending=e.pending.replace(/ +$/,""),e.push("hardbreak","br",0)):(e.pending=e.pending.slice(0,-1),e.push("softbreak","br",0)):e.push("softbreak","br",0)),s++;s<n&&ze(e.src.charCodeAt(s));)s++;return e.pos=s,!0}],["escape",function(e,r){var t,n=e.pos,s=e.posMax;if(92!==e.src.charCodeAt(n))return!1;if(++n<s){if((t=e.src.charCodeAt(n))<256&&0!==Ie[t])return r||(e.pending+=e.src[n]),e.pos+=2,!0;if(10===t){for(r||e.push("hardbreak","br",0),n++;n<s&&(t=e.src.charCodeAt(n),Te(t));)n++;return e.pos=n,!0}}return r||(e.pending+="\\"),e.pos++,!0}],["backticks",function(e,r){var t,n,s,o,i,a,c,l,u=e.pos;if(96!==e.src.charCodeAt(u))return!1;for(t=u,u++,n=e.posMax;u<n&&96===e.src.charCodeAt(u);)u++;if(c=(s=e.src.slice(t,u)).length,e.backticksScanned&&(e.backticks[c]||0)<=t)return r||(e.pending+=s),e.pos+=c,!0;for(i=a=u;-1!==(i=e.src.indexOf("`",a));){for(a=i+1;a<n&&96===e.src.charCodeAt(a);)a++;if((l=a-i)===c)return r||((o=e.push("code_inline","code",0)).markup=s,o.content=e.src.slice(u,i).replace(/\n/g," ").replace(/^ (.+) $/,"$1")),e.pos=a,!0;e.backticks[l]=i}return e.backticksScanned=!0,r||(e.pending+=s),e.pos+=c,!0}],["strikethrough",Be.tokenize],["emphasis",Oe.tokenize],["link",function(e,r){var t,n,s,o,i,a,c,l,u="",p="",h=e.pos,f=e.posMax,d=e.pos,m=!0;if(91!==e.src.charCodeAt(e.pos))return!1;if(i=e.pos+1,(o=e.md.helpers.parseLinkLabel(e,e.pos,!0))<0)return!1;if((a=o+1)<f&&40===e.src.charCodeAt(a)){for(m=!1,a++;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);if(a>=f)return!1;if(d=a,(c=e.md.helpers.parseLinkDestination(e.src,a,e.posMax)).ok){for(u=e.md.normalizeLink(c.str),e.md.validateLink(u)?a=c.pos:u="",d=a;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);if(c=e.md.helpers.parseLinkTitle(e.src,a,e.posMax),a<f&&d!==a&&c.ok)for(p=c.str,a=c.pos;a<f&&(n=e.src.charCodeAt(a),je(n)||10===n);a++);}(a>=f||41!==e.src.charCodeAt(a))&&(m=!0),a++}if(m){if(void 0===e.env.references)return!1;if(a<f&&91===e.src.charCodeAt(a)?(d=a+1,(a=e.md.helpers.parseLinkLabel(e,a))>=0?s=e.src.slice(d,a++):a=o+1):a=o+1,s||(s=e.src.slice(i,o)),!(l=e.env.references[Pe(s)]))return e.pos=h,!1;u=l.href,p=l.title}return r||(e.pos=i,e.posMax=o,e.push("link_open","a",1).attrs=t=[["href",u]],p&&t.push(["title",p]),e.md.inline.tokenize(e),e.push("link_close","a",-1)),e.pos=a,e.posMax=f,!0}],["image",function(e,r){var t,n,s,o,i,a,c,l,u,p,h,f,d,m="",g=e.pos,_=e.posMax;if(33!==e.src.charCodeAt(e.pos))return!1;if(91!==e.src.charCodeAt(e.pos+1))return!1;if(a=e.pos+2,(i=e.md.helpers.parseLinkLabel(e,e.pos+1,!1))<0)return!1;if((c=i+1)<_&&40===e.src.charCodeAt(c)){for(c++;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);if(c>=_)return!1;for(d=c,(u=e.md.helpers.parseLinkDestination(e.src,c,e.posMax)).ok&&(m=e.md.normalizeLink(u.str),e.md.validateLink(m)?c=u.pos:m=""),d=c;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);if(u=e.md.helpers.parseLinkTitle(e.src,c,e.posMax),c<_&&d!==c&&u.ok)for(p=u.str,c=u.pos;c<_&&(n=e.src.charCodeAt(c),Ve(n)||10===n);c++);else p="";if(c>=_||41!==e.src.charCodeAt(c))return e.pos=g,!1;c++}else{if(void 0===e.env.references)return!1;if(c<_&&91===e.src.charCodeAt(c)?(d=c+1,(c=e.md.helpers.parseLinkLabel(e,c))>=0?o=e.src.slice(d,c++):c=i+1):c=i+1,o||(o=e.src.slice(a,i)),!(l=e.env.references[Ue(o)]))return e.pos=g,!1;m=l.href,p=l.title}return r||(s=e.src.slice(a,i),e.md.inline.parse(s,e.md,e.env,f=[]),(h=e.push("image","img",0)).attrs=t=[["src",m],["alt",""]],h.children=f,h.content=s,p&&t.push(["title",p])),e.pos=c,e.posMax=_,!0}],["autolink",function(e,r){var t,n,s,o,i,a,c=e.pos;if(60!==e.src.charCodeAt(c))return!1;for(i=e.pos,a=e.posMax;;){if(++c>=a)return!1;if(60===(o=e.src.charCodeAt(c)))return!1;if(62===o)break}return t=e.src.slice(i+1,c),Ge.test(t)?(n=e.md.normalizeLink(t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0)):!!Ze.test(t)&&(n=e.md.normalizeLink("mailto:"+t),!!e.md.validateLink(n)&&(r||((s=e.push("link_open","a",1)).attrs=[["href",n]],s.markup="autolink",s.info="auto",(s=e.push("text","",0)).content=e.md.normalizeLinkText(t),(s=e.push("link_close","a",-1)).markup="autolink",s.info="auto"),e.pos+=t.length+2,!0))}],["html_inline",function(e,r){var t,n,s,o=e.pos;return!!e.md.options.html&&(s=e.posMax,!(60!==e.src.charCodeAt(o)||o+2>=s)&&(!(33!==(t=e.src.charCodeAt(o+1))&&63!==t&&47!==t&&!function(e){var r=32|e;return r>=97&&r<=122}(t))&&(!!(n=e.src.slice(o).match($e))&&(r||(e.push("html_inline","",0).content=e.src.slice(o,o+n[0].length)),e.pos+=n[0].length,!0))))}],["entity",function(e,t){var n,s,o=e.pos,i=e.posMax;if(38!==e.src.charCodeAt(o))return!1;if(o+1<i)if(35===e.src.charCodeAt(o+1)){if(s=e.src.slice(o).match(Ye))return t||(n="x"===s[1][0].toLowerCase()?parseInt(s[1].slice(1),16):parseInt(s[1],10),e.pending+=Je(n)?We(n):We(65533)),e.pos+=s[0].length,!0}else if((s=e.src.slice(o).match(Ke))&&He(r,s[1]))return t||(e.pending+=r[s[1]]),e.pos+=s[0].length,!0;return t||(e.pending+="&"),e.pos++,!0}]],or=[["balance_pairs",function(e){var r,t=e.tokens_meta,n=e.tokens_meta.length;for(Qe(0,e.delimiters),r=0;r<n;r++)t[r]&&t[r].delimiters&&Qe(0,t[r].delimiters)}],["strikethrough",Be.postProcess],["emphasis",Oe.postProcess],["text_collapse",function(e){var r,t,n=0,s=e.tokens,o=e.tokens.length;for(r=t=0;r<o;r++)s[r].nesting<0&&n--,s[r].level=n,s[r].nesting>0&&n++,"text"===s[r].type&&r+1<o&&"text"===s[r+1].type?s[r+1].content=s[r].content+s[r+1].content:(r!==t&&(s[t]=s[r]),t++);r!==t&&(s.length=t)}]];function ir(){var e;for(this.ruler=new B,e=0;e<sr.length;e++)this.ruler.push(sr[e][0],sr[e][1]);for(this.ruler2=new B,e=0;e<or.length;e++)this.ruler2.push(or[e][0],or[e][1])}ir.prototype.skipToken=function(e){var r,t,n=e.pos,s=this.ruler.getRules(""),o=s.length,i=e.md.options.maxNesting,a=e.cache;if(void 0===a[n]){if(e.level<i)for(t=0;t<o&&(e.level++,r=s[t](e,!0),e.level--,!r);t++);else e.pos=e.posMax;r||e.pos++,a[n]=e.pos}else e.pos=a[n]},ir.prototype.tokenize=function(e){for(var r,t,n=this.ruler.getRules(""),s=n.length,o=e.posMax,i=e.md.options.maxNesting;e.pos<o;){if(e.level<i)for(t=0;t<s&&!(r=n[t](e,!1));t++);if(r){if(e.pos>=o)break}else e.pending+=e.src[e.pos++]}e.pending&&e.pushPending()},ir.prototype.parse=function(e,r,t,n){var s,o,i,a=new this.State(e,r,t,n);for(this.tokenize(a),i=(o=this.ruler2.getRules("")).length,s=0;s<i;s++)o[s](a)},ir.prototype.State=nr;var ar=ir;function cr(e){var r=Array.prototype.slice.call(arguments,1);return r.forEach((function(r){r&&Object.keys(r).forEach((function(t){e[t]=r[t]}))})),e}function lr(e){return Object.prototype.toString.call(e)}function ur(e){return"[object Function]"===lr(e)}function pr(e){return e.replace(/[.?*+^$[\]\\(){}|-]/g,"\\$&")}var hr={fuzzyLink:!0,fuzzyEmail:!0,fuzzyIP:!1};var fr={"http:":{validate:function(e,r,t){var n=e.slice(r);return t.re.http||(t.re.http=new RegExp("^\\/\\/"+t.re.src_auth+t.re.src_host_port_strict+t.re.src_path,"i")),t.re.http.test(n)?n.match(t.re.http)[0].length:0}},"https:":"http:","ftp:":"http:","//":{validate:function(e,r,t){var n=e.slice(r);return t.re.no_http||(t.re.no_http=new RegExp("^"+t.re.src_auth+"(?:localhost|(?:(?:"+t.re.src_domain+")\\.)+"+t.re.src_domain_root+")"+t.re.src_port+t.re.src_host_terminator+t.re.src_path,"i")),t.re.no_http.test(n)?r>=3&&":"===e[r-3]||r>=3&&"/"===e[r-3]?0:n.match(t.re.no_http)[0].length:0}},"mailto:":{validate:function(e,r,t){var n=e.slice(r);return t.re.mailto||(t.re.mailto=new RegExp("^"+t.re.src_email_name+"@"+t.re.src_host_strict,"i")),t.re.mailto.test(n)?n.match(t.re.mailto)[0].length:0}}},dr="biz|com|edu|gov|net|org|pro|web|xxx|aero|asia|coop|info|museum|name|shop|\u0440\u0444".split("|");function mr(e){var r=e.re=function(e){var r={};return r.src_Any=y.source,r.src_Cc=A.source,r.src_Z=x.source,r.src_P=t.source,r.src_ZPCc=[r.src_Z,r.src_P,r.src_Cc].join("|"),r.src_ZCc=[r.src_Z,r.src_Cc].join("|"),r.src_pseudo_letter="(?:(?![><\uff5c]|"+r.src_ZPCc+")"+r.src_Any+")",r.src_ip4="(?:(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)\\.){3}(25[0-5]|2[0-4][0-9]|[01]?[0-9][0-9]?)",r.src_auth="(?:(?:(?!"+r.src_ZCc+"|[@/\\[\\]()]).)+@)?",r.src_port="(?::(?:6(?:[0-4]\\d{3}|5(?:[0-4]\\d{2}|5(?:[0-2]\\d|3[0-5])))|[1-5]?\\d{1,4}))?",r.src_host_terminator="(?=$|[><\uff5c]|"+r.src_ZPCc+")(?!-|_|:\\d|\\.-|\\.(?!$|"+r.src_ZPCc+"))",r.src_path="(?:[/?#](?:(?!"+r.src_ZCc+"|[><\uff5c]|[()[\\]{}.,\"'?!\\-]).|\\[(?:(?!"+r.src_ZCc+"|\\]).)*\\]|\\((?:(?!"+r.src_ZCc+"|[)]).)*\\)|\\{(?:(?!"+r.src_ZCc+'|[}]).)*\\}|\\"(?:(?!'+r.src_ZCc+'|["]).)+\\"|\\\'(?:(?!'+r.src_ZCc+"|[']).)+\\'|\\'(?="+r.src_pseudo_letter+"|[-]).|\\.{2,}[a-zA-Z0-9%/&]|\\.(?!"+r.src_ZCc+"|[.]).|"+(e&&e["---"]?"\\-(?!--(?:[^-]|$))(?:-*)|":"\\-+|")+"\\,(?!"+r.src_ZCc+").|\\!+(?!"+r.src_ZCc+"|[!]).|\\?(?!"+r.src_ZCc+"|[?]).)+|\\/)?",r.src_email_name='[\\-;:&=\\+\\$,\\.a-zA-Z0-9_][\\-;:&=\\+\\$,\\"\\.a-zA-Z0-9_]*',r.src_xn="xn--[a-z0-9\\-]{1,59}",r.src_domain_root="(?:"+r.src_xn+"|"+r.src_pseudo_letter+"{1,63})",r.src_domain="(?:"+r.src_xn+"|(?:"+r.src_pseudo_letter+")|(?:"+r.src_pseudo_letter+"(?:-|"+r.src_pseudo_letter+"){0,61}"+r.src_pseudo_letter+"))",r.src_host="(?:(?:(?:(?:"+r.src_domain+")\\.)*"+r.src_domain+"))",r.tpl_host_fuzzy="(?:"+r.src_ip4+"|(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%)))",r.tpl_host_no_ip_fuzzy="(?:(?:(?:"+r.src_domain+")\\.)+(?:%TLDS%))",r.src_host_strict=r.src_host+r.src_host_terminator,r.tpl_host_fuzzy_strict=r.tpl_host_fuzzy+r.src_host_terminator,r.src_host_port_strict=r.src_host+r.src_port+r.src_host_terminator,r.tpl_host_port_fuzzy_strict=r.tpl_host_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_port_no_ip_fuzzy_strict=r.tpl_host_no_ip_fuzzy+r.src_port+r.src_host_terminator,r.tpl_host_fuzzy_test="localhost|www\\.|\\.\\d{1,3}\\.|(?:\\.(?:%TLDS%)(?:"+r.src_ZPCc+"|>|$))",r.tpl_email_fuzzy='(^|[><\uff5c]|"|\\(|'+r.src_ZCc+")("+r.src_email_name+"@"+r.tpl_host_fuzzy_strict+")",r.tpl_link_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_fuzzy_strict+r.src_path+")",r.tpl_link_no_ip_fuzzy="(^|(?![.:/\\-_@])(?:[$+<=>^`|\uff5c]|"+r.src_ZPCc+"))((?![$+<=>^`|\uff5c])"+r.tpl_host_port_no_ip_fuzzy_strict+r.src_path+")",r}(e.__opts__),n=e.__tlds__.slice();function s(e){return e.replace("%TLDS%",r.src_tlds)}e.onCompile(),e.__tlds_replaced__||n.push("a[cdefgilmnoqrstuwxz]|b[abdefghijmnorstvwyz]|c[acdfghiklmnoruvwxyz]|d[ejkmoz]|e[cegrstu]|f[ijkmor]|g[abdefghilmnpqrstuwy]|h[kmnrtu]|i[delmnoqrst]|j[emop]|k[eghimnprwyz]|l[abcikrstuvy]|m[acdeghklmnopqrstuvwxyz]|n[acefgilopruz]|om|p[aefghklmnrstwy]|qa|r[eosuw]|s[abcdeghijklmnortuvxyz]|t[cdfghjklmnortvwz]|u[agksyz]|v[aceginu]|w[fs]|y[et]|z[amw]"),n.push(r.src_xn),r.src_tlds=n.join("|"),r.email_fuzzy=RegExp(s(r.tpl_email_fuzzy),"i"),r.link_fuzzy=RegExp(s(r.tpl_link_fuzzy),"i"),r.link_no_ip_fuzzy=RegExp(s(r.tpl_link_no_ip_fuzzy),"i"),r.host_fuzzy_test=RegExp(s(r.tpl_host_fuzzy_test),"i");var o=[];function i(e,r){throw new Error('(LinkifyIt) Invalid schema "'+e+'": '+r)}e.__compiled__={},Object.keys(e.__schemas__).forEach((function(r){var t=e.__schemas__[r];if(null!==t){var n={validate:null,link:null};if(e.__compiled__[r]=n,"[object Object]"===lr(t))return!function(e){return"[object RegExp]"===lr(e)}(t.validate)?ur(t.validate)?n.validate=t.validate:i(r,t):n.validate=function(e){return function(r,t){var n=r.slice(t);return e.test(n)?n.match(e)[0].length:0}}(t.validate),void(ur(t.normalize)?n.normalize=t.normalize:t.normalize?i(r,t):n.normalize=function(e,r){r.normalize(e)});!function(e){return"[object String]"===lr(e)}(t)?i(r,t):o.push(r)}})),o.forEach((function(r){e.__compiled__[e.__schemas__[r]]&&(e.__compiled__[r].validate=e.__compiled__[e.__schemas__[r]].validate,e.__compiled__[r].normalize=e.__compiled__[e.__schemas__[r]].normalize)})),e.__compiled__[""]={validate:null,normalize:function(e,r){r.normalize(e)}};var a=Object.keys(e.__compiled__).filter((function(r){return r.length>0&&e.__compiled__[r]})).map(pr).join("|");e.re.schema_test=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","i"),e.re.schema_search=RegExp("(^|(?!_)(?:[><\uff5c]|"+r.src_ZPCc+"))("+a+")","ig"),e.re.pretest=RegExp("("+e.re.schema_test.source+")|("+e.re.host_fuzzy_test.source+")|@","i"),function(e){e.__index__=-1,e.__text_cache__=""}(e)}function gr(e,r){var t=e.__index__,n=e.__last_index__,s=e.__text_cache__.slice(t,n);this.schema=e.__schema__.toLowerCase(),this.index=t+r,this.lastIndex=n+r,this.raw=s,this.text=s,this.url=s}function _r(e,r){var t=new gr(e,r);return e.__compiled__[t.schema].normalize(t,e),t}function br(e,r){if(!(this instanceof br))return new br(e,r);var t;r||(t=e,Object.keys(t||{}).reduce((function(e,r){return e||hr.hasOwnProperty(r)}),!1)&&(r=e,e={})),this.__opts__=cr({},hr,r),this.__index__=-1,this.__last_index__=-1,this.__schema__="",this.__text_cache__="",this.__schemas__=cr({},fr,e),this.__compiled__={},this.__tlds__=dr,this.__tlds_replaced__=!1,this.re={},mr(this)}br.prototype.add=function(e,r){return this.__schemas__[e]=r,mr(this),this},br.prototype.set=function(e){return this.__opts__=cr(this.__opts__,e),this},br.prototype.test=function(e){if(this.__text_cache__=e,this.__index__=-1,!e.length)return!1;var r,t,n,s,o,i,a,c;if(this.re.schema_test.test(e))for((a=this.re.schema_search).lastIndex=0;null!==(r=a.exec(e));)if(s=this.testSchemaAt(e,r[2],a.lastIndex)){this.__schema__=r[2],this.__index__=r.index+r[1].length,this.__last_index__=r.index+r[0].length+s;break}return this.__opts__.fuzzyLink&&this.__compiled__["http:"]&&(c=e.search(this.re.host_fuzzy_test))>=0&&(this.__index__<0||c<this.__index__)&&null!==(t=e.match(this.__opts__.fuzzyIP?this.re.link_fuzzy:this.re.link_no_ip_fuzzy))&&(o=t.index+t[1].length,(this.__index__<0||o<this.__index__)&&(this.__schema__="",this.__index__=o,this.__last_index__=t.index+t[0].length)),this.__opts__.fuzzyEmail&&this.__compiled__["mailto:"]&&e.indexOf("@")>=0&&null!==(n=e.match(this.re.email_fuzzy))&&(o=n.index+n[1].length,i=n.index+n[0].length,(this.__index__<0||o<this.__index__||o===this.__index__&&i>this.__last_index__)&&(this.__schema__="mailto:",this.__index__=o,this.__last_index__=i)),this.__index__>=0},br.prototype.pretest=function(e){return this.re.pretest.test(e)},br.prototype.testSchemaAt=function(e,r,t){return this.__compiled__[r.toLowerCase()]?this.__compiled__[r.toLowerCase()].validate(e,t,this):0},br.prototype.match=function(e){var r=0,t=[];this.__index__>=0&&this.__text_cache__===e&&(t.push(_r(this,r)),r=this.__last_index__);for(var n=r?e.slice(r):e;this.test(n);)t.push(_r(this,r)),n=n.slice(this.__last_index__),r+=this.__last_index__;return t.length?t:null},br.prototype.tlds=function(e,r){return e=Array.isArray(e)?e:[e],r?(this.__tlds__=this.__tlds__.concat(e).sort().filter((function(e,r,t){return e!==t[r-1]})).reverse(),mr(this),this):(this.__tlds__=e.slice(),this.__tlds_replaced__=!0,mr(this),this)},br.prototype.normalize=function(e){e.schema||(e.url="http://"+e.url),"mailto:"!==e.schema||/^mailto:/i.test(e.url)||(e.url="mailto:"+e.url)},br.prototype.onCompile=function(){};var kr=br,vr=2147483647,Cr=36,yr=/^xn--/,Ar=/[^\x20-\x7E]/,xr=/[\x2E\u3002\uFF0E\uFF61]/g,Dr={overflow:"Overflow: input needs wider integers to process","not-basic":"Illegal input >= 0x80 (not a basic code point)","invalid-input":"Invalid input"},wr=Math.floor,Er=String.fromCharCode; /*! https://mths.be/punycode v1.4.1 by @mathias */function qr(e){throw new RangeError(Dr[e])}function Sr(e,r){for(var t=e.length,n=[];t--;)n[t]=r(e[t]);return n}function Fr(e,r){var t=e.split("@"),n="";return t.length>1&&(n=t[0]+"@",e=t[1]),n+Sr((e=e.replace(xr,".")).split("."),r).join(".")}function Lr(e){for(var r,t,n=[],s=0,o=e.length;s<o;)(r=e.charCodeAt(s++))>=55296&&r<=56319&&s<o?56320==(64512&(t=e.charCodeAt(s++)))?n.push(((1023&r)<<10)+(1023&t)+65536):(n.push(r),s--):n.push(r);return n}function zr(e){return Sr(e,(function(e){var r="";return e>65535&&(r+=Er((e-=65536)>>>10&1023|55296),e=56320|1023&e),r+=Er(e)})).join("")}function Tr(e,r){return e+22+75*(e<26)-((0!=r)<<5)}function Ir(e,r,t){var n=0;for(e=t?wr(e/700):e>>1,e+=wr(e/r);e>455;n+=Cr)e=wr(e/35);return wr(n+36*e/(e+38))}function Mr(e){var r,t,n,s,o,i,a,c,l,u,p,h=[],f=e.length,d=0,m=128,g=72;for((t=e.lastIndexOf("-"))<0&&(t=0),n=0;n<t;++n)e.charCodeAt(n)>=128&&qr("not-basic"),h.push(e.charCodeAt(n));for(s=t>0?t+1:0;s<f;){for(o=d,i=1,a=Cr;s>=f&&qr("invalid-input"),((c=(p=e.charCodeAt(s++))-48<10?p-22:p-65<26?p-65:p-97<26?p-97:Cr)>=Cr||c>wr((vr-d)/i))&&qr("overflow"),d+=c*i,!(c<(l=a<=g?1:a>=g+26?26:a-g));a+=Cr)i>wr(vr/(u=Cr-l))&&qr("overflow"),i*=u;g=Ir(d-o,r=h.length+1,0==o),wr(d/r)>vr-m&&qr("overflow"),m+=wr(d/r),d%=r,h.splice(d++,0,m)}return zr(h)}function Rr(e){var r,t,n,s,o,i,a,c,l,u,p,h,f,d,m,g=[];for(h=(e=Lr(e)).length,r=128,t=0,o=72,i=0;i<h;++i)(p=e[i])<128&&g.push(Er(p));for(n=s=g.length,s&&g.push("-");n<h;){for(a=vr,i=0;i<h;++i)(p=e[i])>=r&&p<a&&(a=p);for(a-r>wr((vr-t)/(f=n+1))&&qr("overflow"),t+=(a-r)*f,r=a,i=0;i<h;++i)if((p=e[i])<r&&++t>vr&&qr("overflow"),p==r){for(c=t,l=Cr;!(c<(u=l<=o?1:l>=o+26?26:l-o));l+=Cr)m=c-u,d=Cr-u,g.push(Er(Tr(u+m%d,0))),c=wr(m/d);g.push(Er(Tr(c,0))),o=Ir(t,f,n==s),t=0,++n}++t,++r}return g.join("")}function Br(e){return Fr(e,(function(e){return yr.test(e)?Mr(e.slice(4).toLowerCase()):e}))}function Nr(e){return Fr(e,(function(e){return Ar.test(e)?"xn--"+Rr(e):e}))}var Or="1.4.1",Pr={decode:Lr,encode:zr},jr={version:Or,ucs2:Pr,toASCII:Nr,toUnicode:Br,encode:Rr,decode:Mr},Ur=e(Object.freeze({__proto__:null,decode:Mr,encode:Rr,toUnicode:Br,toASCII:Nr,version:Or,ucs2:Pr,default:jr})),Vr={default:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:100},components:{core:{},block:{},inline:{}}},zero:{options:{html:!1,xhtmlOut:!1,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["paragraph"]},inline:{rules:["text"],rules2:["balance_pairs","text_collapse"]}}},commonmark:{options:{html:!0,xhtmlOut:!0,breaks:!1,langPrefix:"language-",linkify:!1,typographer:!1,quotes:"\u201c\u201d\u2018\u2019",highlight:null,maxNesting:20},components:{core:{rules:["normalize","block","inline"]},block:{rules:["blockquote","code","fence","heading","hr","html_block","lheading","list","reference","paragraph"]},inline:{rules:["autolink","backticks","emphasis","entity","escape","html_inline","image","link","newline","text"],rules2:["balance_pairs","emphasis","text_collapse"]}}}},Zr=/^(vbscript|javascript|file|data):/,Gr=/^data:image\/(gif|png|jpeg|webp);/;function $r(e){var r=e.trim().toLowerCase();return!Zr.test(r)||!!Gr.test(r)}var Hr=["http:","https:","mailto:"];function Jr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Hr.indexOf(r.protocol)>=0))try{r.hostname=Ur.toASCII(r.hostname)}catch(e){}return C.encode(C.format(r))}function Wr(e){var r=C.parse(e,!0);if(r.hostname&&(!r.protocol||Hr.indexOf(r.protocol)>=0))try{r.hostname=Ur.toUnicode(r.hostname)}catch(e){}return C.decode(C.format(r),C.decode.defaultChars+"%")}function Yr(e,r){if(!(this instanceof Yr))return new Yr(e,r);r||w.isString(e)||(r=e||{},e="default"),this.inline=new ar,this.block=new Fe,this.core=new ce,this.renderer=new M,this.linkify=new kr,this.validateLink=$r,this.normalizeLink=Jr,this.normalizeLinkText=Wr,this.utils=w,this.helpers=w.assign({},S),this.options={},this.configure(e),r&&this.set(r)}return Yr.prototype.set=function(e){return w.assign(this.options,e),this},Yr.prototype.configure=function(e){var r,t=this;if(w.isString(e)&&!(e=Vr[r=e]))throw new Error('Wrong `markdown-it` preset "'+r+'", check name');if(!e)throw new Error("Wrong `markdown-it` preset, can't be empty");return e.options&&t.set(e.options),e.components&&Object.keys(e.components).forEach((function(r){e.components[r].rules&&t[r].ruler.enableOnly(e.components[r].rules),e.components[r].rules2&&t[r].ruler2.enableOnly(e.components[r].rules2)})),this},Yr.prototype.enable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.enable(e,!0))}),this),t=t.concat(this.inline.ruler2.enable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to enable unknown rule(s): "+n);return this},Yr.prototype.disable=function(e,r){var t=[];Array.isArray(e)||(e=[e]),["core","block","inline"].forEach((function(r){t=t.concat(this[r].ruler.disable(e,!0))}),this),t=t.concat(this.inline.ruler2.disable(e,!0));var n=e.filter((function(e){return t.indexOf(e)<0}));if(n.length&&!r)throw new Error("MarkdownIt. Failed to disable unknown rule(s): "+n);return this},Yr.prototype.use=function(e){var r=[this].concat(Array.prototype.slice.call(arguments,1));return e.apply(e,r),this},Yr.prototype.parse=function(e,r){if("string"!=typeof e)throw new Error("Input data should be a String");var t=new this.core.State(e,this,r);return this.core.process(t),t.tokens},Yr.prototype.render=function(e,r){return r=r||{},this.renderer.render(this.parse(e,r),this.options,r)},Yr.prototype.parseInline=function(e,r){var t=new this.core.State(e,this,r);return t.inlineMode=!0,this.core.process(t),t.tokens},Yr.prototype.renderInline=function(e,r){return r=r||{},this.renderer.render(this.parseInline(e,r),this.options,r)},Yr})); clsx.js 0000664 00000001225 15105462305 0006056 0 ustar 00 function toVal(mix) { var k, y, str=''; if (typeof mix === 'string' || typeof mix === 'number') { str += mix; } else if (typeof mix === 'object') { if (Array.isArray(mix)) { for (k=0; k < mix.length; k++) { if (mix[k]) { if (y = toVal(mix[k])) { str && (str += ' '); str += y; } } } } else { for (k in mix) { if (mix[k]) { str && (str += ' '); str += k; } } } } return str; } module.exports = function () { var i=0, tmp, x, str=''; while (i < arguments.length) { if (tmp = arguments[i++]) { if (x = toVal(tmp)) { str && (str += ' '); str += x } } } return str; } clsx.m.js 0000664 00000001223 15105462305 0006307 0 ustar 00 function toVal(mix) { var k, y, str=''; if (typeof mix === 'string' || typeof mix === 'number') { str += mix; } else if (typeof mix === 'object') { if (Array.isArray(mix)) { for (k=0; k < mix.length; k++) { if (mix[k]) { if (y = toVal(mix[k])) { str && (str += ' '); str += y; } } } } else { for (k in mix) { if (mix[k]) { str && (str += ' '); str += k; } } } } return str; } export default function () { var i=0, tmp, x, str=''; while (i < arguments.length) { if (tmp = arguments[i++]) { if (x = toVal(tmp)) { str && (str += ' '); str += x } } } return str; } clsx.min.js 0000664 00000001005 15105462305 0006634 0 ustar 00 !function(e,n){"object"==typeof exports&&"undefined"!=typeof module?module.exports=n():"function"==typeof define&&define.amd?define(n):e.clsx=n()}(this,(function(){function e(n){var t,f,o="";if("string"==typeof n||"number"==typeof n)o+=n;else if("object"==typeof n)if(Array.isArray(n))for(t=0;t<n.length;t++)n[t]&&(f=e(n[t]))&&(o&&(o+=" "),o+=f);else for(t in n)n[t]&&(o&&(o+=" "),o+=t);return o}return function(){for(var n,t,f=0,o="";f<arguments.length;)(n=arguments[f++])&&(t=e(n))&&(o&&(o+=" "),o+=t);return o}}));
| ver. 1.4 |
Github
|
.
| PHP 8.1.33 | Генерация страницы: 0.06 |
proxy
|
phpinfo
|
Настройка